package com.atlassian.uwc.ui; | |
import java.io.File; | |
import java.io.FileFilter; | |
import java.io.FileInputStream; | |
import java.io.FileNotFoundException; | |
import java.io.IOException; | |
import java.io.UnsupportedEncodingException; | |
import java.text.DateFormat; | |
import java.text.SimpleDateFormat; | |
import java.util.ArrayList; | |
import java.util.Collections; | |
import java.util.Comparator; | |
import java.util.Date; | |
import java.util.HashMap; | |
import java.util.HashSet; | |
import java.util.Hashtable; | |
import java.util.Iterator; | |
import java.util.LinkedList; | |
import java.util.List; | |
import java.util.Map; | |
import java.util.Properties; | |
import java.util.Set; | |
import java.util.TimeZone; | |
import java.util.TreeSet; | |
import java.util.Vector; | |
import java.util.regex.Matcher; | |
import java.util.regex.Pattern; | |
import javax.activation.MimetypesFileTypeMap; | |
import org.apache.log4j.Logger; | |
import org.apache.xmlrpc.XmlRpcException; | |
import biz.artemis.confluence.xmlrpcwrapper.AttachmentForXmlRpc; | |
import biz.artemis.confluence.xmlrpcwrapper.BlogForXmlRpc; | |
import biz.artemis.confluence.xmlrpcwrapper.CommentForXmlRpc; | |
import biz.artemis.confluence.xmlrpcwrapper.ConfluenceServerSettings; | |
import biz.artemis.confluence.xmlrpcwrapper.PageForXmlRpc; | |
import biz.artemis.confluence.xmlrpcwrapper.RemoteWikiBroker; | |
import biz.artemis.confluence.xmlrpcwrapper.SpaceForXmlRpc; | |
import biz.artemis.confluence.xmlrpcwrapper.SpaceForXmlRpc.SpaceType; | |
import com.atlassian.uwc.converters.Converter; | |
import com.atlassian.uwc.converters.IllegalLinkNameConverter; | |
import com.atlassian.uwc.converters.IllegalPageNameConverter; | |
import com.atlassian.uwc.converters.JavaRegexConverter; | |
import com.atlassian.uwc.converters.PerlConverter; | |
import com.atlassian.uwc.converters.twiki.JavaRegexAndTokenizerConverter; | |
import com.atlassian.uwc.converters.twiki.TWikiRegexConverterCleanerWrapper; | |
import com.atlassian.uwc.converters.xml.DefaultXmlEvents; | |
import com.atlassian.uwc.converters.xml.XmlEvents; | |
import com.atlassian.uwc.filters.FilterChain; | |
import com.atlassian.uwc.hierarchies.HierarchyBuilder; | |
import com.atlassian.uwc.hierarchies.HierarchyNode; | |
import com.atlassian.uwc.splitters.PageSplitter; | |
import com.atlassian.uwc.ui.listeners.FeedbackHandler; | |
import com.atlassian.uwc.ui.listeners.TestSettingsListener; | |
/** | |
* This class drives the conversion process by gathering all the files, gathering | |
* the selected converters, then applying all the converters against each file, then | |
* sending the converted 'Pages' and attachments to Confluence via XML-RPC (or | |
* possibly some other method in the future) | |
*/ | |
public class ConverterEngine implements FeedbackHandler { | |
/* START CONSTANTS */ | |
private static final int NUM_REQ_CONVERTERS = 2; | |
private static final String REQUIRED_CONVERTER_ILLEGAL_LINKS = "MyWiki.9999.illegal-links.class=com.atlassian.uwc.converters.IllegalLinkNameConverter"; | |
private static final String REQUIRED_CONVERTER_ILLEGAL_NAMES = "MyWiki.9999.illegal-names.class=com.atlassian.uwc.converters.IllegalPageNameConverter"; | |
private static final String NONCONVERTERTYPE_PAGEHISTORYPRESERVATION = "page-history-preservation"; | |
private static final String NONCONVERTERTYPE_HIERARCHYBUILDER = ".hierarchy-builder"; | |
private static final String NONCONVERTERTYPE_ILLEGALHANDLING = "illegal-handling"; | |
private static final String NONCONVERTERTYPE_AUTODETECTSPACEKEYS = "autodetect-spacekeys"; | |
private static final String NONCONVERTERTYPE_MISCPROPERTIES = ".property"; | |
private static final String NONCONVERTERTYPE_FILTERS = ".filter"; | |
private static final String NONCONVERTERTYPE_XMLEVENT = ".xmlevent"; | |
private static final String CONVERTERTYPE_TWIKICLEANER = ".twiki-cleaner"; | |
private static final String CONVERTERTYPE_JAVAREGEX = ".java-regex"; | |
private static final String CONVERTERTYPE_JAVAREGEXTOKEN = ".java-regex-tokenize"; | |
private static final String CONVERTERTYPE_PERL = ".perl"; | |
private static final String CONVERTERTYPE_CLASS = ".class"; | |
private static final String XMLEVENT_PROP_ERROR = "Xmlevent Property must follow this format convention: {tag}xmltag{class}com.something.Class"; | |
private static final String PROP_ATTACHMENT_SIZE_MAX = "attachment.size.max"; | |
private static final int DEFAULT_NUM_STEPS = 1000; | |
private static final String ORPHAN_ATTACHMENTS_PAGE_TITLE="Orphan attachments"; | |
private static final String DEFAULT_ATTACHMENT_UPLOAD_COMMENT = "Added by UWC, the Universal Wiki Converter"; | |
public static final String PROPKEY_ENGINE_SAVES_TO_DISK = "engine-saves-to-disk"; | |
/* START FIELDS */ | |
public boolean running = false; //Methods check this to see if the conversion needs to be cancelled | |
/** | |
* used to disable check for illegal names and links. | |
* We want to allow users to override this so they can handle it themselves | |
* with converters. | |
*/ | |
private boolean illegalHandlingEnabled = false; //default = false, as of Confluence 4.2 doesn't appear to be necessary | |
private boolean autoDetectSpacekeys = false; //default = false | |
private HashSet<String> attachedFiles; | |
Logger log = Logger.getLogger(this.getClass()); | |
// this logger is used to write out totals for the UWC to a seperate file uwc-totals.log | |
Logger totalsFileLog = Logger.getLogger("totalsFileLog"); | |
/** | |
* The string that directory separators (e.g., / on Unix and \ on Windows) are replaced | |
* with in page titles. | |
* This is used by DokuWikiLinkConverter too. | |
*/ | |
public static final String CONFLUENCE_SEPARATOR = " -- "; | |
protected enum HierarchyHandler { | |
DEFAULT, //no hierarchy handling | |
HIERARCHY_BUILDER, //hierarchyBuilder handles | |
PAGENAME_HIERARCHIES//hierarchy maintained in pagename | |
} | |
private HierarchyHandler hierarchyHandler = HierarchyHandler.DEFAULT; | |
/** | |
* The mapping from file name extension to mime type that is used when sending | |
* attachments to Confluence. | |
* NOTE: static so that other files can get access to this easily. | |
*/ | |
private static MimetypesFileTypeMap mimeTypes; | |
/** | |
* This is the location of the mime type mapping file. For details on the file format, | |
* refer to the link below. | |
* | |
* @see javax.activation.MimetypesFileTypeMap | |
*/ | |
public final static String mimetypeFileLoc = "conf" + File.separator + "mime.types"; | |
/** | |
* This field is set if a hierarchy builder "converter" is used. The field controls the | |
* way in which pages are added/updated in Confluence. If hierarchyBuilder is <code>null</code>, all | |
* pages are added as top-level pages in the selected space. Otherwise, the hierarchy builder is | |
* called on to create a page hierarchy, and the engine will insert the pages correspondingly. | |
*/ | |
private HierarchyBuilder hierarchyBuilder = null; | |
private UWCUserSettings settings; | |
private State state; | |
private Properties miscProperties = new Properties(); //instantiate this here - UWC-293 | |
private Set<String> filterValues; | |
/** | |
* the number of properties that are not converters from the properties file. | |
* When we set up the progress bar, we calculate the max number of steps | |
* we're going to encounter with the number of properties that could be converters. | |
* But we update the progress bar a step only foreach converter property. So, we'll use | |
* this field to update the progress bar the extra amount. | |
*/ | |
private int numNonConverterProperties; | |
private Feedback feedback; | |
private int newNodes; | |
HashMap<String, Converter> converterCacheMap = new HashMap<String, Converter>(); | |
private long startTotalConvertTime; | |
//Error handlers | |
private ConverterErrors errors = new ConverterErrors(); | |
private boolean hadConverterErrors; | |
private HashMap<String, String> homepages = new HashMap<String, String>(); | |
/* START CONSTRUCTORS */ | |
/** | |
* This default constructor initializes the mime types. | |
*/ | |
public ConverterEngine() { | |
try { | |
mimeTypes = new MimetypesFileTypeMap(new FileInputStream(mimetypeFileLoc)); | |
} catch (FileNotFoundException e) { | |
String note = "Couldn't load mime types!"; | |
log.error(note, e); | |
this.errors.addError(Feedback.BAD_SETTINGS_FILE, note, false); | |
} | |
totalsFileLog.setAdditivity(false); | |
} | |
/* START METHODS */ | |
/** | |
* converts the files with the converterstrings, and hooks any feedback into the given ui | |
* @param inputPages pages from the filesystem to be converted | |
* @param converterStrings list of converters as strings which will be run on the pages | |
* @param sendToConfluence true if the pages should be uploaded to confluence | |
* @param wikitype The wiki type that's being converted into Confluence, ex: Mediawiki | |
*/ | |
public void convert(List<File> inputPages, List<String> converterStrings, UWCUserSettings settings) { | |
//setup | |
this.running = true; | |
resetFeedback(); | |
resetErrorHandlers(); | |
resetHierarchy(); | |
//settings | |
boolean sendToConfluence = Boolean.parseBoolean(settings.getSendToConfluence()); | |
this.settings = settings; | |
if (!this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return; | |
} | |
//convert | |
convert(inputPages, converterStrings, sendToConfluence, settings.getPattern()); | |
//cleanup | |
if (this.feedback == Feedback.NONE) | |
this.feedback = Feedback.OK; | |
this.running = false; | |
} | |
/** | |
* cancels the conversion | |
*/ | |
public void cancel() { | |
String message = "Engine - Sending Cancel Signal"; | |
log.debug(message); | |
this.state.updateNote(message); | |
this.running = false; | |
} | |
/** | |
* gets a new State object. | |
* The State object will be used by the converter engine to measure progress. | |
* @param inputPages list of pages | |
* @param converterStrings list of converters | |
* @param settings settings | |
* @return the state object the engine uses | |
*/ | |
public State getState(List<File> inputPages, List<String> converterStrings, UWCUserSettings settings) { | |
//The inputPages and converterString objects do not approximate the number of steps well because | |
//inputPages includes directories which are counted as 1 object in the inputPages list, and | |
//converterStrings includes non-converter properties. So, for now we'll use a default value to set up | |
//the state. | |
// int steps = | |
// getNumberOfSteps( | |
// inputPages, | |
// converterStrings, | |
// Boolean.parseBoolean(settings.getSendToConfluence()) | |
// ); | |
return getState(settings); | |
} | |
/** | |
* gets a new State object, using a default number of steps. | |
* The State object will be used by the converter engine to measure progress. | |
* @param settings | |
* @return | |
*/ | |
public State getState(UWCUserSettings settings) { | |
int steps = DEFAULT_NUM_STEPS; | |
String initialMessage = "Converting Wiki\n" + | |
"Wikitype = " + settings.getWikitype() + "\n"; | |
this.state = new State(initialMessage, 0, steps); | |
return state; | |
} | |
/** | |
* gets the number of steps for the given pages and converters lists | |
* @param pages list of objects representing pages. Can be any object: String, Page, etc. | |
* @param converters list of objects representing pages. Can be any object: String, Converter, etc. | |
* @param sendToConfluence true, if the conversion will upload the objects to confluence | |
* @return the number of steps that the engine will measure progress against | |
*/ | |
protected int getNumberOfSteps(List pages, List converters, boolean sendToConfluence) { | |
return getNumberOfSteps(pages.size(), converters.size(), sendToConfluence); | |
} | |
/** | |
* Counts the number of steps needed to do the entire conversion from start to finish. | |
* Here are the steps: | |
* 1. init converters - number of converters | |
* 2. create page objects - number of pages | |
* 3. convert the files - num of converterstrings * num of pages (or num of pages) | |
* 4. convert with required converters - num of pages | |
* 5. save pages - num of pages | |
* 6. upload pages (if send to confluence) num of pages, or 0 | |
* @param pages number of pages | |
* @param converters number of converters | |
* @param sendToConfluence true if sending pages to confluence | |
* @return number of steps for performing conversion from start to finish | |
*/ | |
private int getNumberOfSteps(int pages, int converters, boolean sendToConfluence) { | |
return getNumberOfSteps(pages, converters, converters, sendToConfluence); | |
} | |
/** | |
* Counts the number of steps needed to do an entire conversion from start to finish. | |
* Used with progress monitor | |
* @param pages number of pages | |
* @param properties number of all converter file properties (including non-converter properties) | |
* @param converters number of converters | |
* @param sendToConfluence true if sending pages to Confluence | |
* @return number of steps for performing conversion from start to finish | |
*/ | |
private int getNumberOfSteps(int pages, int properties, int converters, boolean sendToConfluence) { | |
return getNumberOfSteps(pages, pages, properties, converters, sendToConfluence); | |
} | |
/** | |
* Counts the number of steps needed to do an entire conversion from start to finish. | |
* Used with progress monitor | |
* @param files number of files or directories chosen by the user. Does not count contents of directories seperately. | |
* @param pages number of individual pages that will be converted | |
* @param properties number of all converter file properties (including non-converter properties) | |
* @param converters number of converters | |
* @param sendToConfluence true if sending pages to Confluence | |
* @return number of steps for performing conversion from start to finish | |
*/ | |
private int getNumberOfSteps(int files, int pages, int properties, int converters, boolean sendToConfluence) { | |
int numReqConverters = isIllegalHandlingEnabled()?NUM_REQ_CONVERTERS:0; | |
int steps = | |
properties + //1. initialize converters (handles both converter and non-converter properties) | |
files + //2. create page objects (uses the original list of chosen file objects) | |
(converters * pages) + //3. convert the files (uses the number of page objects) | |
(numReqConverters) + //4. create required converters (2, right now) | |
(numReqConverters * pages) + //5. convert with required converters (2, right now) | |
pages + //6. save the files | |
(sendToConfluence?pages:0); //7. upload pages if sendToConfluence | |
return steps; | |
} | |
/** | |
* converts the given pages using the given converterStrings, and sends the pages | |
* to Confluence, if sendToConfluence is true. | |
* @param pages | |
* @param converterStrings | |
* @param sendToConfluence | |
*/ | |
public void convert(List<File> pages, List<String> converterStrings, boolean sendToConfluence) { | |
convert(pages, converterStrings, sendToConfluence, ""); | |
} | |
/** | |
* converts the given pages not filtered out with the given filterPattern | |
* using the given converterStrings, and sends the pages to Confluence, | |
* if sendToConfluence is true | |
* @param pages | |
* @param converterStrings | |
* @param sendToConfluence | |
* @param filterPattern ignores files with this filter pattern | |
*/ | |
public void convert(List<File> pages, List<String> converterStrings, boolean sendToConfluence, String filterPattern) { | |
log.info("Starting conversion."); | |
initConversion(); | |
//create converters | |
ArrayList<Converter> converters = createConverters(converterStrings); | |
//create page objects - Recurse through directories, adding all files | |
FileFilter filter = createFilter(filterPattern); | |
List<Page> allPages = createPages(filter, pages); | |
//fix progressbar max, which is dependent on the previous two lists | |
int steps = getNumberOfSteps(pages.size(), allPages.size(), converterStrings.size(), converters.size(), sendToConfluence); | |
this.state.updateMax(steps); | |
//convert the files | |
if (convertPages(allPages, converters)) { | |
//in case converting the pages disqualified some pages, we need to break if there are no pages left | |
if (allPages.size() < 1) { | |
String message = "All pages submitted were disqualified for various reasons. Could not complete conversion."; | |
log.warn(message); | |
this.errors.addError(Feedback.CONVERTER_ERROR, message, true); | |
this.state.updateMax(this.state.getStep()); //complete progress bar, prematurely | |
return; | |
} | |
//in case converting the pages disqualified some pages, we need to recompute progressbarmax | |
steps = getNumberOfSteps(pages.size(), allPages.size(), converterStrings.size(), converters.size(), sendToConfluence); | |
if (steps != this.state.getMax()) this.state.updateMax(steps); | |
// do final required conversions. This step is seperate, due to state saving issues | |
convertWithRequiredConverters(allPages); | |
//save pages if engine-saves-to-disk property is true. Useful for debugging. | |
//We are making this opt-in because users that don't need it will get a speed boost with fewer disk calls | |
if (Boolean.parseBoolean(this.miscProperties.getProperty(PROPKEY_ENGINE_SAVES_TO_DISK, "false"))) | |
savePages(allPages, filterPattern); | |
else log.debug("Engine Saves To Disk setting turned off."); | |
//check for namespace collisions and emit errors if found | |
listCollisions(allPages); | |
//handling page histories and not sorting on create | |
if (isHandlingPageHistories() && | |
!(isPageHistorySortOnCreate())) { | |
allPages = sortByHistory(allPages); | |
} | |
//upload pages, if the user approves | |
if (sendToConfluence && this.running) { | |
if (hierarchyHandler == HierarchyHandler.HIERARCHY_BUILDER && hierarchyBuilder != null) { | |
//tell the hierarchy builder about the page histories framework | |
//do this here so that we're sure the page histories properties are set | |
if (hierarchyBuilder.getProperties() != null) { | |
hierarchyBuilder.getProperties().setProperty("switch."+NONCONVERTERTYPE_PAGEHISTORYPRESERVATION, isHandlingPageHistories()+""); | |
if (getPageHistorySuffix() != null) | |
hierarchyBuilder.getProperties().setProperty("suffix."+NONCONVERTERTYPE_PAGEHISTORYPRESERVATION, getPageHistorySuffix()); | |
} | |
//tell the hierarchy some other information | |
if (hierarchyBuilder.getProperties() != null) { | |
hierarchyBuilder.getProperties().setProperty("spacekey", settings.getSpace()); | |
} | |
//build the hierarchy | |
HierarchyNode root = hierarchyBuilder.buildHierarchy(allPages); | |
writeHierarchy(root, allPages.size(), settings.getSpace()); | |
} else { //no hierarchy - just write the pages | |
writePages(allPages, settings.getSpace()); | |
} | |
} | |
else if (!sendToConfluence){ | |
log.debug("Send To Confluence setting turned off. --> Not uploading pages."); | |
} | |
} | |
log.info("Conversion Complete"); | |
} | |
protected boolean isPageHistorySortOnCreate() { | |
return Boolean.parseBoolean(this.miscProperties.getProperty("page-history-sortoncreate", "true")); | |
} | |
/** | |
* handle any cleanup | |
*/ | |
protected void initConversion() { | |
this.miscProperties.clear(); | |
} | |
/** | |
* Instantiate all the converterStrings | |
* | |
* @param converterStrings a list of converter strings of the form "key=value" | |
* @return a list of converters | |
*/ | |
public ArrayList<Converter> createConverters(List<String> converterStrings) { | |
return createConverters(converterStrings, true); | |
} | |
public ArrayList<Converter> createConverters(List<String> converterStrings, boolean runningState) { | |
String message = "Initializing Converters..."; | |
if (runningState) this.state.updateNote(message); | |
log.info(message); | |
new DefaultXmlEvents().clearAll(); //everytime this method is called, have a clean slate of events | |
ArrayList<Converter> converters = new ArrayList<Converter>(); | |
this.numNonConverterProperties = 0; | |
for (String converterStr : converterStrings) { | |
if (runningState) this.state.updateProgress(); | |
if (runningState && !this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return null; | |
} | |
Converter converter; | |
if (isNonConverterProperty(converterStr)) { | |
this.numNonConverterProperties++; | |
handleNonConverterProperty(converterStr); | |
continue; | |
} | |
converter = getConverterFromString(converterStr); | |
if (converter == null) { | |
continue; | |
} | |
converters.add(converter); | |
} | |
if (runningState) addDefaultMiscProperties(); | |
return converters; | |
} | |
/** | |
* coverts pages with required converters | |
* @param pages | |
*/ | |
protected void convertWithRequiredConverters(List<Page> pages) { | |
if (isIllegalHandlingEnabled()) { | |
//create pagename converter and convert with it | |
String pagenameConvStr = REQUIRED_CONVERTER_ILLEGAL_NAMES; | |
ArrayList<Converter> converters = createOneConverter(pagenameConvStr); | |
convertPages(pages, converters, "Checking for illegal pagenames."); | |
//create linkname converter and convert with it | |
String illegallinksConvStr = REQUIRED_CONVERTER_ILLEGAL_LINKS; | |
converters = createOneConverter(illegallinksConvStr); | |
convertPages(pages, converters, "Checking for links to illegal pagenames."); | |
} | |
} | |
/** | |
* converts the list of pages with the given converter | |
* @param pages list of pages to be converted | |
* @param useUI set this to false if you do not want the associated GUI elements | |
* to be updated. This is useful for unit testing. | |
*/ | |
protected void convertWithRequiredConverters(List<Page> pages, boolean useUI) { | |
//XXX used only by the junit tests | |
//create pagename converter and convert with it | |
String pagenameConvStr = REQUIRED_CONVERTER_ILLEGAL_NAMES; | |
ArrayList<Converter> converters = createOneConverter(pagenameConvStr); | |
convertPages(pages, converters, "Checking for illegal pagenames."); | |
//get the state hashtable | |
IllegalPageNameConverter pagenameConverter = (IllegalPageNameConverter) converters.remove(0); | |
HashSet<String> illegalNames = pagenameConverter.getIllegalPagenames(); | |
//create linkname converter and convert with it | |
String illegallinksConvStr = REQUIRED_CONVERTER_ILLEGAL_LINKS; | |
converters = createOneConverter(illegallinksConvStr); | |
IllegalLinkNameConverter linknameConverter = (IllegalLinkNameConverter) converters.get(0); | |
linknameConverter.setIllegalPagenames(illegalNames); | |
convertPages(pages, converters, "Checking for links to illegal pagenames."); | |
} | |
/** | |
* creates the arraylist of converters when only one converter is needed | |
* @param converterString string representing the converter. Should be in property format. Example:<br/> | |
* key=value | |
* @return arraylist with one converter as its sole item | |
*/ | |
protected ArrayList<Converter> createOneConverter(String converterString) { | |
ArrayList<String> converterStrings = new ArrayList<String>(); | |
converterStrings.add(converterString); | |
ArrayList<Converter> converters = createConverters(converterStrings); | |
return converters; | |
} | |
/** | |
* Instantiates a converter from a correctly formatted String. | |
* <p/> | |
* Note: This method is now only called once per converter -- first all converters | |
* are created, then all pages, then all converters are run on all pages. | |
* | |
* @param converterStr A string of the form "name.keyword=parameters". The | |
* keyword is used to create the correct type of converter, and the parameters | |
* are then passed to the converter. Finally, the "name.keyword" part is set as | |
* the key in the converter, mainly for debugging purposes. | |
* @return converter or null if no converter can be parsed/instantiated | |
*/ | |
public Converter getConverterFromString(String converterStr) { | |
Converter converter; | |
int equalLoc = converterStr.indexOf("="); | |
String key = converterStr.substring(0, equalLoc); | |
String value = converterStr.substring(equalLoc + 1); | |
try { | |
if (key.indexOf(CONVERTERTYPE_CLASS) >= 0) { | |
converter = getConverterClassFromCache(value); | |
} else if (key.indexOf(CONVERTERTYPE_PERL) >= 0) { | |
converter = PerlConverter.getPerlConverter(value); | |
converter.setValue(value); | |
} else if (key.indexOf(CONVERTERTYPE_JAVAREGEXTOKEN) >= 0) { | |
converter = JavaRegexAndTokenizerConverter.getConverter(value); | |
converter.setValue(value); | |
} else if (key.indexOf(CONVERTERTYPE_JAVAREGEX) >= 0) { | |
converter = JavaRegexConverter.getConverter(value); | |
converter.setValue(value); | |
} else if (key.indexOf(CONVERTERTYPE_TWIKICLEANER) >= 0) { | |
//converter = getConverterClassFromCache(value); | |
converter = TWikiRegexConverterCleanerWrapper.getTWikiRegexConverterCleanerWrapper(value); | |
converter.setValue(value); | |
} else { | |
String note = "Converter ignored -- name pattern not recognized: " + key; | |
this.errors.addError(Feedback.BAD_PROPERTY, note, true); | |
log.error(note); | |
return null; | |
} | |
converter.setProperties(this.miscProperties); | |
} catch (ClassNotFoundException e) { | |
this.errors.addError(Feedback.BAD_CONVERTER_CLASS, "Converter ignored -- the Java class " + value + " was not found", true); | |
return null; | |
} catch (IllegalAccessException e) { | |
this.errors.addError(Feedback.BAD_CONVERTER_CLASS, "Converter ignored -- there was a problem creating a converter object", true); | |
return null; | |
} catch (InstantiationException e) { | |
this.errors.addError(Feedback.BAD_CONVERTER_CLASS, "Converter ignored -- there was a problem creating the Java class " + value, true); | |
return null; | |
} catch (ClassCastException e) { | |
this.errors.addError(Feedback.BAD_CONVERTER_CLASS, "Converter ignored -- the Java class " + value + | |
" must implement the " + Converter.class.getName() + " interface!", true); | |
return null; | |
} | |
converter.setKey(key); | |
return converter; | |
} | |
/** | |
* handles necessary state changes for expected properties | |
* that were set in the converter properties file. | |
* expected nonconverter properties include hierarchy builder properties | |
* and page history preservation properties | |
* @param converterStr should be a line from the converter properties file | |
* Example: | |
* MyWiki.0001.someproperty.somepropertytype=setting | |
* <br/> | |
* where somepropertytype is an expected property type: | |
* <br/> | |
* NONCONVERTERTYPE_HIERARCHYBUILDER or NONCONVERTERTYPE_PAGEHISTORYPRESERVATION | |
* or NONCONVERTERTYPE_ILLEGALHANDLING | |
* or NONCONVERTERTYPE_AUTODETECTSPACEKEYS | |
* or NONCONVERTERTYPE_FILTERS | |
* or NONCONVERTERTYPE_MISCPROPERTIES | |
*/ | |
protected void handleNonConverterProperty(String converterStr) { | |
int equalLoc = converterStr.indexOf("="); | |
String key = converterStr.substring(0, equalLoc); | |
String value = converterStr.substring(equalLoc + 1); | |
String parent = ""; | |
try { | |
if (key.indexOf(NONCONVERTERTYPE_HIERARCHYBUILDER) >= 0) { | |
if (isHierarchySwitch(key)) | |
setHierarchyHandler(value); | |
else { | |
parent = HierarchyBuilder.class.getName(); | |
Class c; | |
c = Class.forName(value); | |
HierarchyBuilder hierarchy = (HierarchyBuilder) c.newInstance(); | |
hierarchyBuilder = hierarchy; | |
this.hierarchyBuilder.setProperties(this.miscProperties); | |
} | |
} | |
else if (key.endsWith(NONCONVERTERTYPE_PAGEHISTORYPRESERVATION)) { | |
handlePageHistoryProperty(key, value); | |
} | |
else if (key.endsWith(NONCONVERTERTYPE_ILLEGALHANDLING)) { | |
handleIllegalHandling(key, value); | |
} | |
else if (key.endsWith(NONCONVERTERTYPE_AUTODETECTSPACEKEYS)) { | |
handleAutoDetectSpacekeys(key, value); | |
} | |
else if (key.endsWith(NONCONVERTERTYPE_MISCPROPERTIES)) { | |
handleMiscellaneousProperties(key, value); | |
} | |
else if (key.endsWith(NONCONVERTERTYPE_FILTERS)) { | |
parent = FileFilter.class.getName(); | |
handleFilters(key, value); | |
} | |
else if (key.endsWith(NONCONVERTERTYPE_XMLEVENT)) { | |
handleXmlEvents(key, value); | |
} | |
} catch (ClassNotFoundException e) { | |
String message = "Property ignored -- the Java class " + value + " was not found"; | |
log.error(message); | |
this.errors.addError(Feedback.BAD_PROPERTY, message, true); | |
} catch (IllegalAccessException e) { | |
String message = "Property ignored -- there was a problem creating the Java class: " + value + | |
".\n" + | |
"Note: A necessary method's permissions were too restrictive. Check the constructor. "; | |
log.error(message); | |
this.errors.addError(Feedback.BAD_PROPERTY, message, true); | |
} catch (InstantiationException e) { | |
String message = "Property ignored -- there was a problem creating the Java class " + value + | |
".\n" + | |
"Note: The class cannot be instantiated as it is abstract or is an interface."; | |
log.error(message); | |
this.errors.addError(Feedback.BAD_PROPERTY, message, true); | |
} catch (ClassCastException e) { | |
String message = "Property ignored -- the Java class " + value + | |
" must implement the " + parent + " interface!"; | |
log.error(message); | |
this.errors.addError(Feedback.BAD_PROPERTY, message, true); | |
} catch (IllegalArgumentException e) { | |
String message = "Property ignored -- property value was not in expected format."; | |
log.error(message); | |
this.errors.addError(Feedback.BAD_PROPERTY, message, true); | |
} | |
} | |
/** | |
* at long last making some performance enhancements | |
* here we are creating an object cache which should help a bit | |
* | |
* @param key A string representing the converter (actually the part after the | |
* equals sign of the converter string). | |
* @return | |
* @throws ClassNotFoundException | |
* @throws IllegalAccessException | |
* @throws InstantiationException | |
*/ | |
private Converter getConverterClassFromCache(String key) throws ClassNotFoundException, IllegalAccessException, InstantiationException { | |
Converter converter = converterCacheMap.get(key); | |
if (converter == null) { | |
Class c = Class.forName(key); | |
converter = (Converter) c.newInstance(); | |
converterCacheMap.put(key, converter); | |
} | |
return converter; | |
} | |
/** | |
* creates file filter. | |
* If we have no filter values, returns null. | |
* If we have at least one filter value, uses the FilterChain class | |
* to create FileFilter that will handle all of the filter requirements. | |
* There are two types of supported filters: Class filters, and endswith filters. | |
* Class filters are fully resolved class names for classes that implement FileFilter. | |
* Endswith filters are text strings that the end of the filename must conform to. | |
* If there are more than one filter invoked, the following will be used to resolve | |
* which files to accept: Only pages that all class filters accept as long as | |
* any endswith filter accepts as well will be included. (Class filters are ANDed. | |
* Endswith filters are ORed.) Example: If you had two endswiths, and a class: ".txt", | |
* ".xml", and NoSvnFilter, then .txt and .xml files that the NoSvnFilter accepts | |
* will be included. | |
* @return FileFilter or null | |
*/ | |
protected FileFilter createFilter(final String pattern) { | |
Set<String> values = getFilterValues(); | |
if (pattern != null && !"".equals(pattern)) | |
values.add(pattern); | |
if (values.isEmpty()) return null; | |
FilterChain chain = new FilterChain(values, this.miscProperties); | |
return chain.getFilter(); | |
} | |
/** | |
* Creates PageForXmlRpcOld objects for all the files in inputPages. | |
* | |
* @param filter file filter to be used to filter input pages, or null, if no such filter should be used | |
* @param inputPages A list of files and directories that Pages should be created for. | |
* @return A list of PageForXmlRpcOld objects for all files matching the pattern in the settings. | |
*/ | |
protected List<Page> createPages(FileFilter filter, List<File> inputPages) { | |
String message = "Initializing Pages..."; | |
this.state.updateNote(message); | |
log.info(message); | |
List<Page> allPages = new LinkedList<Page>(); | |
for (File fileOrDir : inputPages) { | |
this.state.updateProgress(); | |
List<Page> pages = recurse(fileOrDir, filter); | |
setupPages(fileOrDir, pages); | |
allPages.addAll(pages); | |
} | |
if (isHandlingPageHistories() && isPageHistorySortOnCreate()) { | |
return sortByHistory(allPages); | |
} | |
return allPages; | |
} | |
/** | |
* Recurses through a directory structure and adds all files in it matching the filter. | |
* Called by createPages. | |
* | |
* @param fileOrDir A directory or file. Must not be <code>null</code>. | |
* @param filter the filter to use when selecting files | |
* @return A list with PageForXmlRpcOld objects for all the matching files in the directory and its subdirectories | |
*/ | |
private List<Page> recurse(File fileOrDir, FileFilter filter) { | |
assert fileOrDir != null; | |
List<Page> result = new LinkedList<Page>(); | |
if (fileOrDir.isFile()) { //it's a file AND | |
if (filter == null || filter.accept(fileOrDir)) { //there's no filter OR the filter accepts the file | |
PageSplitter splitter = getPageSplitter(); | |
if (splitter == null) | |
result.add(new Page(fileOrDir)); | |
else | |
result.addAll(splitter.split(fileOrDir)); | |
} | |
else | |
log.debug("Filtering out filename: " + fileOrDir.getName()); | |
} else if (fileOrDir.isDirectory()) { | |
File[] files = fileOrDir.listFiles(filter); | |
for (File file : files) { | |
result.addAll(recurse(file, filter)); | |
} | |
} | |
else { //some other problem | |
String message = "Could not find file: '" + | |
fileOrDir.getAbsolutePath() + | |
"'.\n" + | |
"Check existence and permissions."; | |
log.warn(message); | |
this.errors.addError(Feedback.BAD_FILE, message, true); | |
} | |
return result; | |
} | |
private PageSplitter getPageSplitter() { | |
String classname = this.miscProperties.getProperty("pagesplitter", null); | |
if (classname == null) return null; | |
Class c; | |
try { | |
c = Class.forName(classname); | |
} catch (ClassNotFoundException e) { | |
log.error("Could not find pagesplitter class named: " + classname, e); | |
return null; | |
} | |
try { | |
PageSplitter splitter = (PageSplitter) c.newInstance(); | |
return splitter; | |
} catch (InstantiationException e) { | |
log.error("Could not instantiate pagesplitter class named: " + classname, e); | |
} catch (IllegalAccessException e) { | |
log.error("Pagesplitter class can not legally be accessed: " + classname, e); | |
} | |
return null; | |
} | |
/** | |
* Set the names of the pages and performs any other setup needed. Called by recurse(). | |
* If the user selected a directory and this file is inside it, the base directory's | |
* path is removed and the rest is used as the page name. | |
* <p/> | |
* Any directory separators are replaced with the constant CONFLUENCE_SEPARATOR. | |
* | |
* @param baseDir The directory that the top-level documents are in | |
* @param pages A list of pages to set up | |
*/ | |
protected void setupPages(File baseDir, List<Page> pages) { | |
String basepath = baseDir.getParentFile().getPath() + File.separator; | |
int baselength = basepath.length(); | |
for (Page page : pages) { | |
String pagePath = page.getFile().getPath(); | |
String pageName = getPagename(pagePath.substring(baselength)); | |
//Strip the file name from the path. | |
String path = getPath(pagePath); | |
page.setPath(path); | |
page.setName(pageName); | |
if (isHandlingPageHistoriesFromFilename()) preserveHistory(page, pageName); | |
} | |
} | |
/** | |
* figures out path var for Page based on complete path to page's file | |
* @param pagePath | |
* @return | |
*/ | |
private String getPath(String pagePath) { | |
int fileNameStart = pagePath.lastIndexOf(File.separator); | |
if (fileNameStart >= 0) { | |
pagePath = pagePath.substring(0, fileNameStart); | |
} else { | |
pagePath = ""; | |
} | |
return pagePath; | |
} | |
/** | |
* uses the filename to set the version and name of the given page | |
* so that the history is preserved in the conversion. Note: | |
* uses the pageHistorySuffix which is set by the handlePageHistoryProperty | |
* method | |
* @param page object that will be changed to reflect pagename and version of given filename | |
* @param filename should use the pageHistorySuffix to indicate version and pagename: | |
* <br/> | |
* if pageHistorySuffix is -#.txt | |
* <br/> | |
* then filename should be something like: pagename-2.txt | |
* @return Page with changed name and version | |
* Will return passed page with no changes if: | |
* <ul> | |
* <li>suffix is null</li> | |
* <li> suffix has no numerical indicator (#)</li> | |
* </ul> | |
*/ | |
protected Page preserveHistory(Page page, String filename) { | |
//get suffix | |
String suffix = getPageHistorySuffix(); | |
if (suffix == null) { | |
log.error("Error attempting to preserve history: Page history suffix is Null."); | |
return page; | |
} | |
//create regex for filename based on the suffix | |
Matcher hashFinder = hashPattern.matcher(suffix); | |
String suffixReplaceRegex = ""; | |
if (hashFinder.find()) { | |
suffixReplaceRegex = hashFinder.replaceAll("(\\\\d+)"); | |
suffixReplaceRegex = "(.*)" + suffixReplaceRegex; | |
} | |
else { | |
log.error("Error attempting to preserve history: Suffix is invalid. Must contain '#'."); | |
return page; | |
} | |
//get the version and name | |
Pattern suffixReplacePattern = Pattern.compile(suffixReplaceRegex); | |
Matcher suffixReplacer = suffixReplacePattern.matcher(filename); | |
if (suffixReplacer.find()) { | |
String pagename = suffixReplacer.group(1); | |
String versionString = suffixReplacer.group(2); | |
int version = Integer.parseInt(versionString); | |
page.setName(pagename); //set name before version so latestversion data is properly set in Page | |
page.setVersion(version); | |
} | |
return page; | |
} | |
/** | |
* gets the pagename given the pagepath | |
* @param pagePath | |
* @return pagename | |
*/ | |
protected String getPagename(String pagePath) { | |
String pageName = ""; | |
if (hierarchyHandler == HierarchyHandler.DEFAULT || | |
hierarchyHandler == HierarchyHandler.HIERARCHY_BUILDER) { | |
pageName = pagePath.substring(pagePath.lastIndexOf(File.separator) + 1); | |
} else if (hierarchyHandler == HierarchyHandler.PAGENAME_HIERARCHIES) { | |
String quotedSeparator = Pattern.quote(File.separator); | |
pageName = pagePath.replaceAll(quotedSeparator, CONFLUENCE_SEPARATOR); | |
} | |
return pageName; | |
} | |
/** | |
* converts the given pages with the given converts | |
* @param pages | |
* @param converters | |
* @return true if conversion of all pages succeeded | |
*/ | |
protected boolean convertPages(List<Page> pages, List<Converter> converters) { | |
return convertPages(pages, converters, "Converting pages..."); | |
} | |
/** | |
* converts the given pages with the given converters | |
* @param pages | |
* @param converters | |
* @param note, message for the progress monitor | |
* @return true if conversion of all pages succeeded | |
*/ | |
protected boolean convertPages(List<Page> pages, List<Converter> converters, String note) { | |
boolean result = true; | |
this.state.updateNote(note); | |
log.info(note); | |
this.startTotalConvertTime = (new Date()).getTime(); | |
//go through each page | |
for (Iterator<Page> iter = pages.iterator(); iter.hasNext();) { | |
if (!this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return false; | |
} | |
Page page = iter.next(); | |
//some bookkeeping | |
long startTimeStamp = conversionBookkeepingNextPage(page); | |
//get the file's contents | |
if (page.getOriginalText() == null || "".equals(page.getOriginalText())) { | |
File file = getFileContents(page); | |
if (file == null) { | |
iter.remove(); //get rid of this page from the iterator. | |
continue; | |
} | |
} //else we used a PageSplitter to set the original text, so we can go straight to conversion | |
//convert the page | |
convertPage(converters, page); | |
//more bookkeeping | |
conversionBookkeepingEndThisPage(startTimeStamp); | |
if (!this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return false; | |
} | |
} | |
//still more bookkeeping | |
conversionBookkeepingEndAll(pages, converters); | |
return result; | |
} | |
/** | |
* make some log entries about the time it took to convert a page | |
* @param startTimeStamp | |
* @return | |
*/ | |
private long conversionBookkeepingEndThisPage(long startTimeStamp) { | |
long stopTimeStamp = ((new Date()).getTime()); | |
log.info(" time to convert " + (stopTimeStamp - startTimeStamp) + "ms"); | |
return stopTimeStamp; | |
} | |
/** | |
* make some log entries regarding the length of time it took to do the entire conversion | |
* @param pages | |
* @param converters | |
*/ | |
private void conversionBookkeepingEndAll(List<Page> pages, List<Converter> converters) { | |
long endTotalConvertTime = (new Date()).getTime(); | |
long totalTimeToConvert = (endTotalConvertTime - startTotalConvertTime)/1000; | |
String baseMessage = "::: total time to convert files: "+ totalTimeToConvert+ " seconds."; | |
log.info(baseMessage); | |
String message = baseMessage + | |
"For " + | |
pages.size() + | |
" pages and using " + | |
converters.size() + | |
" converters."; | |
totalsFileLog.info(message); | |
} | |
/** | |
* update the progress monitor and write some log entries for this page | |
* @param page | |
* @return | |
*/ | |
private long conversionBookkeepingNextPage(Page page) { | |
long startTimeStamp = ((new Date()).getTime()); | |
log.info("-------------------------------------"); | |
log.info("converting page file: " + page.getName()); | |
if (page.getFile() != null && page.getFile().getName() != null) | |
log.debug("original file name: " + page.getFile().getName()); | |
return startTimeStamp; | |
} | |
/** | |
* get the file of the given page | |
* @param page file for this page | |
* @return the file, or return null if not possible | |
*/ | |
private File getFileContents(Page page) { | |
File file = page.getFile(); | |
if (file == null) { | |
if (page.getOriginalText() != null && !"".equals(page.getOriginalText())) { | |
log.warn("This appears to be a unit test. Continue as for Unit Test."); | |
String path = page.getPath(); | |
if (path == null) path = ""; | |
file = new File(path); | |
} | |
else { | |
log.warn("No file was set for page " + page.getName() + ". Skipping page."); | |
return null; | |
} | |
} | |
else if (page.getOriginalText() == null){ | |
try { | |
String pageContents = ""; | |
if (changingEncoding()) { | |
String encoding = getEncoding(); | |
byte[] pagebytes = FileUtils.getBytesFromFile(file); | |
try { | |
pageContents = new String(pagebytes, encoding); | |
} catch (UnsupportedEncodingException e) { | |
String baseerror = "Could not encode file with encoding: " + encoding + "."; | |
log.error(baseerror + " Using utf-8."); | |
this.errors.addError(Feedback.BAD_SETTING, baseerror, true); | |
pageContents = new String(pagebytes, "utf-8"); | |
} | |
} | |
else pageContents = FileUtils.readTextFile(file); | |
page.setOriginalText(pageContents); | |
} catch (IOException e) { | |
String message = "Could not read file " + file.getAbsolutePath() + ".\n" + | |
"Check existence and permissions."; | |
log.error(message); | |
this.errors.addError(Feedback.BAD_FILE, message, true); | |
return null; | |
} | |
// Save the true source since the original will get modified in convert. | |
page.setUnchangedSource(page.getOriginalText()); | |
} | |
return file; | |
} | |
private boolean changingEncoding() { | |
if (this.miscProperties != null) | |
return this.miscProperties.containsKey("encoding"); | |
return false; | |
} | |
private String getEncoding() { | |
if (this.miscProperties != null) | |
return this.miscProperties.getProperty("encoding", "utf-8"); | |
return "utf-8"; | |
} | |
/** | |
* converts one page with the given converters | |
* @param converters list of converters | |
* @param page page object | |
*/ | |
protected Page convertPage(List<Converter> converters, Page page) { | |
if (page.getConvertedText() == null) | |
page.setConvertedText(page.getOriginalText()); //in case empty converter list | |
for (Converter converter : converters) { | |
try { | |
this.state.updateProgress(); | |
if (this.settings != null) { | |
converter.setAttachmentDirectory(this.settings.getAttachmentDirectory()); | |
} | |
else { | |
//for backwards compatibility with v2 | |
ConfluenceSettingsForm confSettings = UWCForm2.getInstance().getConfluenceSettingsForm(); | |
converter.setAttachmentDirectory(confSettings.getAttachmentDirectory()); | |
} | |
converter.convert(page); | |
// Need to reset originalText here because each converted expects | |
// to start with the result of previous conversions. | |
page.setOriginalText(page.getConvertedText()); | |
} catch (Exception e) { | |
String note = "Exception thrown by converter " + converter.getKey() + | |
" on page " + page.getName() + ". Continuing with next converter."; | |
log.error(note, e); | |
this.errors.addError(Feedback.CONVERTER_ERROR, note, true); | |
} | |
if (converter.getErrors().hasErrors()) { | |
this.hadConverterErrors = true; | |
this.state.updateNote(converter.getErrors().getFeedbackWindowErrorMessages()); | |
} | |
} | |
return page; | |
} | |
/** | |
* Write pages to disk. They are saved to the directory output/output below the | |
* current working directory. | |
* | |
* @param pages The pages to save | |
* @param pattern This file name extension is appended | |
* to each page name to create the file name. | |
*/ | |
private void savePages(List<Page> pages, String pattern) { | |
String message = "Saving Pages to Filesystem"; | |
this.state.updateNote(message); | |
log.info(message); | |
FileUtils.createOutputDirIfNeeded(); | |
String outputDirName = UWCGuiModel.getOutputDir(); | |
log.debug("Output Directory = " + outputDirName); | |
File outputDir = new File(outputDirName); | |
if (!outputDir.exists() && !outputDir.mkdir()) { | |
String dirfailMessage = "Directory creation failed for directory " + outputDirName; | |
log.error(Feedback.BAD_OUTPUT_DIR + ": " + dirfailMessage); | |
this.errors.addError(Feedback.BAD_OUTPUT_DIR, dirfailMessage, true); | |
} | |
for (Page page : pages) { | |
if (!this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return; | |
} | |
this.state.updateProgress(); | |
String outputFileLoc = outputDirName + File.separator + page.getName() + pattern; | |
FileUtils.writeFile(page.getConvertedText(), outputFileLoc); | |
} | |
} | |
protected Vector listCollisions(List<Page> pages) { | |
Vector<String> collisions = new Vector<String>(); | |
//check to see if "off" property is present | |
if (this.miscProperties != null && | |
this.miscProperties.containsKey("list-collisions") && | |
!Boolean.parseBoolean(this.miscProperties.getProperty("list-collisions"))) { | |
log.debug("Namespace Collisions Feature turned off."); | |
return collisions; | |
} | |
//sort | |
Vector<Page> sorted = new Vector<Page>(); | |
sorted.addAll(pages); | |
AsciiVersionComparator version = new AsciiVersionComparator(); | |
Collections.sort(sorted, version); | |
//look for collisions | |
Page last = new Page(null); | |
last.setName(""); | |
last.setPath(""); | |
for (int i = 1; i < sorted.size(); i++) { | |
Page page1 = (Page) sorted.get(i-1); | |
Page page2 = (Page) sorted.get(i); | |
log.debug("Checking for collisions: " + page1.getName() + " and " + page2.getName()); | |
String collision = ""; | |
//if each page lower cased is the same | |
if (getCollisionComparisonString(page1).equals(getCollisionComparisonString(page2)) | |
&& page1.getVersion() == page2.getVersion() //and same page history version | |
) { | |
if (getCollisionComparisonString(page1).equals(getCollisionComparisonString(last))) { //already have one for this name | |
String latestPath = getPagePath(page2); | |
String current = collisions.remove(collisions.size()-1); | |
collision = current + ", " + latestPath + page2.getName(); | |
} | |
else { //starting here | |
collision = getPagePath(page1) + page1.getName() + ", " + | |
getPagePath(page2) + page2.getName(); | |
} | |
collisions.add(collision); | |
last = page1; | |
String error = "Potential namespace collision detected for pages: " + collision; | |
this.getErrors().addError(Feedback.NAMESPACE_COLLISION, | |
error, | |
true); | |
this.log.error(error); | |
} | |
} | |
return collisions; | |
} | |
/** | |
* @param page | |
* @return the namespace collision comparison string. Either | |
* the pagename, lower cased, or if we're using the auto detect spacekeys | |
* feature, then the page page + the pagename, all lower cased. | |
*/ | |
protected String getCollisionComparisonString(Page page) { | |
if (this.autoDetectSpacekeys) | |
return (getPagePath(page) + page.getName()).toLowerCase(); | |
return page.getName().toLowerCase(); | |
} | |
/** | |
* @param page | |
* @return the page's path, including an ending file seperator if one isn't | |
* already there | |
*/ | |
private String getPagePath(Page page) { | |
return (page.getPath().endsWith(File.separator)? | |
page.getPath(): | |
page.getPath()+File.separator); | |
} | |
/** | |
* Writes the pages to Confluence. If the process takes more than three seconds, | |
* a progress monitor will be displayed so that the user can see that something is | |
* indeed happening. | |
* | |
* @param pages The pages to output. | |
* @param spacekey space to which the pages will be written | |
*/ | |
protected void writePages(List<Page> pages, String spacekey) { | |
String note = "Uploading Pages to Confluence..."; | |
this.state.updateNote(note); | |
log.info(note); | |
int numUploaded = 0; | |
// at last, write the pages to Confluence! | |
for (Page page : pages) { | |
this.state.updateProgress(); | |
if (!this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return; | |
} | |
if (sendPage(page, null, this.settings) == null) continue; | |
numUploaded++; | |
if ((numUploaded % 10) == 0) { | |
String message = "Uploaded " + numUploaded + | |
" out of " + pages.size() + | |
" page"+ (numUploaded==1?"":"s") + | |
"."; | |
this.state.updateNote(message); | |
log.info(message); | |
} | |
} | |
String message = "Uploaded " + numUploaded + | |
" out of " + pages.size() + | |
" page"+ (numUploaded==1?"":"s") + | |
"."; | |
this.state.updateNote(message); | |
log.info(message); | |
if (this.settings.getUploadOrphanAttachments().equalsIgnoreCase("true")) | |
{ | |
ArrayList <File> orphanAttachments=findOrphanAttachments(this.settings.getAttachmentDirectory()); | |
uploadOrphanAttachments(orphanAttachments); | |
} | |
//attachedFiles is cleared so that if we do another conversion | |
//without closing the UWC, it won't think the attachment has already been | |
//attached | |
this.attachedFiles = null; | |
} | |
/****** | |
* to find all orphan attachment files | |
* @param dirName | |
* @return | |
*/ | |
protected ArrayList<File> findOrphanAttachments(String dirName) | |
{ | |
ArrayList<File> orphanAttachments=new ArrayList<File>(); | |
File directory=new File(dirName); | |
for (File file : directory.listFiles()) { | |
if (file.isDirectory()) | |
orphanAttachments.addAll(findOrphanAttachments(file.getAbsolutePath())); | |
else if (file.isFile()) | |
{ | |
if (alreadyAttached(file.getName())) | |
continue; | |
orphanAttachments.add(file); | |
} | |
} | |
return orphanAttachments; | |
} | |
/** | |
* to upload the orphan attachment files to wiki. | |
*/ | |
protected void uploadOrphanAttachments(ArrayList<File> orphanAttachments) | |
{ | |
if (orphanAttachments == null || orphanAttachments.size() == 0) | |
return; | |
Hashtable pageTable = new Hashtable(); | |
pageTable.put("content", "{attachments}"); | |
pageTable.put("title", ORPHAN_ATTACHMENTS_PAGE_TITLE); | |
//create ConfluenceServerSettings object | |
ConfluenceServerSettings confSettings = new ConfluenceServerSettings(); | |
confSettings.login = settings.getLogin(); | |
confSettings.password = settings.getPassword(); | |
confSettings.url = settings.getUrl(); | |
confSettings.spaceKey = settings.getSpace(); | |
confSettings.truststore = settings.getTruststore(); | |
confSettings.trustpass = settings.getTrustpass(); | |
confSettings.trustallcerts = settings.getTrustall(); | |
RemoteWikiBroker broker = RemoteWikiBroker.getInstance(); | |
//check for problems with settings | |
checkConfluenceSettings(confSettings); | |
//send page | |
String pageId = sendPage(broker, pageTable, confSettings); | |
int total=orphanAttachments.size(); | |
int count=0; | |
for (File file : orphanAttachments) { | |
sendAttachment(file, broker, pageId, confSettings); | |
count++; | |
if ((count % 10) == 0) { | |
String message = "Uploaded " + count + | |
" out of " + total + " orphan attachments."; | |
this.state.updateNote(message); | |
log.info(message); | |
} | |
} | |
String message = "Uploaded " + total + " orphan attachments."; | |
this.state.updateNote(message); | |
log.info(message); | |
} | |
/**** | |
* send an attachment file to wiki. | |
* | |
* @param file | |
* @param broker | |
* @param pageId | |
* @param confSettings | |
* @return the attachment object we sent. used by junit tests | |
*/ | |
protected AttachmentForXmlRpc sendAttachment(File file, RemoteWikiBroker broker, String pageId, ConfluenceServerSettings confSettings) { | |
return sendAttachment(new Attachment(file), broker, pageId, confSettings); | |
} | |
protected AttachmentForXmlRpc sendAttachment(Attachment attachment, RemoteWikiBroker broker, String pageId, ConfluenceServerSettings confSettings) | |
{ | |
File file = attachment.getFile(); | |
AttachmentForXmlRpc attachmentRpc = new AttachmentForXmlRpc(); | |
if (tooBig(file) || doesNotExist(file)) | |
return null; | |
attachmentRpc.setFileName(attachment.getName()); | |
attachmentRpc.setFileLocation(file.getAbsolutePath()); | |
attachmentRpc.setContentType(determineContentType(file)); //XXX Note: if the filename is different from the file, the content type determining might be foiled | |
attachmentRpc.setComment(attachment.getComment() == null?getAttachmentUploadComment():attachment.getComment()); | |
String errorMessage = "Couldn't send attachmentRpc " + | |
file.getAbsolutePath() + ". Skipping attachmentRpc."; | |
if (usingWebdav()) { | |
String webdavPath = getWebdavPath(); | |
sendAttachmentWebdav(broker, pageId, confSettings, attachmentRpc, webdavPath, errorMessage); | |
} | |
else | |
sendAttachmentRemoteAPI(broker, pageId, confSettings, attachmentRpc, errorMessage); | |
return attachmentRpc;//for junit tests | |
} | |
private String getAttachmentUploadComment() { | |
if (this.miscProperties != null && | |
this.miscProperties.containsKey("attachment-upload-comment")) { | |
String comment = this.miscProperties.getProperty("attachment-upload-comment"); | |
if (comment == null) return DEFAULT_ATTACHMENT_UPLOAD_COMMENT; | |
return comment; | |
} | |
return DEFAULT_ATTACHMENT_UPLOAD_COMMENT; | |
} | |
protected boolean usingWebdav() { | |
if (this.miscProperties != null && | |
this.miscProperties.containsKey("attachments-use-webdav")) { | |
return Boolean.parseBoolean( | |
this.miscProperties.getProperty("attachments-use-webdav", "false")); | |
} | |
return false; | |
} | |
protected String getWebdavPath() { | |
if (this.miscProperties != null && | |
this.miscProperties.containsKey("webdav-path")) { | |
return this.miscProperties.getProperty("webdav-path", RemoteWikiBroker.WEBDAV_PATH_EARLY); | |
} | |
return RemoteWikiBroker.WEBDAV_PATH_EARLY; | |
} | |
private void sendAttachmentWebdav(RemoteWikiBroker broker, String pageId, | |
ConfluenceServerSettings confSettings, | |
AttachmentForXmlRpc attachment, String basepath, | |
String errorMessage) { | |
try { | |
Map pagesByIdMap = broker.getAllServerPagesMapById(confSettings, confSettings.spaceKey); | |
String webdavPath = broker.getWebDAVPagePath(confSettings.url, confSettings.spaceKey, pageId, pagesByIdMap, basepath); | |
broker.sendFileViaWebDAV(attachment.getFileLocation(), webdavPath, confSettings.login, confSettings.password); | |
} catch (IOException e) { | |
log.error(Feedback.BAD_FILE + ": " + errorMessage, e); | |
this.errors.addError(Feedback.BAD_FILE, errorMessage, true); | |
} catch (XmlRpcException e) { | |
log.error(Feedback.REMOTE_API_ERROR + ": " + errorMessage, e); | |
this.errors.addError(Feedback.REMOTE_API_ERROR, errorMessage, true); | |
if (Pattern.matches(".*?You do not have the permissions.*", e.getMessage())) { | |
String noPermissionsError = "User '" + confSettings.login + | |
"' " + | |
"does not have permission to attach files to space '" + | |
confSettings.spaceKey + | |
"'."; | |
log.debug(Feedback.USER_NOT_PERMITTED + ": " + noPermissionsError); | |
this.errors.addError(Feedback.USER_NOT_PERMITTED, noPermissionsError, true); | |
} | |
} | |
} | |
private void sendAttachmentRemoteAPI(RemoteWikiBroker broker, String pageId, ConfluenceServerSettings confSettings, AttachmentForXmlRpc attachment, String errorMessage) { | |
try { | |
broker.storeAttachment(confSettings, pageId, attachment); | |
} catch (IOException e) { | |
log.error(Feedback.BAD_FILE + ": " + errorMessage, e); | |
this.errors.addError(Feedback.BAD_FILE, errorMessage, true); | |
} catch (XmlRpcException e) { | |
log.error(Feedback.REMOTE_API_ERROR + ": " + errorMessage, e); | |
this.errors.addError(Feedback.REMOTE_API_ERROR, errorMessage, true); | |
if (Pattern.matches(".*?You do not have the permissions.*", e.getMessage())) { | |
String noPermissionsError = "User '" + confSettings.login + | |
"' " + | |
"does not have permission to attach files to space '" + | |
confSettings.spaceKey + | |
"'."; | |
log.debug(Feedback.USER_NOT_PERMITTED + ": " + noPermissionsError); | |
this.errors.addError(Feedback.USER_NOT_PERMITTED, noPermissionsError, true); | |
} | |
} | |
} | |
/** | |
* Writes a hierarchy of pages to Confluence. The empty nodes (those with page=null) will | |
* not be written if there already exists a page in Confluence. If there is no page at the | |
* corresponding place in Confluence, an empty page will be created. | |
* | |
* Like writePages(), this method will show a progress bar if the hierarchy takes more than | |
* a few seconds to send to Confluence. | |
* | |
* @param root The root of the hierarchy. Note: The root node itself will <strong>NOT</strong> be | |
* added to Confluence. All it's children will be added as top-level pages in the space. | |
* @param maxProgress used by logging and status messages | |
* @param spacekey space to which the pages will be written | |
*/ | |
protected void writeHierarchy(HierarchyNode root, int maxProgress, String spacekey) { | |
String message = "Uploading Pages to Confluence..."; | |
this.state.updateNote(message); | |
log.info(message); | |
int progressNum = 0; | |
this.newNodes = 0; //this has to be a field, because we're already returning something; | |
// at last write the pages to Confluence! | |
for (HierarchyNode topLevelPage : root.getChildren()) { | |
log.debug("writeHierarchy: toplevelpage = " + topLevelPage.getName()); | |
log.debug("number of children this toplevelpage has = " + topLevelPage.getChildren().size()); | |
progressNum = writeHierarchy(topLevelPage, null, progressNum, maxProgress, spacekey); | |
if (!this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return; | |
} | |
} | |
} | |
/** | |
* This is the recursive part of <code>writeHierarchy</code>. Don't call this directly! | |
* Call writeHierarchy(root) instead. | |
* | |
* @param node The current node in the hierarchy | |
* @param parentId The Confluence "page ID" of the parent page | |
* @param progress The number of pages that have been converted so far | |
* (used to keep the progress monitor updated) | |
* @param spacekey space to which the pages will be written | |
* @return The number of pages converted after this node and all its descendants have been added. | |
*/ | |
private int writeHierarchy( | |
HierarchyNode node, | |
String parentId, | |
int progress, | |
int maxProgress, | |
String spacekey) { | |
if (!this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return progress; | |
} | |
// First upload the page contained in this node | |
Page page = node.getPage(); | |
// create missing nodes - like a directory that didn't have a corresponding page | |
if (page == null) { | |
// This node is a "placeholder" because there are pages further down the hierarchy but | |
// for some reason this node was not included in the conversion. Create an empty page. | |
// Note that this page will only be sent to Confluence if there was no page in place before. | |
page = new Page(null); | |
page.setName(node.getName()); | |
page.setOriginalText(""); | |
page.setConvertedText(""); | |
page.setPath(node.getName()); //needed by auto-detect spacekeys feature | |
String message = "Page '" + page.getName() + "' does not exist. Creating it now."; | |
log.info(message); | |
this.state.updateNote(message); | |
this.newNodes++; | |
this.state.updateMax(this.state.getMax() + 1); | |
} | |
//upload the page | |
String myId = sendPage(page, parentId, this.settings); | |
//some bookkeeping | |
progress++; | |
logProgressMessage(progress, maxProgress); | |
// Then recursively upload all the node's descendants | |
for (HierarchyNode child : node.getChildren()) { | |
progress = writeHierarchy(child, myId, progress, maxProgress, spacekey); | |
if (!this.running) { | |
this.feedback = Feedback.CANCELLED; | |
return progress; | |
} | |
} | |
return progress; | |
} | |
/** | |
* sends upload progress messages to the feedback window and the log | |
* @param current current number of uploaded pages | |
* @param max max number of uploaded pages | |
*/ | |
private void logProgressMessage(int current, int max) { | |
this.state.updateProgress(); | |
String message = "Uploaded " + current + " out of " + (max + this.newNodes) + " pages."; | |
//more visible note if current is divisible by 10 or last page | |
if ((current % 10) == 0 || current == (max + this.newNodes)) { | |
this.state.updateNote(message); | |
log.info(message); | |
} | |
else { //less visible note for everything else | |
log.debug(message); | |
} | |
} | |
/** | |
* sends page, using settings from the given settings | |
* @param page | |
* @param parentId | |
* @return page id | |
* @throws IllegalArgumentException if a confluenceSetting is invalid | |
*/ | |
protected String sendPage(Page page, String parentId, UWCUserSettings settings) { | |
//XXX why are we setting these up every page. Most of these are global. | |
//XXX If we set these up earlier in the process, we could do the checkConfluenceSettings call | |
//(currently in the next sendPage) earlier in the process as well | |
ConfluenceServerSettings confSettings = new ConfluenceServerSettings(); | |
confSettings.login = settings.getLogin(); | |
confSettings.password = settings.getPassword(); | |
confSettings.url = settings.getUrl(); | |
confSettings.spaceKey = settings.getSpace(); | |
confSettings.truststore = settings.getTruststore(); | |
confSettings.trustpass = settings.getTrustpass(); | |
confSettings.trustallcerts = settings.getTrustall(); | |
//check to see if we've assigned a space to the page | |
if (page.getSpacekey() != null && !"".equals(page.getSpacekey())) { | |
confSettings.spaceKey = page.getSpacekey(); | |
String[] spacedata = page.getSpaceData(page.getSpacekey()); | |
String spacename = (spacedata == null || spacedata.length < 1)?page.getSpacekey():spacedata[0]; | |
String spacedesc = (spacedata == null || spacedata.length < 2)?"":spacedata[1]; | |
if (!createSpace(confSettings, spacename, spacedesc, page.isPersonalSpace(), page.getPersonalSpaceUsername())) { | |
log.warn("Could not create space '" + confSettings.spaceKey + "' assigned to page '" + page.getName() + "'. " + | |
"Using default space from settings."); | |
confSettings.spaceKey = settings.getSpace(); | |
} | |
} // check to see if we're automatically detecting spaces based on the file system | |
else if (isAutoDetectingSpacekeys()) { | |
confSettings.spaceKey = determineSpaceKey(page); | |
if ("".equals(confSettings.spaceKey) || confSettings.spaceKey == null) { | |
String error = "Could not find spacekeys. Note: the auto-detect spacekeys" + | |
" framework is being used. You must choose directories not individual files" + | |
" for conversion.\nCannot upload files to Confluence. Exiting."; | |
log.error(error); | |
this.errors.addError(Feedback.BAD_SPACE, error, true); | |
this.state.updateProgress(this.state.getMax()); | |
this.running = false; | |
return ""; | |
} | |
if (!createSpace(confSettings)) return null; | |
} //else otherwise use the default (settings based) spacekey | |
return sendPage(page, parentId, confSettings); | |
} | |
/** | |
* creates a space for the spacekey in the given settings, if it | |
* doesn't already exist | |
* @param confSettings | |
* @return false if space could not be created | |
*/ | |
protected boolean createSpace(ConfluenceServerSettings confSettings) { | |
String spaceName = confSettings.spaceKey; | |
String description = "This space was auto-generated by the UWC."; | |
return createSpace(confSettings, spaceName, description, false, null); | |
} | |
/** | |
* creates a space for the spacekey in the given settings, if it doesn't already exist | |
* @param confSettings | |
* @param name name of space to be created. will not be used, if space already exists | |
* @param description description of space to be created. will not be used if space already exists | |
* @param isPersonalSpace true if space is personal space | |
* @param personalSpaceUsername should be non-null if isPersonalSpace is true. If this condition is not | |
* maintained, will use spacekey in confSettings instead | |
* @return false if space could not be created | |
*/ | |
protected boolean createSpace(ConfluenceServerSettings confSettings, String name, String description, | |
boolean isPersonalSpace, String personalSpaceUsername) { | |
String spacekey = confSettings.spaceKey; | |
RemoteWikiBroker broker = RemoteWikiBroker.getInstance(); | |
SpaceForXmlRpc space = broker.createSpace(spacekey, name, description); | |
if (isPersonalSpace) { | |
space.setType(SpaceType.PERSONAL); | |
space.setUsername(personalSpaceUsername); | |
} | |
try { | |
// Conf 2.x will throw an exception if the space doesn't exist. | |
SpaceForXmlRpc space2 = broker.getSpace(confSettings, spacekey); | |
// Conf 3.x will not throw an exception but will return null | |
if (space2 == null) { //Confluence 3.x | |
String note = "Creating space with spacekey '" + spacekey + "' and name: " + name; | |
log.info(note); | |
this.state.updateNote(note); | |
try { | |
broker.addSpace(confSettings, space); | |
} catch (Exception e) { | |
getErrors().addError(Feedback.BAD_LOGIN, | |
"Could not create space: " + spacekey + | |
" with login: " + confSettings.login + | |
". That login may not have permission to create spaces.", | |
true); | |
e.printStackTrace(); | |
return false; | |
} | |
} | |
} catch (Exception e) { //Confluence 2.x | |
try { //exception! So, try adding the space | |
String note = "Creating space with spacekey '" + spacekey + "' and name: " + name; | |
log.info(note); | |
this.state.updateNote(note); | |
broker.addSpace(confSettings, space); | |
} catch (Exception e1) { //something bad happened. | |
getErrors().addError(Feedback.BAD_LOGIN, | |
"Could not create space: " + spacekey + | |
" with login: " + confSettings.login + | |
". That login may not have permission to create spaces.", | |
true); | |
e1.printStackTrace(); | |
return false; | |
} | |
} | |
return true; | |
} | |
/** | |
* determines the correct spacekey for the given page. | |
* Note: used in conjunction with the autoDetectSpacekeys Framework | |
* @param page | |
* @return spacekey | |
*/ | |
protected String determineSpaceKey(Page page) { | |
log.debug("determining space key. page = " + page.getName()); | |
String path = page.getPath(); | |
log.debug("determining space key. path = " + path); | |
String ignore = this.miscProperties.getProperty("auto-detect-ignorable-ancestors", ""); | |
if (this.miscProperties.containsKey("filepath-hierarchy-ignorable-ancestors") && | |
page.getName().equals(path)) { | |
ignore = ""; //turn off the ignore property - this is the top level directory | |
} | |
if (!"".equals(ignore)) { | |
log.debug("Ignoring these ancestors: " + ignore); | |
path = page.getFile().getParentFile().getAbsolutePath(). | |
replaceFirst("^\\Q" + ignore + "\\E", ""); | |
} | |
String validated = validateSpacekey(path); | |
log.debug("validated space key = " + validated); | |
return validated; | |
} | |
/** | |
* validates the given spacekey, removing illegal chars, | |
* as necessary | |
* @param spacekey | |
* @return valid spacekey | |
*/ | |
public static String validateSpacekey(String spacekey) { | |
String validated = spacekey.replaceAll("[^A-Za-z0-9]", ""); | |
return validated; | |
} | |
/********* | |
* to send a page table which has all the attributes for a page to wiki | |
* @param broker | |
* @param pageTable | |
* @param confSettings | |
* @return | |
*/ | |
protected String sendPage(RemoteWikiBroker broker, Hashtable pageTable, ConfluenceServerSettings confSettings) | |
{ | |
PageForXmlRpc brokerPage = PageForXmlRpc.create(pageTable); | |
PageForXmlRpc newPage = null; | |
try { | |
newPage = broker.storeNewOrUpdatePage(confSettings, confSettings.spaceKey, brokerPage); | |
if (newPage == null || newPage.getPageParams() == null) { | |
String message = "Unknown problem occured while sending page '" + pageTable.get("title") + | |
"'. See atlassian-confluence.log for more details."; | |
log.error(message); | |
getErrors().addError(Feedback.REMOTE_API_ERROR, message, true); | |
return null; | |
} | |
} catch (Exception e) { | |
getErrors().addError(Feedback.REMOTE_API_ERROR, | |
"The Remote API threw an exception when it tried to upload page: \"" + | |
pageTable.get("title") + | |
"\".", true); | |
e.printStackTrace(); | |
return null; | |
} | |
//move the page if necessary and you can | |
String parentid = null; | |
if (pageTable.containsKey("parentId")) | |
parentid = (String) pageTable.get("parentId"); | |
else { //We would like to put pages, by default, under the homepage. | |
if (this.homepages.containsKey(confSettings.spaceKey)) {//is there a known Home page in the space? | |
parentid = this.homepages.get(confSettings.spaceKey); | |
if ("-1".equals(parentid)) parentid = null;// no homepage in this space | |
} | |
else { //can we find the home page for this space? | |
try { | |
parentid = broker.getPageIdFromConfluence(confSettings, confSettings.spaceKey, "Home"); | |
this.homepages.put(confSettings.spaceKey, parentid); | |
} catch (Exception e) { | |
parentid = null; | |
this.homepages.put(confSettings.spaceKey, "-1"); | |
} | |
} | |
} | |
if (parentid != null) { | |
try { | |
broker.movePage(confSettings, newPage.getId(), parentid, RemoteWikiBroker.Position.APPEND); | |
} catch (Exception e) { | |
log.debug("Could not move page " + pageTable.get("title") + "\n" + e.getMessage() + "\n" + | |
e.getStackTrace()); //could be because Confluence is earlier than 2.9 | |
} | |
} | |
return newPage.getId(); | |
} | |
/********* | |
* to send a blog table which has all the attributes for a blog to wiki | |
* @param broker | |
* @param pageTable | |
* @param confSettings | |
* @return | |
*/ | |
protected String sendBlog(RemoteWikiBroker broker, Hashtable pageTable, ConfluenceServerSettings confSettings) | |
{ | |
BlogForXmlRpc brokerPage = BlogForXmlRpc.create(pageTable); | |
BlogForXmlRpc newPage = null; | |
try { | |
newPage = broker.storeBlog(confSettings, confSettings.spaceKey, brokerPage); | |
if (newPage == null || newPage.getblogParams() == null) { | |
String message = "Unknown problem occured while sending page '" + pageTable.get("title") + | |
"'. See atlassian-confluence.log for more details."; | |
log.error(message); | |
getErrors().addError(Feedback.REMOTE_API_ERROR, message, true); | |
return null; | |
} | |
} catch (Exception e) { | |
getErrors().addError(Feedback.REMOTE_API_ERROR, | |
"The Remote API threw an exception when it tried to upload page: \"" + | |
pageTable.get("title") + | |
"\".", true); | |
e.printStackTrace(); | |
return null; | |
} | |
return newPage.getId(); | |
} | |
protected void checkConfluenceSettings(ConfluenceServerSettings confSettings) | |
{ | |
//check for problems with settings | |
Feedback testConnectionFeedback = TestSettingsListener.getConnectionFeedback(confSettings, isAutoDetectingSpacekeys()); | |
if (testConnectionFeedback != Feedback.OK) { | |
String message = TestSettingsListener.getConnectionFeedbackMessage(confSettings, isAutoDetectingSpacekeys()); | |
log.error(message); | |
this.state.updateNote(message); | |
throw new IllegalArgumentException(message); | |
} | |
// log.info(TestSettingsListener.SUCCESS_MESSAGE_LONG); //this is getting called for every page | |
} | |
/** | |
* sends page using the given settings | |
* @param page | |
* @param parentId | |
* @param confSettings | |
* @return page id the confluence page id for the page being stored. Used if | |
* page is new. | |
*/ | |
protected String sendPage(Page page, String parentId, ConfluenceServerSettings confSettings) { | |
//create wiki broker | |
RemoteWikiBroker broker = RemoteWikiBroker.getInstance(); | |
//update page content to be xhtml | |
page = pageContentToXhtml(broker, confSettings, page); | |
//create page that broker can use | |
Hashtable pageTable = createPageTable(page, parentId); | |
//check for problems with settings | |
checkConfluenceSettings(confSettings); //XXX Why are we doing this for every page? 'cause we seem to create the confSettings on a page by page basis? | |
//send page | |
String id = null; | |
if (page.isBlog()) { | |
log.debug("Attempting to send blog: " + page.getName() + " to space: " + confSettings.spaceKey); | |
id = sendBlog(broker, pageTable, confSettings); | |
} else { | |
log.debug("Attempting to send page: " + page.getName() + " to space: " + confSettings.spaceKey); | |
id = sendPage(broker, pageTable, confSettings); | |
} | |
if (id == null) return null; | |
//send attachments | |
sendAttachments(page, broker, id, confSettings); | |
//send labels | |
sendLabels(page, broker, id, confSettings); | |
//send comments | |
sendComments(page, broker, id, confSettings); | |
//set author | |
sendAuthor(page, broker, id, confSettings); | |
//set timestamp | |
sendTimestamp(page, broker, id, confSettings); | |
//return the page id | |
return id; | |
} | |
private Page pageContentToXhtml(RemoteWikiBroker broker, | |
ConfluenceServerSettings confSettings, Page page) { | |
try { | |
String xhtml = getContentAsXhtmlFormat(broker, confSettings, page.getConvertedText()); | |
page.setConvertedText(xhtml); | |
} catch (Exception e) { | |
String errorMessage = "Could not transform wiki content in page: '"+page.getName()+ | |
"' from markup to xhtml."; | |
log.error(Feedback.REMOTE_API_ERROR + ": " + errorMessage); | |
this.errors.addError(Feedback.REMOTE_API_ERROR, errorMessage, true); | |
} | |
return page; | |
} | |
/** | |
* creates a parameter table with the given page and parentId. | |
* @param page | |
* @param parentId | |
* @return table with Remote API page parameters | |
*/ | |
private Hashtable createPageTable(Page page, String parentId) { | |
Hashtable table = new Hashtable(); | |
table.put("content", page.getConvertedText()); | |
table.put("title", page.getName()); | |
if (parentId != null && !parentId.equals("null")) table.put("parentId", parentId); | |
if (page.getVersion() > 0) table.put("version", page.getVersion() + ""); | |
return table; | |
} | |
/** | |
* checks the given page for valid attachments, | |
* and sends them to Confluence using the rwb and the given pageId string as the | |
* page to be attached to. | |
* | |
* @param page given page object that might have attachments | |
* @param broker XML-RPC broker which will communicate with Confluence | |
* @param pageId the page the Confluence will attach the attachment to | |
* @param confSettings the confluence user settings needed by the broker to connect to Confluence | |
*/ | |
private void sendAttachments(Page page, RemoteWikiBroker broker, String pageId, ConfluenceServerSettings confSettings) { | |
log.debug("Examining attachments for page: " + page.getName()); | |
// Send the attachments | |
for (Attachment attachment : page.getAllAttachmentData()) { | |
if (alreadyAttached(page, attachment.getFile())) | |
continue; | |
sendAttachment(attachment, broker, pageId, confSettings); | |
} | |
} | |
protected void sendLabels(Page page, RemoteWikiBroker broker, String pageId, ConfluenceServerSettings confSettings) { | |
log.debug("Examining labels for page: " + page.getName()); | |
//check to see if we're sending labels for this version of the page | |
if (badVersionForSendingLabels(page)) return; | |
String labels = page.getLabelsAsString(); | |
log.debug("Sending Labels: " + labels); | |
if (labels == null) | |
return; | |
try { | |
broker.addLabels(confSettings, labels, pageId); | |
} catch (Exception e) { | |
String errorMessage = "Could not add labels '" + labels + "' to page '" + page.getName() +"'"; | |
log.error(Feedback.REMOTE_API_ERROR + ": " + errorMessage); | |
this.errors.addError(Feedback.REMOTE_API_ERROR, errorMessage, true); | |
} | |
} | |
private boolean badVersionForSendingLabels(Page page) { | |
int version = page.getVersion(); | |
int latest = Page.getLatestVersion(page.getName()); | |
boolean history = isHandlingPageHistories(); | |
String allVersionsProp = (String) this.miscProperties.get("page-history-allversionlabels"); | |
boolean allVersions = (allVersionsProp != null) && Boolean.parseBoolean(allVersionsProp); | |
return history && !allVersions && version != latest; | |
} | |
/** | |
* adds page comments to a page in confluence | |
* @param page given page object that might have comments | |
* @param broker XML-RPC broker which will communicate with Confluence | |
* @param pageId the page id for the given page | |
* @param confSettings the confluence user settings needed by the broker to connect to Confluence | |
*/ | |
protected void sendComments(Page page, RemoteWikiBroker broker, String pageId, ConfluenceServerSettings confSettings) { | |
if (page.hasComments()) { | |
log.debug("Sending comments for page: " + page.getName()); | |
try { | |
for (Comment comment : page.getAllCommentData()) { | |
//create page that broker can use | |
CommentForXmlRpc brokerComment = new CommentForXmlRpc(); | |
brokerComment.setPageId(pageId); | |
brokerComment.setContent(getContentAsXhtmlFormat(broker, confSettings, comment.text)); | |
//upload comment | |
CommentForXmlRpc uploadedComment = broker.addComment(confSettings, brokerComment); | |
if (comment.hasCreator()) { | |
boolean usersMustExist = false; | |
broker.setCreator(confSettings, comment.creator, uploadedComment.getId(), usersMustExist); | |
broker.setLastModifier(confSettings, comment.creator, uploadedComment.getId(), usersMustExist); | |
} | |
if (comment.hasTimestamp()) { | |
broker.setCreateDate(confSettings, comment.timestamp, uploadedComment.getId()); | |
broker.setLastModifiedDate(confSettings, comment.timestamp, uploadedComment.getId()); | |
} | |
} | |
} catch (Exception e) { | |
String errorMessage = null; | |
if (e.getMessage().contains("NotPermittedException")) { | |
errorMessage = "User is not permitted to add comments to page: " + page.getName() + "'"; | |
} | |
else if (e.getMessage().contains("does not exist")) { | |
errorMessage = "Cannot add comments to the page because it does not exist: " + page.getName(); | |
} | |
else { | |
errorMessage = "Could not send comments to page '" + page.getName() +"'"; | |
} | |
log.error(Feedback.REMOTE_API_ERROR + ": " + errorMessage); | |
this.errors.addError(Feedback.REMOTE_API_ERROR, errorMessage, true); | |
} | |
} | |
else log.debug("Page has no comments."); //DELETE | |
} | |
public String getContentAsXhtmlFormat(RemoteWikiBroker broker, ConfluenceServerSettings confSettings, String text) throws XmlRpcException, IOException { | |
return broker.convertWikiToStorageFormat(confSettings, text); | |
} | |
private void sendAuthor(Page page, RemoteWikiBroker broker, String id, ConfluenceServerSettings confSettings) { | |
if (page.getAuthor() != null) { | |
log.debug("Sending author data."); | |
boolean exist = true; | |
if (this.miscProperties.containsKey("users-must-exist")) | |
exist = Boolean.parseBoolean((String) this.miscProperties.get("users-must-exist")); | |
try { | |
if (page.getVersion() == 1) { //only set the creator if its the first version | |
broker.setCreator(confSettings, page.getAuthor(), id, exist); | |
} | |
//set the modifier | |
broker.setLastModifier(confSettings, page.getAuthor(), id, exist); | |
} catch (Exception e) { | |
String errorMessage = Feedback.REMOTE_API_ERROR + ": Problem setting creator or last modifier data."; | |
log.error(errorMessage); | |
this.errors.addError(Feedback.REMOTE_API_ERROR, errorMessage, true); | |
e.printStackTrace(); | |
} | |
} | |
} | |
private void sendTimestamp(Page page, RemoteWikiBroker broker, String id, ConfluenceServerSettings confSettings) { | |
if (page.getTimestamp() != null) { | |
log.debug("Sending timestamp data."); | |
try { | |
DateFormat dateFormat = new SimpleDateFormat("yyyy:MM:dd:HH:mm:ss:SS"); //XXX Settable? | |
if (this.miscProperties.getProperty("user-timezone", null) != null) { | |
String timezone = this.miscProperties.getProperty("user-timezone", null); | |
timezone = timezone.trim(); | |
dateFormat.setTimeZone(TimeZone.getTimeZone(timezone)); | |
} | |
String timestamp = dateFormat.format(page.getTimestamp()); | |
if (page.getVersion() == 1) { //only set the creator if its the first version | |
broker.setCreateDate(confSettings, timestamp, id); | |
} | |
//set the modifier | |
broker.setLastModifiedDate(confSettings, timestamp, id); | |
} catch (Exception e) { | |
String errorMessage = Feedback.REMOTE_API_ERROR + ": Problem setting create or last modified date."; | |
log.error(errorMessage); | |
this.errors.addError(Feedback.REMOTE_API_ERROR, errorMessage, true); | |
e.printStackTrace(); | |
} | |
} | |
} | |
/** | |
* @param file | |
* @return true if the given file does not exist on the filesystem. | |
*/ | |
protected boolean doesNotExist(File file) { | |
boolean doesNotExist = !file.exists(); | |
if (doesNotExist) | |
log.warn("File '" + file.getPath() + "' does not exist: Skipping"); | |
return doesNotExist; | |
} | |
/** | |
* @param file | |
* @return true if file size is too big | |
*/ | |
protected boolean tooBig(File file) { | |
if (!file.exists()) return false; | |
int length = (int) file.length(); | |
String maxString = getMaxAttachmentSizeString(); | |
int maxBytes = getAsBytes(maxString); | |
if (maxBytes < 0) return false; | |
boolean tooBig = length > maxBytes; | |
if (tooBig) | |
log.warn("File " + file.getName() + " is larger than " + maxString + ". Skipping."); | |
return tooBig; | |
} | |
/** | |
* @return the max attachment size as a string | |
*/ | |
private String getMaxAttachmentSizeString() { | |
return getMaxAttachmentSizeStringFromModel(); | |
} | |
/** | |
* @return the max attachment size as it's represented in the model | |
*/ | |
private String getMaxAttachmentSizeStringFromModel() { | |
return this.settings.getAttachmentSize(); | |
} | |
/** | |
* @param fileLocation location of properties file | |
* @return a Properties object containing confluence settings | |
*/ | |
protected Properties loadProperties(String fileLocation) { | |
/* most of this code grabbed from ConfluenceSettingsForm.populateConfluenceSettings*/ | |
Properties properties = new Properties(); | |
File confSettings = new File(fileLocation); | |
if (confSettings.exists()) { | |
// load properties file | |
FileInputStream fis; | |
try { | |
fis = new FileInputStream(fileLocation); | |
properties.load(fis); | |
fis.close(); | |
} catch (FileNotFoundException e) { | |
e.printStackTrace(); | |
} catch (IOException e) { | |
e.printStackTrace(); | |
} | |
} | |
return properties; | |
} | |
/** | |
* calculates the number of bytes the given maxString represents | |
* @param maxString file size described as a String. | |
* Example: 5B, 5K, 5M, 5G, etc. | |
* @return as Bytes. | |
* Respectively: 5, 5120, 5242880, 5368709120 | |
*/ | |
protected int getAsBytes(String maxString) { | |
String maxRegex = "^(\\d+)(\\D)"; | |
if (maxString == null || "".equals(maxString)) | |
return -1; | |
int power, num = 0; | |
String numString, unitString = null; | |
if (Pattern.matches("^\\d+$", maxString)) { | |
unitString = "B"; | |
numString = maxString; | |
} | |
else { | |
numString = maxString.replaceFirst(maxRegex, "$1"); | |
unitString = maxString.replaceFirst(maxRegex, "$2"); | |
} | |
try { | |
num = Integer.parseInt(numString); | |
} catch (NumberFormatException e) { | |
String message = PROP_ATTACHMENT_SIZE_MAX + " setting is malformed.\n" + | |
"Setting must be formatted like so: [number][unit], where unit is\n" + | |
"one of the following: B, K, M, G. No max attachment size set."; | |
log.error(message); | |
return -1; | |
} | |
unitString = unitString.toUpperCase(); | |
char unit = unitString.toCharArray()[0]; //first char in that string | |
switch (unit) { | |
case ('B'): power = 0;break; | |
case ('K'): power = 1;break; | |
case ('M'): power = 2;break; | |
case ('G'): power = 3;break; | |
default: return -1; | |
} | |
int multiplier = (int) Math.pow(1024, power); | |
int value = num * multiplier; | |
return value; | |
} | |
/** | |
* @param page | |
* @param file | |
* @return true if a particular page already has a particular | |
* file attached. | |
*/ | |
protected boolean alreadyAttached(Page page, File file) { | |
String pagename = page.getName(); | |
String filename = file.getName(); | |
String attachmentId = pagename + filename; | |
if (attachedFiles == null) | |
attachedFiles = new HashSet<String>(); | |
boolean attached = attachedFiles.contains(attachmentId); | |
if (!attached) attachedFiles.add(attachmentId); | |
else log.debug("Attachment " + filename + " is already attached: Skipping."); | |
return attached; | |
} | |
/** | |
* to check if the file has been attached with any pages. | |
* @param fileName | |
* @return | |
*/ | |
protected boolean alreadyAttached(String fileName) { | |
if (this.attachedFiles == null || this.attachedFiles.isEmpty()) | |
return false; | |
Iterator <String>it=attachedFiles.iterator(); | |
while (it.hasNext()) | |
{ | |
String item=it.next(); | |
int index=item.lastIndexOf(fileName); | |
if (index < 0) | |
continue; | |
if (item.length() - index == fileName.length()) | |
return true; | |
} | |
return false; | |
} | |
/** | |
* This method determines the mime type of a file. It uses the file | |
* conf/mime.types to map from the file name extension | |
* to a mime type. The mime type file should be read into the | |
* mimeTypes field before this method is called. | |
* | |
* @param file The file object | |
* @return the mime type of the file. | |
*/ | |
public static String determineContentType(File file) { | |
if (mimeTypes != null) { | |
return mimeTypes.getContentType(file); | |
} | |
//else assume it's an image | |
String filename = file.getName(); | |
int extensionStart = filename.lastIndexOf("."); | |
if (extensionStart >= 0) { | |
String extension = filename.substring(extensionStart + 1); | |
return "image/" + extension; | |
} | |
// Hmm... No extension. Assume it's a text file. | |
return "text/plain"; | |
} | |
Pattern switchPattern = Pattern.compile("switch"); | |
Pattern suffixPattern = Pattern.compile("suffix"); | |
private boolean handlingPageHistories = false; | |
private String pageHistorySuffix = null; | |
/** | |
* set the page history state to reflect the page history property | |
* and associated value that are passed as arguments | |
* @param key | |
* @param value | |
*/ | |
protected void handlePageHistoryProperty(String key, String value) { | |
Matcher switchFinder = switchPattern.matcher(key); | |
if (switchFinder.find()) { | |
//the default should be false, so it's ok to just parse the string. | |
this.handlingPageHistories = Boolean.parseBoolean(value); | |
return; | |
} | |
Matcher suffixFinder = suffixPattern.matcher(key); | |
if (suffixFinder.find()) { | |
setPageHistorySuffix(value); | |
return; | |
} | |
} | |
protected void handleIllegalHandling(String key, String value) { | |
boolean enabled = false; //default, confluence 4 doesn't appear to need this | |
value = value.trim(); | |
if ("false".equals(value)) | |
enabled = false; | |
illegalHandlingEnabled = enabled; | |
} | |
protected void handleAutoDetectSpacekeys(String key, String value) { | |
boolean enabled = false; //default | |
value = value.trim(); | |
if ("true".equals(value)) { | |
enabled = true; | |
} | |
autoDetectSpacekeys = enabled; | |
} | |
Pattern miscPropsPattern = Pattern.compile("" + | |
"\\w+\\.\\d+\\.([^.]+)\\.property" | |
); | |
protected Properties handleMiscellaneousProperties(String key, String value) { | |
Matcher miscKeyFinder = miscPropsPattern.matcher(key); | |
if (miscKeyFinder.matches()) { | |
String misckey = miscKeyFinder.group(1); | |
if (this.miscProperties == null) | |
this.miscProperties = new Properties(); | |
this.miscProperties.put(misckey, value); | |
log.debug("Miscellaneous Property set: " + misckey + "=" + value); | |
return this.miscProperties; | |
} | |
String error = "Miscellaneous property was detected, " + | |
"but key was invalid. Could not instantiate property: " + | |
key + "=" + value; | |
log.error(error); | |
this.errors.addError(Feedback.BAD_PROPERTY, error, true); | |
return this.miscProperties; | |
} | |
private void addDefaultMiscProperties() { | |
handleMiscellaneousProperties("Testing.1234.spacekey.property", this.settings.getSpace()); | |
} | |
protected void handleFilters(String key, String value) throws InstantiationException, IllegalAccessException { | |
log.debug("filter property = " + value); | |
getFilterValues().add(value); | |
} | |
private Set<String> getFilterValues() { | |
if (this.filterValues == null) | |
this.filterValues = new HashSet<String>(); | |
return this.filterValues; | |
} | |
/** | |
* sets up .xmlevent properties | |
* @param key must end in .xmlevent | |
* @param value must follow this format: | |
* <tt> | |
* {tag}tagname{class}classname | |
* </tt> | |
* where tagname is the xml tag to associate the event with (b, for bold) | |
* and classname is the parser that will manage the events for that tag. | |
* tagname can contain a comma-delimited list of tags. For example: | |
* {tag}h1, h2, h3{class}com.example.HeaderParser | |
*/ | |
private void handleXmlEvents(String key, String value) { | |
String tag = getXmlEventTag(value); | |
String classname = getXmlEventClassname(value); | |
String[] tags = tag.split(","); | |
for (String onetag : tags) { | |
onetag = onetag.trim(); | |
addOneXmlEvent(onetag, classname); | |
} | |
} | |
/** | |
* adds one xml event object to the events handler, such that the classname becomes | |
* an instantiated class that is associated with the given tag. | |
* The events handler can be custom (using the xmlevents misc property), or the default | |
* xml events handler will be used | |
* @param tag | |
* @param classname | |
*/ | |
private void addOneXmlEvent(String tag, String classname) { | |
if (this.miscProperties.containsKey("xmlevents")) { | |
Class eventsClass; | |
String xmleventsclass = this.miscProperties.getProperty("xmlevents"); | |
try { | |
eventsClass = Class.forName(xmleventsclass); | |
} catch (ClassNotFoundException e) { | |
log.warn("xmlevents property value - " + | |
xmleventsclass + | |
" - does not exist. Using DefaultXmlEvents."); | |
this.miscProperties.remove("xmlevents"); | |
eventsClass = DefaultXmlEvents.class; //try setting the DefaultXmlEvents | |
} | |
XmlEvents events = null; | |
try { | |
events = (XmlEvents) eventsClass.newInstance(); | |
events.addEvent(tag, classname); //call the custom events class | |
return; | |
} catch (Exception e) { | |
log.warn("xmlevents property value - " + | |
xmleventsclass + " - hasn't implemented XmlEvents. " + | |
"Using DefaultXmlEvents."); | |
this.miscProperties.remove("xmlevents"); | |
//continue to DefaultXmlEvents.addEvent below | |
} | |
} | |
new DefaultXmlEvents().addEvent(tag, classname); | |
} | |
Pattern xmleventClassPattern = Pattern.compile("" + | |
"\\{class\\}(.*)"); | |
protected String getXmlEventClassname(String value) { | |
Matcher finder = xmleventClassPattern.matcher(value); | |
if (finder.find()) { | |
return finder.group(1); | |
} | |
throw new IllegalArgumentException(XMLEVENT_PROP_ERROR); | |
} | |
Pattern xmleventTagPattern = Pattern.compile("" + | |
"\\{tag\\}([^}]+)\\{class\\}"); | |
protected String getXmlEventTag(String value) { | |
Matcher finder = xmleventTagPattern.matcher(value); | |
if (finder.find()) { | |
return finder.group(1); | |
} | |
throw new IllegalArgumentException(XMLEVENT_PROP_ERROR); | |
} | |
/** | |
* @param key | |
* @return true if the given key is the switch to turn on the | |
* Hierarchy framework | |
*/ | |
protected boolean isHierarchySwitch(String key) { | |
Matcher switchFinder = switchPattern.matcher(key); | |
return switchFinder.find(); | |
} | |
/** | |
* determines if the given string represents an allowed | |
* non converter property: (hierarchy builder, page history preserver, | |
* illegalname handler, autodetect spacekeys) | |
* @param input represents an entire converter/property string. For example: | |
* <br/> | |
* Wiki.0011.somefilename.propertytype=something | |
* @return true if it's an expected/allowed non converter property | |
*/ | |
public boolean isNonConverterProperty(String input) { | |
String converterTypes = | |
"(" + | |
"(" + | |
NONCONVERTERTYPE_HIERARCHYBUILDER + | |
")" + | |
"|" + | |
"(" + | |
NONCONVERTERTYPE_PAGEHISTORYPRESERVATION + | |
")" + | |
"|" + | |
"(" + | |
NONCONVERTERTYPE_ILLEGALHANDLING + | |
")" + | |
"|" + | |
"(" + | |
NONCONVERTERTYPE_AUTODETECTSPACEKEYS + | |
")" + | |
"|" + | |
"(" + | |
NONCONVERTERTYPE_FILTERS + | |
")" + | |
"|" + | |
"(" + | |
NONCONVERTERTYPE_MISCPROPERTIES + | |
")" + | |
"|" + | |
"(" + | |
NONCONVERTERTYPE_XMLEVENT + | |
")" + | |
")"; | |
String converterPattern = "[-\\w\\d.]+?" + converterTypes + "=" + ".*"; | |
return input.matches(converterPattern); | |
} | |
/** | |
* @return true if the converter should handle page histories | |
*/ | |
public boolean isHandlingPageHistories() { | |
return this.handlingPageHistories; | |
} | |
/** | |
* @return true if the converter should handle page histories | |
*/ | |
public boolean isHandlingPageHistoriesFromFilename() { | |
return this.handlingPageHistories && this.pageHistorySuffix != null; | |
} | |
/** | |
* @return the current page history suffix | |
*/ | |
public String getPageHistorySuffix() { | |
return this.pageHistorySuffix; | |
} | |
/** | |
* sorts the given list of pages. | |
* Note: sorting will take into account page name | |
* and page version. Non unique page objects will be culled. | |
* @param pages list of Page objects | |
* @return sorted list | |
*/ | |
protected List<Page> sortByHistory(List<Page> pages) { | |
this.state.updateNote("Sorting Pages by Page History"); | |
List<Page> sortedPages = new ArrayList<Page>(); | |
Set<Page> sorted = new TreeSet<Page>(); | |
sorted.addAll(pages); //sort them and get rid of non-unique pages | |
sortedPages.addAll(sorted); //turn them back into a list | |
return sortedPages; | |
} | |
Pattern hashPattern = Pattern.compile("#+"); | |
/** | |
* sets the page history suffix, if it's a valid suffix. | |
* If not, sets it to null. | |
* @param suffix candidate suffix, a valid candidate will have | |
* a numeric component, represented by a '#' (hash) symbol | |
* <br/> | |
* Example: -v#.txt | |
* @return true, if a valid suffix was saved. | |
* false, if the suffix was invalid, and therefore was not saved. | |
*/ | |
protected boolean setPageHistorySuffix(String suffix) { | |
//check for suffix goodness | |
Matcher hashFinder = hashPattern.matcher(suffix); | |
if (hashFinder.find()) { | |
this.pageHistorySuffix = suffix; | |
return true; | |
} | |
log.error("Error trying to preserve page history: Suffix '" + suffix + "' " + | |
"does not have a sortable component. Must include '#'."); | |
this.pageHistorySuffix = null; | |
return false; | |
} | |
/** | |
* @return HierarchyBuilder object. used by tests. | |
*/ | |
protected HierarchyBuilder getHierarchyBuilder() { | |
return hierarchyBuilder; | |
} | |
/** | |
* @return HierarchyHandler object. used by tests. | |
*/ | |
protected HierarchyHandler getHierarchyHandler() { | |
return hierarchyHandler; | |
} | |
/** | |
* sets how the hierarchy framework is to be used. | |
* @param input "UseBuilder", "UsePagenames", or "Default". | |
* If input is none of these, no changes occur | |
*/ | |
private void setHierarchyHandler(String input) { | |
if (input.matches("UseBuilder")) hierarchyHandler = HierarchyHandler.HIERARCHY_BUILDER; | |
else if (input.matches("UsePagenames")) hierarchyHandler = HierarchyHandler.PAGENAME_HIERARCHIES; | |
else if (input.matches("Default")) hierarchyHandler = HierarchyHandler.DEFAULT; | |
} | |
/** | |
* @return the feedback as it currently stands | |
*/ | |
public Feedback getConverterFeedback() { | |
return this.feedback; | |
} | |
/** | |
* resets the feedback state to Feedback.NONE | |
*/ | |
public void resetFeedback() { | |
this.feedback = Feedback.NONE; | |
} | |
/** | |
* clears state relating to the error handling | |
*/ | |
public void resetErrorHandlers() { | |
this.errors.clear(); | |
this.hadConverterErrors = false; | |
} | |
/** | |
* clears state relating to the hierarchy framework | |
*/ | |
public void resetHierarchy() { | |
this.hierarchyBuilder = null; | |
this.hierarchyHandler = HierarchyHandler.DEFAULT; | |
} | |
/** | |
* @return object contains information relating to errors triggered during the conversion | |
*/ | |
public ConverterErrors getErrors() { | |
return this.errors; | |
} | |
/** | |
* @return true if the conversion has generated errors | |
*/ | |
public boolean hadConverterErrors() { | |
return this.hadConverterErrors; | |
} | |
/** | |
* setter | |
* @param running | |
*/ | |
protected void setRunning(boolean running) { | |
this.running = running; //used in junit | |
} | |
/** | |
* setter | |
* @param settings | |
*/ | |
protected void setSettings(UWCUserSettings settings) { | |
this.settings = settings; //used in junit | |
} | |
/** | |
* @return true if the illegal handling (names and links) should occur. | |
* false if it should be disabled | |
*/ | |
public boolean isIllegalHandlingEnabled() { | |
return illegalHandlingEnabled; | |
} | |
public boolean isAutoDetectingSpacekeys() { | |
return autoDetectSpacekeys; | |
} | |
public class AsciiVersionComparator implements Comparator { | |
public int compare(Object a, Object b) { | |
Page pa = (Page) a; | |
Page pb = (Page) b; | |
String sa = pa.getName().toLowerCase(); | |
String sb = pb.getName().toLowerCase(); | |
int ascii = sa.compareTo(sb); | |
int sav = pa.getVersion(); | |
int sbv = pb.getVersion(); | |
int version = sbv - sav; | |
return ascii - version; | |
} | |
} | |
} |