| /* |
| * Licensed to the Apache Software Foundation (ASF) under one |
| * or more contributor license agreements. See the NOTICE file |
| * distributed with this work for additional information |
| * regarding copyright ownership. The ASF licenses this file |
| * to you under the Apache License, Version 2.0 (the |
| * "License"); you may not use this file except in compliance |
| * with the License. You may obtain a copy of the License at |
| * |
| * http://www.apache.org/licenses/LICENSE-2.0 |
| * |
| * Unless required by applicable law or agreed to in writing, software |
| * distributed under the License is distributed on an "AS IS" BASIS, |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| * See the License for the specific language governing permissions and |
| * limitations under the License. |
| */ |
| |
| package org.apache.storm.daemon.nimbus; |
| |
| import com.codahale.metrics.CachedGauge; |
| import com.codahale.metrics.DerivativeGauge; |
| import com.codahale.metrics.Histogram; |
| import com.codahale.metrics.Meter; |
| import com.codahale.metrics.MetricRegistry; |
| import com.codahale.metrics.MetricSet; |
| import com.codahale.metrics.SlidingTimeWindowReservoir; |
| import com.codahale.metrics.Timer; |
| import java.io.File; |
| import java.io.FileInputStream; |
| import java.io.FileOutputStream; |
| import java.io.IOException; |
| import java.io.InterruptedIOException; |
| import java.io.OutputStream; |
| import java.net.BindException; |
| import java.net.ServerSocket; |
| import java.nio.ByteBuffer; |
| import java.nio.channels.Channels; |
| import java.nio.channels.WritableByteChannel; |
| import java.security.Principal; |
| import java.util.ArrayList; |
| import java.util.Arrays; |
| import java.util.Collection; |
| import java.util.Collections; |
| import java.util.Comparator; |
| import java.util.HashMap; |
| import java.util.HashSet; |
| import java.util.Iterator; |
| import java.util.List; |
| import java.util.Map; |
| import java.util.Map.Entry; |
| import java.util.NavigableMap; |
| import java.util.Set; |
| import java.util.TreeSet; |
| import java.util.concurrent.TimeUnit; |
| import java.util.concurrent.atomic.AtomicBoolean; |
| import java.util.concurrent.atomic.AtomicLong; |
| import java.util.concurrent.atomic.AtomicReference; |
| import java.util.function.Function; |
| import java.util.function.UnaryOperator; |
| import java.util.stream.Collectors; |
| import javax.security.auth.Subject; |
| |
| import org.apache.storm.Config; |
| import org.apache.storm.Constants; |
| import org.apache.storm.DaemonConfig; |
| import org.apache.storm.StormTimer; |
| import org.apache.storm.blobstore.AtomicOutputStream; |
| import org.apache.storm.blobstore.BlobStore; |
| import org.apache.storm.blobstore.BlobStoreAclHandler; |
| import org.apache.storm.blobstore.InputStreamWithMeta; |
| import org.apache.storm.blobstore.KeySequenceNumber; |
| import org.apache.storm.blobstore.LocalFsBlobStore; |
| import org.apache.storm.callback.DefaultWatcherCallBack; |
| import org.apache.storm.cluster.ClusterStateContext; |
| import org.apache.storm.cluster.ClusterUtils; |
| import org.apache.storm.cluster.DaemonType; |
| import org.apache.storm.cluster.IStormClusterState; |
| import org.apache.storm.container.oci.OciUtils; |
| import org.apache.storm.daemon.DaemonCommon; |
| import org.apache.storm.daemon.Shutdownable; |
| import org.apache.storm.daemon.StormCommon; |
| import org.apache.storm.generated.AlreadyAliveException; |
| import org.apache.storm.generated.Assignment; |
| import org.apache.storm.generated.AuthorizationException; |
| import org.apache.storm.generated.BeginDownloadResult; |
| import org.apache.storm.generated.Bolt; |
| import org.apache.storm.generated.BoltAggregateStats; |
| import org.apache.storm.generated.ClusterSummary; |
| import org.apache.storm.generated.CommonAggregateStats; |
| import org.apache.storm.generated.ComponentAggregateStats; |
| import org.apache.storm.generated.ComponentPageInfo; |
| import org.apache.storm.generated.ComponentType; |
| import org.apache.storm.generated.Credentials; |
| import org.apache.storm.generated.DebugOptions; |
| import org.apache.storm.generated.ErrorInfo; |
| import org.apache.storm.generated.ExecutorInfo; |
| import org.apache.storm.generated.ExecutorStats; |
| import org.apache.storm.generated.ExecutorSummary; |
| import org.apache.storm.generated.GetInfoOptions; |
| import org.apache.storm.generated.IllegalStateException; |
| import org.apache.storm.generated.InvalidTopologyException; |
| import org.apache.storm.generated.KeyAlreadyExistsException; |
| import org.apache.storm.generated.KeyNotFoundException; |
| import org.apache.storm.generated.KillOptions; |
| import org.apache.storm.generated.LSTopoHistory; |
| import org.apache.storm.generated.ListBlobsResult; |
| import org.apache.storm.generated.LogConfig; |
| import org.apache.storm.generated.LogLevel; |
| import org.apache.storm.generated.LogLevelAction; |
| import org.apache.storm.generated.Nimbus.Iface; |
| import org.apache.storm.generated.Nimbus.Processor; |
| import org.apache.storm.generated.NimbusSummary; |
| import org.apache.storm.generated.NodeInfo; |
| import org.apache.storm.generated.NotAliveException; |
| import org.apache.storm.generated.NumErrorsChoice; |
| import org.apache.storm.generated.OwnerResourceSummary; |
| import org.apache.storm.generated.ProfileAction; |
| import org.apache.storm.generated.ProfileRequest; |
| import org.apache.storm.generated.ReadableBlobMeta; |
| import org.apache.storm.generated.RebalanceOptions; |
| import org.apache.storm.generated.SettableBlobMeta; |
| import org.apache.storm.generated.SpecificAggregateStats; |
| import org.apache.storm.generated.SpoutAggregateStats; |
| import org.apache.storm.generated.SpoutSpec; |
| import org.apache.storm.generated.StormBase; |
| import org.apache.storm.generated.StormTopology; |
| import org.apache.storm.generated.SubmitOptions; |
| import org.apache.storm.generated.SupervisorAssignments; |
| import org.apache.storm.generated.SupervisorInfo; |
| import org.apache.storm.generated.SupervisorPageInfo; |
| import org.apache.storm.generated.SupervisorSummary; |
| import org.apache.storm.generated.SupervisorWorkerHeartbeat; |
| import org.apache.storm.generated.SupervisorWorkerHeartbeats; |
| import org.apache.storm.generated.TopologyActionOptions; |
| import org.apache.storm.generated.TopologyHistoryInfo; |
| import org.apache.storm.generated.TopologyInfo; |
| import org.apache.storm.generated.TopologyInitialStatus; |
| import org.apache.storm.generated.TopologyPageInfo; |
| import org.apache.storm.generated.TopologyStatus; |
| import org.apache.storm.generated.TopologySummary; |
| import org.apache.storm.generated.WorkerMetricPoint; |
| import org.apache.storm.generated.WorkerMetrics; |
| import org.apache.storm.generated.WorkerResources; |
| import org.apache.storm.generated.WorkerSummary; |
| import org.apache.storm.logging.ThriftAccessLogger; |
| import org.apache.storm.metric.ClusterMetricsConsumerExecutor; |
| import org.apache.storm.metric.StormMetricsRegistry; |
| import org.apache.storm.metric.api.DataPoint; |
| import org.apache.storm.metric.api.IClusterMetricsConsumer; |
| import org.apache.storm.metric.api.IClusterMetricsConsumer.ClusterInfo; |
| import org.apache.storm.metricstore.AggLevel; |
| import org.apache.storm.metricstore.Metric; |
| import org.apache.storm.metricstore.MetricStore; |
| import org.apache.storm.metricstore.MetricStoreConfig; |
| import org.apache.storm.nimbus.AssignmentDistributionService; |
| import org.apache.storm.nimbus.DefaultTopologyValidator; |
| import org.apache.storm.nimbus.ILeaderElector; |
| import org.apache.storm.nimbus.ITopologyActionNotifierPlugin; |
| import org.apache.storm.nimbus.ITopologyValidator; |
| import org.apache.storm.nimbus.IWorkerHeartbeatsRecoveryStrategy; |
| import org.apache.storm.nimbus.NimbusInfo; |
| import org.apache.storm.nimbus.WorkerHeartbeatsRecoveryStrategyFactory; |
| import org.apache.storm.scheduler.Cluster; |
| import org.apache.storm.scheduler.DefaultScheduler; |
| import org.apache.storm.scheduler.ExecutorDetails; |
| import org.apache.storm.scheduler.INimbus; |
| import org.apache.storm.scheduler.IScheduler; |
| import org.apache.storm.scheduler.SchedulerAssignment; |
| import org.apache.storm.scheduler.SchedulerAssignmentImpl; |
| import org.apache.storm.scheduler.SupervisorDetails; |
| import org.apache.storm.scheduler.SupervisorResources; |
| import org.apache.storm.scheduler.Topologies; |
| import org.apache.storm.scheduler.TopologyDetails; |
| import org.apache.storm.scheduler.WorkerSlot; |
| import org.apache.storm.scheduler.blacklist.BlacklistScheduler; |
| import org.apache.storm.scheduler.multitenant.MultitenantScheduler; |
| import org.apache.storm.scheduler.resource.ResourceAwareScheduler; |
| import org.apache.storm.scheduler.resource.ResourceUtils; |
| import org.apache.storm.scheduler.resource.normalization.NormalizedResourceRequest; |
| import org.apache.storm.scheduler.resource.normalization.ResourceMetrics; |
| import org.apache.storm.security.INimbusCredentialPlugin; |
| import org.apache.storm.security.auth.ClientAuthUtils; |
| import org.apache.storm.security.auth.IAuthorizer; |
| import org.apache.storm.security.auth.ICredentialsRenewer; |
| import org.apache.storm.security.auth.IGroupMappingServiceProvider; |
| import org.apache.storm.security.auth.IPrincipalToLocal; |
| import org.apache.storm.security.auth.NimbusPrincipal; |
| import org.apache.storm.security.auth.ReqContext; |
| import org.apache.storm.security.auth.ThriftConnectionType; |
| import org.apache.storm.security.auth.ThriftServer; |
| import org.apache.storm.security.auth.workertoken.WorkerTokenManager; |
| import org.apache.storm.shade.com.google.common.annotations.VisibleForTesting; |
| import org.apache.storm.shade.com.google.common.base.Strings; |
| import org.apache.storm.shade.com.google.common.collect.ImmutableMap; |
| import org.apache.storm.shade.com.google.common.collect.MapDifference; |
| import org.apache.storm.shade.com.google.common.collect.Maps; |
| import org.apache.storm.shade.org.apache.curator.framework.CuratorFramework; |
| import org.apache.storm.shade.org.apache.zookeeper.ZooDefs; |
| import org.apache.storm.shade.org.apache.zookeeper.data.ACL; |
| import org.apache.storm.stats.ClientStatsUtil; |
| import org.apache.storm.stats.StatsUtil; |
| import org.apache.storm.thrift.TException; |
| import org.apache.storm.utils.BufferInputStream; |
| import org.apache.storm.utils.ConfigUtils; |
| import org.apache.storm.utils.LocalState; |
| import org.apache.storm.utils.ObjectReader; |
| import org.apache.storm.utils.ReflectionUtils; |
| import org.apache.storm.utils.RotatingMap; |
| import org.apache.storm.utils.ServerConfigUtils; |
| import org.apache.storm.utils.ServerUtils; |
| import org.apache.storm.utils.SimpleVersion; |
| import org.apache.storm.utils.Time; |
| import org.apache.storm.utils.TimeCacheMap; |
| import org.apache.storm.utils.TupleUtils; |
| import org.apache.storm.utils.Utils; |
| import org.apache.storm.utils.Utils.UptimeComputer; |
| import org.apache.storm.utils.VersionInfo; |
| import org.apache.storm.utils.WrappedAlreadyAliveException; |
| import org.apache.storm.utils.WrappedAuthorizationException; |
| import org.apache.storm.utils.WrappedIllegalStateException; |
| import org.apache.storm.utils.WrappedInvalidTopologyException; |
| import org.apache.storm.utils.WrappedNotAliveException; |
| import org.apache.storm.validation.ConfigValidation; |
| import org.apache.storm.zookeeper.AclEnforcement; |
| import org.apache.storm.zookeeper.ClientZookeeper; |
| import org.apache.storm.zookeeper.Zookeeper; |
| import org.json.simple.JSONValue; |
| import org.slf4j.Logger; |
| import org.slf4j.LoggerFactory; |
| |
| public class Nimbus implements Iface, Shutdownable, DaemonCommon { |
| @VisibleForTesting |
| public static final List<ACL> ZK_ACLS = Arrays.asList(ZooDefs.Ids.CREATOR_ALL_ACL.get(0)); |
| public static final SimpleVersion MIN_VERSION_SUPPORT_RPC_HEARTBEAT = new SimpleVersion("2.0.0"); |
| private static final Logger LOG = LoggerFactory.getLogger(Nimbus.class); |
| // Metrics |
| private final Meter submitTopologyWithOptsCalls; |
| private final Meter submitTopologyCalls; |
| private final Meter killTopologyWithOptsCalls; |
| private final Meter killTopologyCalls; |
| private final Meter rebalanceCalls; |
| private final Meter activateCalls; |
| private final Meter deactivateCalls; |
| private final Meter debugCalls; |
| private final Meter setWorkerProfilerCalls; |
| private final Meter getComponentPendingProfileActionsCalls; |
| private final Meter setLogConfigCalls; |
| private final Meter uploadNewCredentialsCalls; |
| private final Meter beginFileUploadCalls; |
| private final Meter uploadChunkCalls; |
| private final Meter finishFileUploadCalls; |
| private final Meter downloadChunkCalls; |
| private final Meter getNimbusConfCalls; |
| private final Meter getLogConfigCalls; |
| private final Meter getTopologyConfCalls; |
| private final Meter getTopologyCalls; |
| private final Meter getUserTopologyCalls; |
| private final Meter getClusterInfoCalls; |
| private final Meter getTopologySummariesCalls; |
| private final Meter getTopologySummaryCalls; |
| private final Meter getTopologySummaryByNameCalls; |
| private final Meter getLeaderCalls; |
| private final Meter isTopologyNameAllowedCalls; |
| private final Meter getTopologyInfoWithOptsCalls; |
| private final Meter getTopologyInfoCalls; |
| private final Meter getTopologyInfoByNameCalls; |
| private final Meter getTopologyInfoByNameWithOptsCalls; |
| private final Meter getTopologyPageInfoCalls; |
| private final Meter getSupervisorPageInfoCalls; |
| private final Meter getComponentPageInfoCalls; |
| private final Meter getOwnerResourceSummariesCalls; |
| private final Meter shutdownCalls; |
| private final Meter processWorkerMetricsCalls; |
| private final Meter mkAssignmentsErrors; |
| private final Meter sendAssignmentExceptions; // used in AssignmentDistributionService.java |
| |
| //Timer |
| private final Timer fileUploadDuration; |
| private final Timer schedulingDuration; |
| //Scheduler histogram |
| private final Histogram numAddedExecPerScheduling; |
| private final Histogram numAddedSlotPerScheduling; |
| private final Histogram numRemovedExecPerScheduling; |
| private final Histogram numRemovedSlotPerScheduling; |
| private final Histogram numNetExecIncreasePerScheduling; |
| private final Histogram numNetSlotIncreasePerScheduling; |
| // END Metrics |
| private static final String STORM_VERSION = VersionInfo.getVersion(); |
| |
| public static List<ACL> getNimbusAcls(Map<String, Object> conf) { |
| List<ACL> acls = null; |
| if (Utils.isZkAuthenticationConfiguredStormServer(conf)) { |
| acls = ZK_ACLS; |
| } |
| return acls; |
| } |
| |
| public static final Subject NIMBUS_SUBJECT = new Subject(); |
| |
| static { |
| NIMBUS_SUBJECT.getPrincipals().add(new NimbusPrincipal()); |
| NIMBUS_SUBJECT.setReadOnly(); |
| } |
| |
| private static final TopologyStateTransition NOOP_TRANSITION = (arg, nimbus, topoId, base) -> null; |
| private static final TopologyStateTransition INACTIVE_TRANSITION = (arg, nimbus, topoId, base) -> Nimbus.make(TopologyStatus.INACTIVE); |
| private static final TopologyStateTransition ACTIVE_TRANSITION = (arg, nimbus, topoId, base) -> Nimbus.make(TopologyStatus.ACTIVE); |
| private static final TopologyStateTransition REMOVE_TRANSITION = (args, nimbus, topoId, base) -> { |
| LOG.info("Killing topology: {}", topoId); |
| IStormClusterState state = nimbus.getStormClusterState(); |
| Assignment oldAssignment = state.assignmentInfo(topoId, null); |
| state.removeStorm(topoId); |
| notifySupervisorsAsKilled(state, oldAssignment, nimbus.getAssignmentsDistributer(), nimbus.getMetricsRegistry()); |
| nimbus.heartbeatsCache.removeTopo(topoId); |
| nimbus.getIdToExecutors().getAndUpdate(new Dissoc<>(topoId)); |
| return null; |
| }; |
| private static final TopologyStateTransition DO_REBALANCE_TRANSITION = (args, nimbus, topoId, base) -> { |
| nimbus.doRebalance(topoId, base); |
| return Nimbus.make(base.get_prev_status()); |
| }; |
| private static final TopologyStateTransition KILL_TRANSITION = (killTime, nimbus, topoId, base) -> { |
| int delay = 0; |
| if (killTime != null) { |
| delay = ((Number) killTime).intValue(); |
| } else { |
| delay = ObjectReader.getInt(Nimbus.readTopoConf(topoId, nimbus.getTopoCache()).get(Config.TOPOLOGY_MESSAGE_TIMEOUT_SECS)); |
| } |
| nimbus.delayEvent(topoId, delay, TopologyActions.REMOVE, null); |
| StormBase sb = new StormBase(); |
| sb.set_status(TopologyStatus.KILLED); |
| TopologyActionOptions tao = new TopologyActionOptions(); |
| KillOptions opts = new KillOptions(); |
| opts.set_wait_secs(delay); |
| tao.set_kill_options(opts); |
| sb.set_topology_action_options(tao); |
| sb.set_component_executors(Collections.emptyMap()); |
| sb.set_component_debug(Collections.emptyMap()); |
| return sb; |
| }; |
| |
| private static final TopologyStateTransition REBALANCE_TRANSITION = (args, nimbus, topoId, base) -> { |
| RebalanceOptions rbo = ((RebalanceOptions) args).deepCopy(); |
| int delay = 0; |
| if (rbo.is_set_wait_secs()) { |
| delay = rbo.get_wait_secs(); |
| } else { |
| delay = ObjectReader.getInt(Nimbus.readTopoConf(topoId, nimbus.getTopoCache()).get(Config.TOPOLOGY_MESSAGE_TIMEOUT_SECS)); |
| } |
| nimbus.delayEvent(topoId, delay, TopologyActions.DO_REBALANCE, null); |
| |
| rbo.set_wait_secs(delay); |
| if (!rbo.is_set_num_executors()) { |
| rbo.set_num_executors(Collections.emptyMap()); |
| } |
| |
| StormBase sb = new StormBase(); |
| sb.set_status(TopologyStatus.REBALANCING); |
| sb.set_prev_status(base.get_status()); |
| TopologyActionOptions tao = new TopologyActionOptions(); |
| tao.set_rebalance_options(rbo); |
| sb.set_topology_action_options(tao); |
| sb.set_component_executors(Collections.emptyMap()); |
| sb.set_component_debug(Collections.emptyMap()); |
| |
| return sb; |
| }; |
| private static final TopologyStateTransition GAIN_LEADERSHIP_WHEN_KILLED_TRANSITION = (args, nimbus, topoId, base) -> { |
| int delay = base.get_topology_action_options().get_kill_options().get_wait_secs(); |
| nimbus.delayEvent(topoId, delay, TopologyActions.REMOVE, null); |
| return null; |
| }; |
| private static final TopologyStateTransition GAIN_LEADERSHIP_WHEN_REBALANCING_TRANSITION = (args, nimbus, topoId, base) -> { |
| int delay = base.get_topology_action_options().get_rebalance_options().get_wait_secs(); |
| nimbus.delayEvent(topoId, delay, TopologyActions.DO_REBALANCE, null); |
| return null; |
| }; |
| private static final Map<TopologyStatus, Map<TopologyActions, TopologyStateTransition>> TOPO_STATE_TRANSITIONS = |
| new ImmutableMap.Builder<TopologyStatus, Map<TopologyActions, TopologyStateTransition>>() |
| .put(TopologyStatus.ACTIVE, new ImmutableMap.Builder<TopologyActions, TopologyStateTransition>() |
| .put(TopologyActions.INACTIVATE, INACTIVE_TRANSITION) |
| .put(TopologyActions.ACTIVATE, NOOP_TRANSITION) |
| .put(TopologyActions.REBALANCE, REBALANCE_TRANSITION) |
| .put(TopologyActions.KILL, KILL_TRANSITION) |
| .build()) |
| .put(TopologyStatus.INACTIVE, new ImmutableMap.Builder<TopologyActions, TopologyStateTransition>() |
| .put(TopologyActions.ACTIVATE, ACTIVE_TRANSITION) |
| .put(TopologyActions.INACTIVATE, NOOP_TRANSITION) |
| .put(TopologyActions.REBALANCE, REBALANCE_TRANSITION) |
| .put(TopologyActions.KILL, KILL_TRANSITION) |
| .build()) |
| .put(TopologyStatus.KILLED, new ImmutableMap.Builder<TopologyActions, TopologyStateTransition>() |
| .put(TopologyActions.GAIN_LEADERSHIP, GAIN_LEADERSHIP_WHEN_KILLED_TRANSITION) |
| .put(TopologyActions.KILL, KILL_TRANSITION) |
| .put(TopologyActions.REMOVE, REMOVE_TRANSITION) |
| .build()) |
| .put(TopologyStatus.REBALANCING, new ImmutableMap.Builder<TopologyActions, TopologyStateTransition>() |
| .put(TopologyActions.GAIN_LEADERSHIP, GAIN_LEADERSHIP_WHEN_REBALANCING_TRANSITION) |
| .put(TopologyActions.KILL, KILL_TRANSITION) |
| .put(TopologyActions.DO_REBALANCE, DO_REBALANCE_TRANSITION) |
| .build()) |
| .build(); |
| private static final List<String> EMPTY_STRING_LIST = Collections.unmodifiableList(Collections.emptyList()); |
| private static final Set<String> EMPTY_STRING_SET = Collections.unmodifiableSet(Collections.emptySet()); |
| private static final RotatingMap<String, Long> topologyCleanupDetected = new RotatingMap<>(2); |
| private static long topologyCleanupRotationTime = 0L; |
| |
| // END TOPOLOGY STATE TRANSITIONS |
| |
| private final Map<String, Object> conf; |
| private final NavigableMap<SimpleVersion, List<String>> supervisorClasspaths; |
| private final NimbusInfo nimbusHostPortInfo; |
| private final INimbus inimbus; |
| private final IAuthorizer impersonationAuthorizationHandler; |
| private final AtomicLong submittedCount; |
| private final IStormClusterState stormClusterState; |
| private final Object submitLock = new Object(); |
| private final Object schedLock = new Object(); |
| private final Object credUpdateLock = new Object(); |
| private final HeartbeatCache heartbeatsCache; |
| private final AtomicBoolean heartbeatsReadyFlag; |
| private final IWorkerHeartbeatsRecoveryStrategy heartbeatsRecoveryStrategy; |
| @SuppressWarnings("deprecation") |
| private final TimeCacheMap<String, BufferInputStream> downloaders; |
| @SuppressWarnings("deprecation") |
| private final TimeCacheMap<String, WritableByteChannel> uploaders; |
| private final BlobStore blobStore; |
| private final TopoCache topoCache; |
| @SuppressWarnings("deprecation") |
| private final TimeCacheMap<String, BufferInputStream> blobDownloaders; |
| @SuppressWarnings("deprecation") |
| private final TimeCacheMap<String, OutputStream> blobUploaders; |
| @SuppressWarnings("deprecation") |
| private final TimeCacheMap<String, Iterator<String>> blobListers; |
| private final UptimeComputer uptime; |
| private final ITopologyValidator validator; |
| private final StormTimer timer; |
| private final IScheduler scheduler; |
| private final IScheduler underlyingScheduler; |
| //Metrics related |
| private final AtomicReference<Long> schedulingStartTimeNs = new AtomicReference<>(null); |
| private final AtomicLong longestSchedulingTime = new AtomicLong(); |
| |
| private final ILeaderElector leaderElector; |
| private final AssignmentDistributionService assignmentsDistributer; |
| private final AtomicReference<Map<String, String>> idToSchedStatus; |
| private final AtomicReference<Map<String, SupervisorResources>> nodeIdToResources; |
| private final AtomicReference<Map<String, TopologyResources>> idToResources; |
| private final AtomicReference<Map<String, Map<WorkerSlot, WorkerResources>>> idToWorkerResources; |
| private final Collection<ICredentialsRenewer> credRenewers; |
| private final Object topologyHistoryLock; |
| private final LocalState topologyHistoryState; |
| private final Collection<INimbusCredentialPlugin> nimbusAutocredPlugins; |
| private final ITopologyActionNotifierPlugin nimbusTopologyActionNotifier; |
| private final List<ClusterMetricsConsumerExecutor> clusterConsumerExceutors; |
| private final IGroupMappingServiceProvider groupMapper; |
| private final IPrincipalToLocal principalToLocal; |
| private final StormMetricsRegistry metricsRegistry; |
| private final ResourceMetrics resourceMetrics; |
| private final ClusterSummaryMetricSet clusterMetricSet; |
| private MetricStore metricsStore; |
| private IAuthorizer authorizationHandler; |
| //Cached CuratorFramework, mainly used for BlobStore. |
| private final CuratorFramework zkClient; |
| //Cached topology -> executor ids, used for deciding timeout workers of heartbeatsCache. |
| private AtomicReference<Map<String, Set<List<Integer>>>> idToExecutors; |
| //May be null if worker tokens are not supported by the thrift transport. |
| private WorkerTokenManager workerTokenManager; |
| private boolean wasLeader = false; |
| |
| public Nimbus(Map<String, Object> conf, INimbus inimbus, StormMetricsRegistry metricsRegistry) throws Exception { |
| this(conf, inimbus, null, null, null, null, null, metricsRegistry); |
| } |
| |
| public Nimbus(Map<String, Object> conf, INimbus inimbus, IStormClusterState stormClusterState, NimbusInfo hostPortInfo, |
| BlobStore blobStore, ILeaderElector leaderElector, IGroupMappingServiceProvider groupMapper, |
| StormMetricsRegistry metricsRegistry) throws Exception { |
| this(conf, inimbus, stormClusterState, hostPortInfo, blobStore, null, leaderElector, groupMapper, metricsRegistry); |
| } |
| |
| public Nimbus(Map<String, Object> conf, INimbus inimbus, IStormClusterState stormClusterState, NimbusInfo hostPortInfo, |
| BlobStore blobStore, TopoCache topoCache, ILeaderElector leaderElector, IGroupMappingServiceProvider groupMapper, |
| StormMetricsRegistry metricsRegistry) |
| throws Exception { |
| this.conf = conf; |
| this.metricsRegistry = metricsRegistry; |
| this.resourceMetrics = new ResourceMetrics(metricsRegistry); |
| this.submitTopologyWithOptsCalls = metricsRegistry.registerMeter("nimbus:num-submitTopologyWithOpts-calls"); |
| this.submitTopologyCalls = metricsRegistry.registerMeter("nimbus:num-submitTopology-calls"); |
| this.killTopologyWithOptsCalls = metricsRegistry.registerMeter("nimbus:num-killTopologyWithOpts-calls"); |
| this.killTopologyCalls = metricsRegistry.registerMeter("nimbus:num-killTopology-calls"); |
| this.rebalanceCalls = metricsRegistry.registerMeter("nimbus:num-rebalance-calls"); |
| this.activateCalls = metricsRegistry.registerMeter("nimbus:num-activate-calls"); |
| this.deactivateCalls = metricsRegistry.registerMeter("nimbus:num-deactivate-calls"); |
| this.debugCalls = metricsRegistry.registerMeter("nimbus:num-debug-calls"); |
| this.setWorkerProfilerCalls = metricsRegistry.registerMeter("nimbus:num-setWorkerProfiler-calls"); |
| this.getComponentPendingProfileActionsCalls = metricsRegistry.registerMeter( |
| "nimbus:num-getComponentPendingProfileActions-calls"); |
| this.setLogConfigCalls = metricsRegistry.registerMeter("nimbus:num-setLogConfig-calls"); |
| this.uploadNewCredentialsCalls = metricsRegistry.registerMeter("nimbus:num-uploadNewCredentials-calls"); |
| this.beginFileUploadCalls = metricsRegistry.registerMeter("nimbus:num-beginFileUpload-calls"); |
| this.uploadChunkCalls = metricsRegistry.registerMeter("nimbus:num-uploadChunk-calls"); |
| this.finishFileUploadCalls = metricsRegistry.registerMeter("nimbus:num-finishFileUpload-calls"); |
| this.downloadChunkCalls = metricsRegistry.registerMeter("nimbus:num-downloadChunk-calls"); |
| this.getNimbusConfCalls = metricsRegistry.registerMeter("nimbus:num-getNimbusConf-calls"); |
| this.getLogConfigCalls = metricsRegistry.registerMeter("nimbus:num-getLogConfig-calls"); |
| this.getTopologyConfCalls = metricsRegistry.registerMeter("nimbus:num-getTopologyConf-calls"); |
| this.getTopologyCalls = metricsRegistry.registerMeter("nimbus:num-getTopology-calls"); |
| this.getUserTopologyCalls = metricsRegistry.registerMeter("nimbus:num-getUserTopology-calls"); |
| this.getClusterInfoCalls = metricsRegistry.registerMeter("nimbus:num-getClusterInfo-calls"); |
| this.getTopologySummariesCalls = metricsRegistry.registerMeter("nimbus:num-getTopologySummaries-calls"); |
| this.getTopologySummaryCalls = metricsRegistry.registerMeter("nimbus:num-getTopologySummary-calls"); |
| this.getTopologySummaryByNameCalls = metricsRegistry.registerMeter("nimbus:num-getTopologySummaryByName-calls"); |
| this.getLeaderCalls = metricsRegistry.registerMeter("nimbus:num-getLeader-calls"); |
| this.isTopologyNameAllowedCalls = metricsRegistry.registerMeter("nimbus:num-isTopologyNameAllowed-calls"); |
| this.getTopologyInfoWithOptsCalls = metricsRegistry.registerMeter( |
| "nimbus:num-getTopologyInfoWithOpts-calls"); |
| this.getTopologyInfoCalls = metricsRegistry.registerMeter("nimbus:num-getTopologyInfo-calls"); |
| this.getTopologyInfoByNameCalls = metricsRegistry.registerMeter("nimbus:num-getTopologyInfoByName-calls"); |
| this.getTopologyInfoByNameWithOptsCalls = metricsRegistry.registerMeter("nimbus:num-getTopologyInfoByNameWithOpts-calls"); |
| this.getTopologyPageInfoCalls = metricsRegistry.registerMeter("nimbus:num-getTopologyPageInfo-calls"); |
| this.getSupervisorPageInfoCalls = metricsRegistry.registerMeter("nimbus:num-getSupervisorPageInfo-calls"); |
| this.getComponentPageInfoCalls = metricsRegistry.registerMeter("nimbus:num-getComponentPageInfo-calls"); |
| this.getOwnerResourceSummariesCalls = metricsRegistry.registerMeter( |
| "nimbus:num-getOwnerResourceSummaries-calls"); |
| this.shutdownCalls = metricsRegistry.registerMeter("nimbus:num-shutdown-calls"); |
| this.processWorkerMetricsCalls = metricsRegistry.registerMeter("nimbus:process-worker-metric-calls"); |
| this.mkAssignmentsErrors = metricsRegistry.registerMeter("nimbus:mkAssignments-Errors"); |
| this.sendAssignmentExceptions = metricsRegistry.registerMeter(Constants.NIMBUS_SEND_ASSIGNMENT_EXCEPTIONS); |
| this.fileUploadDuration = metricsRegistry.registerTimer("nimbus:files-upload-duration-ms"); |
| this.schedulingDuration = metricsRegistry.registerTimer("nimbus:topology-scheduling-duration-ms"); |
| this.numAddedExecPerScheduling = metricsRegistry.registerHistogram("nimbus:num-added-executors-per-scheduling"); |
| this.numAddedSlotPerScheduling = metricsRegistry.registerHistogram("nimbus:num-added-slots-per-scheduling"); |
| this.numRemovedExecPerScheduling = metricsRegistry.registerHistogram("nimbus:num-removed-executors-per-scheduling"); |
| this.numRemovedSlotPerScheduling = metricsRegistry.registerHistogram("nimbus:num-removed-slots-per-scheduling"); |
| this.numNetExecIncreasePerScheduling = metricsRegistry.registerHistogram("nimbus:num-net-executors-increase-per-scheduling"); |
| this.numNetSlotIncreasePerScheduling = metricsRegistry.registerHistogram("nimbus:num-net-slots-increase-per-scheduling"); |
| |
| this.metricsStore = null; |
| try { |
| this.metricsStore = MetricStoreConfig.configure(conf, metricsRegistry); |
| } catch (Exception e) { |
| // the metrics store is not critical to the operation of the cluster, allow Nimbus to come up |
| LOG.error("Failed to initialize metric store", e); |
| } |
| |
| if (hostPortInfo == null) { |
| hostPortInfo = NimbusInfo.fromConf(conf); |
| } |
| this.nimbusHostPortInfo = hostPortInfo; |
| if (inimbus != null) { |
| inimbus.prepare(conf, ServerConfigUtils.masterInimbusDir(conf)); |
| } |
| |
| this.inimbus = inimbus; |
| this.authorizationHandler = StormCommon.mkAuthorizationHandler((String) conf.get(DaemonConfig.NIMBUS_AUTHORIZER), conf); |
| this.impersonationAuthorizationHandler = |
| StormCommon.mkAuthorizationHandler((String) conf.get(DaemonConfig.NIMBUS_IMPERSONATION_AUTHORIZER), conf); |
| this.submittedCount = new AtomicLong(0); |
| if (stormClusterState == null) { |
| stormClusterState = makeStormClusterState(conf); |
| } |
| this.stormClusterState = stormClusterState; |
| this.heartbeatsCache = new HeartbeatCache(); |
| this.heartbeatsReadyFlag = new AtomicBoolean(false); |
| this.heartbeatsRecoveryStrategy = WorkerHeartbeatsRecoveryStrategyFactory.getStrategy(conf); |
| this.downloaders = fileCacheMap(conf); |
| this.uploaders = fileCacheMap(conf); |
| this.blobDownloaders = makeBlobCacheMap(conf); |
| this.blobUploaders = makeBlobCacheMap(conf); |
| this.blobListers = makeBlobListCacheMap(conf); |
| this.uptime = Utils.makeUptimeComputer(); |
| this.validator = ReflectionUtils |
| .newInstance((String) conf.getOrDefault(DaemonConfig.NIMBUS_TOPOLOGY_VALIDATOR, DefaultTopologyValidator.class.getName())); |
| this.timer = new StormTimer(null, (t, e) -> { |
| LOG.error("Error while processing event", e); |
| Utils.exitProcess(20, "Error while processing event"); |
| }); |
| this.underlyingScheduler = makeScheduler(conf, inimbus); |
| this.scheduler = wrapAsBlacklistScheduler(conf, underlyingScheduler, metricsRegistry); |
| this.zkClient = makeZKClient(conf); |
| this.idToExecutors = new AtomicReference<>(new HashMap<>()); |
| |
| if (blobStore == null) { |
| blobStore = ServerUtils.getNimbusBlobStore(conf, this.nimbusHostPortInfo, null); |
| } |
| this.blobStore = blobStore; |
| |
| if (topoCache == null) { |
| topoCache = new TopoCache(blobStore, conf); |
| } |
| if (leaderElector == null) { |
| leaderElector = Zookeeper.zkLeaderElector(conf, zkClient, blobStore, topoCache, stormClusterState, getNimbusAcls(conf), |
| metricsRegistry); |
| } |
| this.leaderElector = leaderElector; |
| this.blobStore.setLeaderElector(this.leaderElector); |
| |
| this.topoCache = topoCache; |
| this.assignmentsDistributer = AssignmentDistributionService.getInstance(conf, this.scheduler); |
| this.idToSchedStatus = new AtomicReference<>(new HashMap<>()); |
| this.nodeIdToResources = new AtomicReference<>(new HashMap<>()); |
| this.idToResources = new AtomicReference<>(new HashMap<>()); |
| this.idToWorkerResources = new AtomicReference<>(new HashMap<>()); |
| this.credRenewers = ClientAuthUtils.getCredentialRenewers(conf); |
| this.topologyHistoryLock = new Object(); |
| this.topologyHistoryState = ServerConfigUtils.nimbusTopoHistoryState(conf); |
| this.nimbusAutocredPlugins = ClientAuthUtils.getNimbusAutoCredPlugins(conf); |
| this.nimbusTopologyActionNotifier = createTopologyActionNotifier(conf); |
| this.clusterConsumerExceutors = makeClusterMetricsConsumerExecutors(conf); |
| if (groupMapper == null) { |
| groupMapper = ClientAuthUtils.getGroupMappingServiceProviderPlugin(conf); |
| } |
| this.groupMapper = groupMapper; |
| this.principalToLocal = ClientAuthUtils.getPrincipalToLocalPlugin(conf); |
| // We don't use the classpath part of this, so just an empty list |
| this.supervisorClasspaths = Collections.unmodifiableNavigableMap(Utils.getConfiguredClasspathVersions(conf, EMPTY_STRING_LIST)); |
| clusterMetricSet = new ClusterSummaryMetricSet(metricsRegistry); |
| } |
| |
| // TOPOLOGY STATE TRANSITIONS |
| private static StormBase make(TopologyStatus status) { |
| StormBase ret = new StormBase(); |
| ret.set_status(status); |
| //The following are required for backwards compatibility with clojure code |
| ret.set_component_executors(Collections.emptyMap()); |
| ret.set_component_debug(Collections.emptyMap()); |
| return ret; |
| } |
| |
| @SuppressWarnings("deprecation") |
| private static <T extends AutoCloseable> TimeCacheMap<String, T> fileCacheMap(Map<String, Object> conf) { |
| return new TimeCacheMap<>(ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_FILE_COPY_EXPIRATION_SECS), 600), |
| (id, stream) -> { |
| try { |
| stream.close(); |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| } |
| |
| //Not symmetric difference. Performing A.entrySet() - B.entrySet() |
| private static <K, V> Map<K, V> mapDiff(Map<? extends K, ? extends V> first, Map<? extends K, ? extends V> second) { |
| Map<K, V> ret = new HashMap<>(); |
| for (Entry<? extends K, ? extends V> entry : second.entrySet()) { |
| if (!entry.getValue().equals(first.get(entry.getKey()))) { |
| ret.put(entry.getKey(), entry.getValue()); |
| } |
| } |
| return ret; |
| } |
| |
| private static IScheduler wrapAsBlacklistScheduler(Map<String, Object> conf, IScheduler scheduler, |
| StormMetricsRegistry metricsRegistry) { |
| BlacklistScheduler blacklistWrappedScheduler = new BlacklistScheduler(scheduler); |
| blacklistWrappedScheduler.prepare(conf, metricsRegistry); |
| return blacklistWrappedScheduler; |
| } |
| |
| private static IScheduler makeScheduler(Map<String, Object> conf, INimbus inimbus) { |
| String schedClass = (String) conf.get(DaemonConfig.STORM_SCHEDULER); |
| IScheduler scheduler = inimbus == null ? null : inimbus.getForcedScheduler(); |
| if (scheduler != null) { |
| LOG.info("Using forced scheduler from INimbus {} {}", scheduler.getClass(), scheduler); |
| } else if (schedClass != null) { |
| LOG.info("Using custom scheduler: {}", schedClass); |
| scheduler = ReflectionUtils.newInstance(schedClass); |
| } else { |
| LOG.info("Using default scheduler"); |
| scheduler = new DefaultScheduler(); |
| } |
| return scheduler; |
| } |
| |
| /** |
| * Constructs a TimeCacheMap instance with a blob store timeout whose expiration callback invokes cancel on the value held by an expired |
| * entry when that value is an AtomicOutputStream and calls close otherwise. |
| * |
| * @param conf the config to use |
| * @return the newly created map |
| */ |
| @SuppressWarnings("deprecation") |
| private static <T extends AutoCloseable> TimeCacheMap<String, T> makeBlobCacheMap(Map<String, Object> conf) { |
| return new TimeCacheMap<>(ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_BLOBSTORE_EXPIRATION_SECS), 600), |
| (id, stream) -> { |
| try { |
| if (stream instanceof AtomicOutputStream) { |
| ((AtomicOutputStream) stream).cancel(); |
| } else { |
| stream.close(); |
| } |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| } |
| |
| /** |
| * Constructs a TimeCacheMap instance with a blobstore timeout and no callback function. |
| * |
| * @param conf the config to use |
| * @return the newly created TimeCacheMap |
| */ |
| @SuppressWarnings("deprecation") |
| private static TimeCacheMap<String, Iterator<String>> makeBlobListCacheMap(Map<String, Object> conf) { |
| return new TimeCacheMap<>(ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_BLOBSTORE_EXPIRATION_SECS), 600)); |
| } |
| |
| private static ITopologyActionNotifierPlugin createTopologyActionNotifier(Map<String, Object> conf) { |
| String clazz = (String) conf.get(DaemonConfig.NIMBUS_TOPOLOGY_ACTION_NOTIFIER_PLUGIN); |
| ITopologyActionNotifierPlugin ret = null; |
| if (clazz != null && !clazz.isEmpty()) { |
| ret = ReflectionUtils.newInstance(clazz); |
| try { |
| ret.prepare(conf); |
| } catch (Exception e) { |
| LOG.warn("Ignoring exception, Could not initialize {}", clazz, e); |
| ret = null; |
| } |
| } |
| return ret; |
| } |
| |
| @SuppressWarnings("unchecked") |
| private static List<ClusterMetricsConsumerExecutor> makeClusterMetricsConsumerExecutors(Map<String, Object> conf) { |
| Collection<Map<String, Object>> consumers = (Collection<Map<String, Object>>) conf.get( |
| DaemonConfig.STORM_CLUSTER_METRICS_CONSUMER_REGISTER); |
| List<ClusterMetricsConsumerExecutor> ret = new ArrayList<>(); |
| if (consumers != null) { |
| for (Map<String, Object> consumer : consumers) { |
| ret.add(new ClusterMetricsConsumerExecutor((String) consumer.get("class"), consumer.get("argument"))); |
| } |
| } |
| return ret; |
| } |
| |
| private static Subject getSubject() { |
| return ReqContext.context().subject(); |
| } |
| |
| static Map<String, Object> readTopoConf(String topoId, TopoCache tc) throws KeyNotFoundException, |
| AuthorizationException, IOException { |
| return tc.readTopoConf(topoId, getSubject()); |
| } |
| |
| static List<String> getKeyListFromId(Map<String, Object> conf, String id) { |
| List<String> ret = new ArrayList<>(3); |
| ret.add(ConfigUtils.masterStormCodeKey(id)); |
| ret.add(ConfigUtils.masterStormConfKey(id)); |
| if (!ConfigUtils.isLocalMode(conf)) { |
| ret.add(ConfigUtils.masterStormJarKey(id)); |
| } |
| return ret; |
| } |
| |
| public static int getVersionForKey(String key, NimbusInfo nimbusInfo, |
| CuratorFramework zkClient) throws KeyNotFoundException { |
| KeySequenceNumber kseq = new KeySequenceNumber(key, nimbusInfo); |
| return kseq.getKeySequenceNumber(zkClient); |
| } |
| |
| private static StormTopology readStormTopology(String topoId, TopoCache tc) throws KeyNotFoundException, AuthorizationException, |
| IOException { |
| return tc.readTopology(topoId, getSubject()); |
| } |
| |
| private static Map<String, Object> readTopoConfAsNimbus(String topoId, TopoCache tc) throws KeyNotFoundException, |
| AuthorizationException, IOException { |
| return tc.readTopoConf(topoId, NIMBUS_SUBJECT); |
| } |
| |
| private static StormTopology readStormTopologyAsNimbus(String topoId, TopoCache tc) throws KeyNotFoundException, |
| AuthorizationException, IOException { |
| return tc.readTopology(topoId, NIMBUS_SUBJECT); |
| } |
| |
| /** |
| * convert {topology-id -> SchedulerAssignment} to {topology-id -> {executor [node port]}}. |
| * |
| * @return {topology-id -> {executor [node port]}} mapping |
| */ |
| private static Map<String, Map<List<Long>, List<Object>>> computeTopoToExecToNodePort( |
| Map<String, SchedulerAssignment> schedAssignments, List<String> assignedTopologyIds) { |
| Map<String, Map<List<Long>, List<Object>>> ret = new HashMap<>(); |
| for (Entry<String, SchedulerAssignment> schedEntry : schedAssignments.entrySet()) { |
| Map<List<Long>, List<Object>> execToNodePort = new HashMap<>(); |
| for (Entry<ExecutorDetails, WorkerSlot> execAndNodePort : schedEntry.getValue().getExecutorToSlot().entrySet()) { |
| ExecutorDetails exec = execAndNodePort.getKey(); |
| WorkerSlot slot = execAndNodePort.getValue(); |
| execToNodePort.put(exec.toList(), slot.toList()); |
| } |
| ret.put(schedEntry.getKey(), execToNodePort); |
| } |
| for (String id : assignedTopologyIds) { |
| ret.putIfAbsent(id, null); |
| } |
| return ret; |
| } |
| |
| private static int numUsedWorkers(SchedulerAssignment assignment) { |
| if (assignment == null) { |
| return 0; |
| } |
| return assignment.getSlots().size(); |
| } |
| |
| /** |
| * Convert {topology-id -> SchedulerAssignment} to {topology-id -> {WorkerSlot WorkerResources}}. Make sure this can deal with other |
| * non-RAS schedulers later we may further support map-for-any-resources. |
| * |
| * @param schedAssignments the assignments |
| * @return The resources used per slot |
| */ |
| private static Map<String, Map<WorkerSlot, WorkerResources>> computeTopoToNodePortToResources( |
| Map<String, SchedulerAssignment> schedAssignments) { |
| Map<String, Map<WorkerSlot, WorkerResources>> ret = new HashMap<>(); |
| for (Entry<String, SchedulerAssignment> schedEntry : schedAssignments.entrySet()) { |
| ret.put(schedEntry.getKey(), schedEntry.getValue().getScheduledResources()); |
| } |
| return ret; |
| } |
| |
| private boolean auditAssignmentChanges(Map<String, Assignment> existingAssignments, |
| Map<String, Assignment> newAssignments) { |
| assert existingAssignments != null && newAssignments != null; |
| boolean anyChanged = existingAssignments.isEmpty() ^ newAssignments.isEmpty(); |
| long numRemovedExec = 0; |
| long numRemovedSlot = 0; |
| long numAddedExec = 0; |
| long numAddedSlot = 0; |
| if (existingAssignments.isEmpty()) { |
| for (Entry<String, Assignment> entry : newAssignments.entrySet()) { |
| final Map<List<Long>, NodeInfo> execToPort = entry.getValue().get_executor_node_port(); |
| final long count = new HashSet<>(execToPort.values()).size(); |
| LOG.info("Assigning {} to {} slots", entry.getKey(), count); |
| LOG.info("Assign executors: {}", execToPort.keySet()); |
| numAddedSlot += count; |
| numAddedExec += execToPort.size(); |
| } |
| } else if (newAssignments.isEmpty()) { |
| for (Entry<String, Assignment> entry : existingAssignments.entrySet()) { |
| final Map<List<Long>, NodeInfo> execToPort = entry.getValue().get_executor_node_port(); |
| final long count = new HashSet<>(execToPort.values()).size(); |
| LOG.info("Removing {} from {} slots", entry.getKey(), count); |
| LOG.info("Remove executors: {}", execToPort.keySet()); |
| numRemovedSlot += count; |
| numRemovedExec += execToPort.size(); |
| } |
| } else { |
| MapDifference<String, Assignment> difference = Maps.difference(existingAssignments, newAssignments); |
| if (anyChanged = !difference.areEqual()) { |
| for (Entry<String, Assignment> entry : difference.entriesOnlyOnLeft().entrySet()) { |
| final Map<List<Long>, NodeInfo> execToPort = entry.getValue().get_executor_node_port(); |
| final long count = new HashSet<>(execToPort.values()).size(); |
| LOG.info("Removing {} from {} slots", entry.getKey(), count); |
| LOG.info("Remove executors: {}", execToPort.keySet()); |
| numRemovedSlot += count; |
| numRemovedExec += execToPort.size(); |
| } |
| for (Entry<String, Assignment> entry : difference.entriesOnlyOnRight().entrySet()) { |
| final Map<List<Long>, NodeInfo> execToPort = entry.getValue().get_executor_node_port(); |
| final long count = new HashSet<>(execToPort.values()).size(); |
| LOG.info("Assigning {} to {} slots", entry.getKey(), count); |
| LOG.info("Assign executors: {}", execToPort.keySet()); |
| numAddedSlot += count; |
| numAddedExec += execToPort.size(); |
| } |
| for (Entry<String, MapDifference.ValueDifference<Assignment>> entry : difference.entriesDiffering().entrySet()) { |
| final Map<List<Long>, NodeInfo> execToSlot = entry.getValue().rightValue().get_executor_node_port(); |
| final Set<NodeInfo> slots = new HashSet<>(execToSlot.values()); |
| LOG.info("Reassigning {} to {} slots", entry.getKey(), slots.size()); |
| LOG.info("Reassign executors: {}", execToSlot.keySet()); |
| |
| final Map<List<Long>, NodeInfo> oldExecToSlot = entry.getValue().leftValue().get_executor_node_port(); |
| |
| long commonExecCount = 0; |
| Set<NodeInfo> commonSlots = new HashSet<>(execToSlot.size()); |
| for (Entry<List<Long>, NodeInfo> execEntry : execToSlot.entrySet()) { |
| if (execEntry.getValue().equals(oldExecToSlot.get(execEntry.getKey()))) { |
| commonExecCount++; |
| commonSlots.add(execEntry.getValue()); |
| } |
| } |
| long commonSlotCount = commonSlots.size(); |
| |
| //Treat reassign as remove and add |
| numRemovedSlot += new HashSet<>(oldExecToSlot.values()).size() - commonSlotCount; |
| numRemovedExec += oldExecToSlot.size() - commonExecCount; |
| numAddedSlot += slots.size() - commonSlotCount; |
| numAddedExec += execToSlot.size() - commonExecCount; |
| } |
| } |
| LOG.debug("{} assignments unchanged: {}", difference.entriesInCommon().size(), difference.entriesInCommon().keySet()); |
| } |
| numAddedExecPerScheduling.update(numAddedExec); |
| numAddedSlotPerScheduling.update(numAddedSlot); |
| numRemovedExecPerScheduling.update(numRemovedExec); |
| numRemovedSlotPerScheduling.update(numRemovedSlot); |
| numNetExecIncreasePerScheduling.update(numAddedExec - numRemovedExec); |
| numNetSlotIncreasePerScheduling.update(numAddedSlot - numRemovedSlot); |
| |
| if (anyChanged) { |
| LOG.info("Fragmentation after scheduling is: {} MB, {} PCore CPUs", fragmentedMemory(), fragmentedCpu()); |
| nodeIdToResources.get().forEach((id, node) -> { |
| final double availableMem = node.getAvailableMem(); |
| if (availableMem < 0) { |
| LOG.warn("Memory over-scheduled on {}", id, availableMem); |
| } |
| final double availableCpu = node.getAvailableCpu(); |
| if (availableCpu < 0) { |
| LOG.warn("CPU over-scheduled on {}", id, availableCpu); |
| } |
| LOG.info( |
| "Node Id: {} Total Mem: {}, Used Mem: {}, Available Mem: {}, Total CPU: {}, Used " |
| + "CPU: {}, Available CPU: {}, fragmented: {}", |
| id, node.getTotalMem(), node.getUsedMem(), availableMem, |
| node.getTotalCpu(), node.getUsedCpu(), availableCpu, isFragmented(node)); |
| }); |
| } |
| return anyChanged; |
| } |
| |
| private static List<List<Long>> changedExecutors(Map<List<Long>, NodeInfo> map, Map<List<Long>, |
| List<Object>> newExecToNodePort) { |
| HashMap<NodeInfo, List<List<Long>>> tmpSlotAssigned = map == null ? new HashMap<>() : Utils.reverseMap(map); |
| HashMap<List<Object>, List<List<Long>>> slotAssigned = new HashMap<>(); |
| for (Entry<NodeInfo, List<List<Long>>> entry : tmpSlotAssigned.entrySet()) { |
| NodeInfo ni = entry.getKey(); |
| List<Object> key = new ArrayList<>(2); |
| key.add(ni.get_node()); |
| key.add(ni.get_port_iterator().next()); |
| List<List<Long>> value = new ArrayList<>(entry.getValue()); |
| value.sort(Comparator.comparing(a -> a.get(0))); |
| slotAssigned.put(key, value); |
| } |
| HashMap<List<Object>, List<List<Long>>> tmpNewSlotAssigned = newExecToNodePort == null ? new HashMap<>() : |
| Utils.reverseMap(newExecToNodePort); |
| HashMap<List<Object>, List<List<Long>>> newSlotAssigned = new HashMap<>(); |
| for (Entry<List<Object>, List<List<Long>>> entry : tmpNewSlotAssigned.entrySet()) { |
| List<List<Long>> value = new ArrayList<>(entry.getValue()); |
| value.sort(Comparator.comparing(a -> a.get(0))); |
| newSlotAssigned.put(entry.getKey(), value); |
| } |
| Map<List<Object>, List<List<Long>>> diff = mapDiff(slotAssigned, newSlotAssigned); |
| List<List<Long>> ret = new ArrayList<>(); |
| for (List<List<Long>> val : diff.values()) { |
| ret.addAll(val); |
| } |
| return ret; |
| } |
| |
| private static Set<WorkerSlot> newlyAddedSlots(Assignment old, Assignment current) { |
| Set<NodeInfo> oldSlots = new HashSet<>(old.get_executor_node_port().values()); |
| Set<NodeInfo> niRet = new HashSet<>(current.get_executor_node_port().values()); |
| niRet.removeAll(oldSlots); |
| Set<WorkerSlot> ret = new HashSet<>(); |
| for (NodeInfo ni : niRet) { |
| ret.add(new WorkerSlot(ni.get_node(), ni.get_port_iterator().next())); |
| } |
| return ret; |
| } |
| |
| private static Map<String, SupervisorDetails> basicSupervisorDetailsMap(IStormClusterState state) { |
| Map<String, SupervisorDetails> ret = new HashMap<>(); |
| for (Entry<String, SupervisorInfo> entry : state.allSupervisorInfo().entrySet()) { |
| String id = entry.getKey(); |
| SupervisorInfo info = entry.getValue(); |
| ret.put(id, new SupervisorDetails(id, info.get_server_port(), info.get_hostname(), |
| info.get_scheduler_meta(), null, info.get_resources_map())); |
| } |
| return ret; |
| } |
| |
| /** |
| * NOTE: this can return false when a topology has just been activated. The topology may still be |
| * in the STORMS_SUBTREE. |
| */ |
| private static boolean isTopologyActive(IStormClusterState state, String topoName) { |
| return state.getTopoId(topoName).isPresent(); |
| } |
| |
| private static boolean isTopologyActiveOrActivating(IStormClusterState state, String topoName) { |
| return isTopologyActive(state, topoName) || state.activeStorms().contains(topoName); |
| } |
| |
| private static Map<String, Object> tryReadTopoConf(String topoId, TopoCache tc) |
| throws NotAliveException, AuthorizationException, IOException { |
| try { |
| return readTopoConfAsNimbus(topoId, tc); |
| //Was a try-cause but I looked at the code around this and key not found is not wrapped in runtime, |
| // so it is not needed |
| } catch (KeyNotFoundException e) { |
| if (topoId == null) { |
| throw new NullPointerException(); |
| } |
| throw new WrappedNotAliveException(topoId); |
| } |
| } |
| |
| private static void rotateTopologyCleanupMap(long deletionDelay) { |
| if (Time.currentTimeMillis() - topologyCleanupRotationTime > deletionDelay) { |
| topologyCleanupDetected.rotate(); |
| topologyCleanupRotationTime = Time.currentTimeMillis(); |
| } |
| } |
| |
| private static long getTopologyCleanupDetectedTime(String topologyId) { |
| Long firstDetectedForDeletion = topologyCleanupDetected.get(topologyId); |
| if (firstDetectedForDeletion == null) { |
| firstDetectedForDeletion = Time.currentTimeMillis(); |
| topologyCleanupDetected.put(topologyId, firstDetectedForDeletion); |
| } |
| return firstDetectedForDeletion; |
| } |
| |
| /** |
| * From a set of topologies that have been found to cleanup, return a set that has been detected for a minimum |
| * amount of time. Topology entries first detected less than NIMBUS_TOPOLOGY_BLOBSTORE_DELETION_DELAY_MS ago are |
| * ignored. The delay is to prevent a race conditions such as when a blobstore is created and when the topology |
| * is submitted. It is possible the Nimbus cleanup timer task will find entries to delete between these two events. |
| * |
| * <p>Tracked topology entries are rotated out of the stored map periodically. |
| * |
| * @param toposToClean topologies considered for cleanup |
| * @param conf the nimbus conf |
| * @return the set of topologies that have been detected for cleanup past the expiration time |
| */ |
| static Set<String> getExpiredTopologyIds(Set<String> toposToClean, Map<String, Object> conf) { |
| Set<String> idleTopologies = new HashSet<>(); |
| long topologyDeletionDelay = ObjectReader.getInt( |
| conf.get(DaemonConfig.NIMBUS_TOPOLOGY_BLOBSTORE_DELETION_DELAY_MS), 5 * 60 * 1000); |
| for (String topologyId : toposToClean) { |
| if (Math.max(0, Time.currentTimeMillis() - getTopologyCleanupDetectedTime(topologyId)) >= topologyDeletionDelay) { |
| idleTopologies.add(topologyId); |
| } |
| } |
| |
| rotateTopologyCleanupMap(topologyDeletionDelay); |
| |
| return idleTopologies; |
| } |
| |
| @VisibleForTesting |
| public static Set<String> topoIdsToClean(IStormClusterState state, BlobStore store, Map<String, Object> conf) { |
| Set<String> ret = new HashSet<>(); |
| ret.addAll(Utils.OR(state.heartbeatStorms(), EMPTY_STRING_LIST)); |
| ret.addAll(Utils.OR(state.errorTopologies(), EMPTY_STRING_LIST)); |
| ret.addAll(Utils.OR(store.storedTopoIds(), EMPTY_STRING_SET)); |
| ret.addAll(Utils.OR(state.backpressureTopologies(), EMPTY_STRING_LIST)); |
| ret.addAll(Utils.OR(state.idsOfTopologiesWithPrivateWorkerKeys(), EMPTY_STRING_SET)); |
| ret = getExpiredTopologyIds(ret, conf); |
| ret.removeAll(Utils.OR(state.activeStorms(), EMPTY_STRING_LIST)); |
| return ret; |
| } |
| |
| private static String extractStatusStr(StormBase base) { |
| String ret = null; |
| if (base != null) { |
| TopologyStatus status = base.get_status(); |
| if (status != null) { |
| ret = status.name().toUpperCase(); |
| } |
| } |
| return ret; |
| } |
| |
| private static StormTopology normalizeTopology(Map<String, Object> topoConf, StormTopology topology) |
| throws InvalidTopologyException { |
| StormTopology ret = topology.deepCopy(); |
| for (Object comp : StormCommon.allComponents(ret).values()) { |
| Map<String, Object> mergedConf = StormCommon.componentConf(comp); |
| mergedConf.put(Config.TOPOLOGY_TASKS, ServerUtils.getComponentParallelism(topoConf, comp)); |
| String jsonConf = JSONValue.toJSONString(mergedConf); |
| StormCommon.getComponentCommon(comp).set_json_conf(jsonConf); |
| } |
| return ret; |
| } |
| |
| private static void addToDecorators(Set<String> decorators, List<String> conf) { |
| if (conf != null) { |
| decorators.addAll(conf); |
| } |
| } |
| |
| @SuppressWarnings("unchecked") |
| private static void addToSerializers(Map<String, String> ser, List<Object> conf) { |
| if (conf != null) { |
| for (Object o : conf) { |
| if (o instanceof Map) { |
| ser.putAll((Map<String, String>) o); |
| } else { |
| ser.put((String) o, null); |
| } |
| } |
| } |
| } |
| |
| @SuppressWarnings("unchecked") |
| /** |
| * Create a normalized topology conf. |
| * |
| * @param conf the nimbus conf |
| * @param topoConf initial topology conf |
| * @param topology the Storm topology |
| */ |
| private static Map<String, Object> normalizeConf(Map<String, Object> conf, Map<String, Object> topoConf, StormTopology topology) { |
| //ensure that serializations are same for all tasks no matter what's on |
| // the supervisors. this also allows you to declare the serializations as a sequence |
| List<Map<String, Object>> allConfs = new ArrayList<>(); |
| for (Object comp : StormCommon.allComponents(topology).values()) { |
| allConfs.add(StormCommon.componentConf(comp)); |
| } |
| |
| Set<String> decorators = new HashSet<>(); |
| //Yes we are putting in a config that is not the same type we pulled out. |
| Map<String, String> serializers = new HashMap<>(); |
| for (Map<String, Object> c : allConfs) { |
| addToDecorators(decorators, (List<String>) c.get(Config.TOPOLOGY_KRYO_DECORATORS)); |
| addToSerializers(serializers, (List<Object>) c.get(Config.TOPOLOGY_KRYO_REGISTER)); |
| } |
| addToDecorators(decorators, (List<String>) topoConf.getOrDefault(Config.TOPOLOGY_KRYO_DECORATORS, |
| conf.get(Config.TOPOLOGY_KRYO_DECORATORS))); |
| addToSerializers(serializers, (List<Object>) topoConf.getOrDefault(Config.TOPOLOGY_KRYO_REGISTER, |
| conf.get(Config.TOPOLOGY_KRYO_REGISTER))); |
| |
| Map<String, Object> mergedConf = Utils.merge(conf, topoConf); |
| Map<String, Object> ret = new HashMap<>(topoConf); |
| ret.put(Config.TOPOLOGY_KRYO_REGISTER, serializers); |
| ret.put(Config.TOPOLOGY_KRYO_DECORATORS, new ArrayList<>(decorators)); |
| ret.put(Config.TOPOLOGY_ACKER_EXECUTORS, mergedConf.get(Config.TOPOLOGY_ACKER_EXECUTORS)); |
| ret.put(Config.TOPOLOGY_EVENTLOGGER_EXECUTORS, mergedConf.get(Config.TOPOLOGY_EVENTLOGGER_EXECUTORS)); |
| ret.put(Config.TOPOLOGY_MAX_TASK_PARALLELISM, mergedConf.get(Config.TOPOLOGY_MAX_TASK_PARALLELISM)); |
| |
| // storm.messaging.netty.authentication is about inter-worker communication |
| // enforce netty authentication when either topo or daemon set it to true |
| boolean enforceNettyAuth = false; |
| if (!topoConf.containsKey(Config.STORM_MESSAGING_NETTY_AUTHENTICATION)) { |
| enforceNettyAuth = (Boolean) conf.get(Config.STORM_MESSAGING_NETTY_AUTHENTICATION); |
| } else { |
| enforceNettyAuth = (Boolean) topoConf.get(Config.STORM_MESSAGING_NETTY_AUTHENTICATION) |
| || (Boolean) conf.get(Config.STORM_MESSAGING_NETTY_AUTHENTICATION); |
| } |
| LOG.debug("For netty authentication, topo conf is: {}, cluster conf is: {}, Enforce netty auth: {}", |
| topoConf.get(Config.STORM_MESSAGING_NETTY_AUTHENTICATION), |
| conf.get(Config.STORM_MESSAGING_NETTY_AUTHENTICATION), |
| enforceNettyAuth); |
| ret.put(Config.STORM_MESSAGING_NETTY_AUTHENTICATION, enforceNettyAuth); |
| |
| if (!mergedConf.containsKey(Config.TOPOLOGY_METRICS_REPORTERS) && mergedConf.containsKey(Config.STORM_METRICS_REPORTERS)) { |
| ret.put(Config.TOPOLOGY_METRICS_REPORTERS, mergedConf.get(Config.STORM_METRICS_REPORTERS)); |
| } |
| |
| // Don't allow topoConf to override various cluster-specific properties. |
| // Specifically adding the cluster settings to the topoConf here will make sure these settings |
| // also override the subsequently generated conf picked up locally on the classpath. |
| // |
| // We will be dealing with 3 confs: |
| // 1) the submitted topoConf created here |
| // 2) the combined classpath conf with the topoConf added on top |
| // 3) the nimbus conf with conf 2 above added on top. |
| // |
| // By first forcing the topology conf to contain the nimbus settings, we guarantee all three confs |
| // will have the correct settings that cannot be overriden by the submitter. |
| ret.put(Config.STORM_CGROUP_HIERARCHY_DIR, conf.get(Config.STORM_CGROUP_HIERARCHY_DIR)); |
| ret.put(Config.WORKER_METRICS, conf.get(Config.WORKER_METRICS)); |
| |
| if (mergedConf.containsKey(Config.TOPOLOGY_WORKER_TIMEOUT_SECS)) { |
| int workerTimeoutSecs = (Integer) ObjectReader.getInt(mergedConf.get(Config.TOPOLOGY_WORKER_TIMEOUT_SECS)); |
| int workerMaxTimeoutSecs = (Integer) ObjectReader.getInt(mergedConf.get(Config.WORKER_MAX_TIMEOUT_SECS)); |
| if (workerTimeoutSecs > workerMaxTimeoutSecs) { |
| ret.put(Config.TOPOLOGY_WORKER_TIMEOUT_SECS, workerMaxTimeoutSecs); |
| String topoId = (String) mergedConf.get(Config.STORM_ID); |
| LOG.warn("Topology {} topology.worker.timeout.secs is too large. Reducing from {} to {}", |
| topoId, workerTimeoutSecs, workerMaxTimeoutSecs); |
| } |
| } |
| return ret; |
| } |
| |
| private static void rmBlobKey(BlobStore store, String key, IStormClusterState state) { |
| try { |
| store.deleteBlob(key, NIMBUS_SUBJECT); |
| } catch (Exception e) { |
| //Yes eat the exception |
| LOG.info("Exception {}", e); |
| } |
| } |
| |
| /** |
| * Deletes jar files in dirLoc older than seconds. |
| * |
| * @param dirLoc the location to look in for file |
| * @param seconds how old is too old and should be deleted |
| */ |
| @VisibleForTesting |
| public static void cleanInbox(String dirLoc, int seconds) { |
| final long now = Time.currentTimeMillis(); |
| final long ms = Time.secsToMillis(seconds); |
| File dir = new File(dirLoc); |
| for (File f : dir.listFiles((file) -> file.isFile() && ((file.lastModified() + ms) <= now))) { |
| if (f.delete()) { |
| LOG.info("Cleaning inbox ... deleted: {}", f.getName()); |
| } else { |
| LOG.error("Cleaning inbox ... error deleting: {}", f.getName()); |
| } |
| } |
| } |
| |
| private static ExecutorInfo toExecInfo(List<Long> exec) { |
| return new ExecutorInfo(exec.get(0).intValue(), exec.get(1).intValue()); |
| } |
| |
| private static void validateTopologyName(String name) throws InvalidTopologyException { |
| try { |
| Utils.validateTopologyName(name); |
| } catch (IllegalArgumentException e) { |
| throw new WrappedInvalidTopologyException(e.getMessage()); |
| } |
| } |
| |
| private static StormTopology tryReadTopology(String topoId, TopoCache tc) |
| throws NotAliveException, AuthorizationException, IOException { |
| try { |
| return readStormTopologyAsNimbus(topoId, tc); |
| } catch (KeyNotFoundException e) { |
| throw new WrappedNotAliveException(topoId); |
| } |
| } |
| |
| private static void validateTopologySize(Map<String, Object> topoConf, Map<String, Object> nimbusConf, |
| StormTopology topology) throws InvalidTopologyException { |
| // check allowedWorkers only if the scheduler is not the Resource Aware Scheduler |
| if (!ServerUtils.isRas(nimbusConf)) { |
| int workerCount = ObjectReader.getInt(topoConf.get(Config.TOPOLOGY_WORKERS), 1); |
| Integer allowedWorkers = ObjectReader.getInt(nimbusConf.get(DaemonConfig.NIMBUS_SLOTS_PER_TOPOLOGY), null); |
| if (allowedWorkers != null && workerCount > allowedWorkers) { |
| throw new WrappedInvalidTopologyException("Failed to submit topology. Topology requests more than " |
| + allowedWorkers + " workers."); |
| } |
| } |
| int executorsCount = 0; |
| for (Object comp : StormCommon.allComponents(topology).values()) { |
| executorsCount += StormCommon.numStartExecutors(comp); |
| } |
| Integer allowedExecutors = ObjectReader.getInt(nimbusConf.get(DaemonConfig.NIMBUS_EXECUTORS_PER_TOPOLOGY), null); |
| if (allowedExecutors != null && executorsCount > allowedExecutors) { |
| throw new WrappedInvalidTopologyException("Failed to submit topology. Topology requests more than " |
| + allowedExecutors + " executors."); |
| } |
| } |
| |
| private static void setLoggerTimeouts(LogLevel level) { |
| int timeoutSecs = level.get_reset_log_level_timeout_secs(); |
| if (timeoutSecs > 0) { |
| level.set_reset_log_level_timeout_epoch(Time.currentTimeMillis() + Time.secsToMillis(timeoutSecs)); |
| } else { |
| level.unset_reset_log_level_timeout_epoch(); |
| } |
| } |
| |
| @VisibleForTesting |
| public static List<String> topologiesOnSupervisor(Map<String, Assignment> assignments, String supervisorId) { |
| Set<String> ret = new HashSet<>(); |
| for (Entry<String, Assignment> entry : assignments.entrySet()) { |
| Assignment assignment = entry.getValue(); |
| for (NodeInfo nodeInfo : assignment.get_executor_node_port().values()) { |
| if (supervisorId.equals(nodeInfo.get_node())) { |
| ret.add(entry.getKey()); |
| break; |
| } |
| } |
| } |
| |
| return new ArrayList<>(ret); |
| } |
| |
| private static IClusterMetricsConsumer.ClusterInfo mkClusterInfo() { |
| return new IClusterMetricsConsumer.ClusterInfo(Time.currentTimeSecs()); |
| } |
| |
| private static List<DataPoint> extractClusterMetrics(ClusterSummary summ) { |
| List<DataPoint> ret = new ArrayList<>(); |
| ret.add(new DataPoint("supervisors", summ.get_supervisors_size())); |
| ret.add(new DataPoint("topologies", summ.get_topologies_size())); |
| |
| int totalSlots = 0; |
| int usedSlots = 0; |
| for (SupervisorSummary sup : summ.get_supervisors()) { |
| usedSlots += sup.get_num_used_workers(); |
| totalSlots += sup.get_num_workers(); |
| } |
| ret.add(new DataPoint("slotsTotal", totalSlots)); |
| ret.add(new DataPoint("slotsUsed", usedSlots)); |
| ret.add(new DataPoint("slotsFree", totalSlots - usedSlots)); |
| |
| int totalExecutors = 0; |
| int totalTasks = 0; |
| for (TopologySummary topo : summ.get_topologies()) { |
| totalExecutors += topo.get_num_executors(); |
| totalTasks += topo.get_num_tasks(); |
| } |
| ret.add(new DataPoint("executorsTotal", totalExecutors)); |
| ret.add(new DataPoint("tasksTotal", totalTasks)); |
| return ret; |
| } |
| |
| private static Map<IClusterMetricsConsumer.SupervisorInfo, List<DataPoint>> extractSupervisorMetrics(ClusterSummary summ) { |
| Map<IClusterMetricsConsumer.SupervisorInfo, List<DataPoint>> ret = new HashMap<>(); |
| for (SupervisorSummary sup : summ.get_supervisors()) { |
| List<DataPoint> metrics = new ArrayList<>(); |
| metrics.add(new DataPoint("slotsTotal", sup.get_num_workers())); |
| metrics.add(new DataPoint("slotsUsed", sup.get_num_used_workers())); |
| metrics.add(new DataPoint("totalMem", sup.get_total_resources().get(Constants.COMMON_TOTAL_MEMORY_RESOURCE_NAME))); |
| metrics.add(new DataPoint("totalCpu", sup.get_total_resources().get(Constants.COMMON_CPU_RESOURCE_NAME))); |
| metrics.add(new DataPoint("usedMem", sup.get_used_mem())); |
| metrics.add(new DataPoint("usedCpu", sup.get_used_cpu())); |
| IClusterMetricsConsumer.SupervisorInfo info = |
| new IClusterMetricsConsumer.SupervisorInfo(sup.get_host(), sup.get_supervisor_id(), Time.currentTimeSecs()); |
| ret.put(info, metrics); |
| } |
| return ret; |
| } |
| |
| private static void setResourcesDefaultIfNotSet(Map<String, NormalizedResourceRequest> compResourcesMap, String compId, |
| Map<String, Object> topoConf) { |
| NormalizedResourceRequest resources = compResourcesMap.get(compId); |
| if (resources == null) { |
| compResourcesMap.put(compId, new NormalizedResourceRequest(topoConf, compId)); |
| } |
| } |
| |
| private static void validatePortAvailable(Map<String, Object> conf) throws IOException { |
| int port = ObjectReader.getInt(conf.get(Config.NIMBUS_THRIFT_PORT)); |
| try (ServerSocket socket = new ServerSocket(port)) { |
| //Nothing |
| } catch (BindException e) { |
| LOG.error("{} is not available. Check if another process is already listening on {}", port, port); |
| System.exit(0); |
| } |
| } |
| |
| @VisibleForTesting |
| public void launchServer() throws Exception { |
| try { |
| IStormClusterState state = stormClusterState; |
| NimbusInfo hpi = nimbusHostPortInfo; |
| |
| LOG.info("Starting Nimbus with conf {}", ConfigUtils.maskPasswords(conf)); |
| validator.prepare(conf); |
| |
| //add to nimbuses |
| state.addNimbusHost(hpi.getHost(), |
| new NimbusSummary(hpi.getHost(), hpi.getPort(), Time.currentTimeSecs(), false, STORM_VERSION)); |
| leaderElector.addToLeaderLockQueue(); |
| this.blobStore.startSyncBlobs(); |
| |
| for (ClusterMetricsConsumerExecutor exec: clusterConsumerExceutors) { |
| exec.prepare(); |
| } |
| |
| // Leadership coordination may be incomplete when launchServer is called. Previous behavior did a one time check |
| // which could cause Nimbus to not process TopologyActions.GAIN_LEADERSHIP transitions. Similar problem exists for |
| // HA Nimbus on being newly elected as leader. Change to a recurring pattern addresses these problems. |
| timer.scheduleRecurring(3, 5, |
| () -> { |
| try { |
| boolean isLeader = isLeader(); |
| if (isLeader && !wasLeader) { |
| for (String topoId : state.activeStorms()) { |
| transition(topoId, TopologyActions.GAIN_LEADERSHIP, null); |
| } |
| clusterMetricSet.setActive(true); |
| } |
| wasLeader = isLeader; |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| |
| final boolean doNotReassign = (Boolean) conf.getOrDefault(ServerConfigUtils.NIMBUS_DO_NOT_REASSIGN, false); |
| timer.scheduleRecurring(0, ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_MONITOR_FREQ_SECS)), |
| () -> { |
| try { |
| if (!doNotReassign) { |
| mkAssignments(); |
| } |
| doCleanup(); |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| |
| // Schedule Nimbus inbox cleaner |
| final int jarExpSecs = ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_INBOX_JAR_EXPIRATION_SECS)); |
| timer.scheduleRecurring(0, ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_CLEANUP_INBOX_FREQ_SECS)), |
| () -> { |
| try { |
| cleanInbox(getInbox(), jarExpSecs); |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| |
| |
| // Schedule topology history cleaner |
| Integer interval = ObjectReader.getInt(conf.get(DaemonConfig.LOGVIEWER_CLEANUP_INTERVAL_SECS), null); |
| if (interval != null) { |
| final int lvCleanupAgeMins = ObjectReader.getInt(conf.get(DaemonConfig.LOGVIEWER_CLEANUP_AGE_MINS)); |
| timer.scheduleRecurring(0, interval, |
| () -> { |
| try { |
| cleanTopologyHistory(lvCleanupAgeMins); |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| } |
| |
| timer.scheduleRecurring(0, ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_CREDENTIAL_RENEW_FREQ_SECS)), |
| () -> { |
| try { |
| renewCredentials(); |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| |
| metricsRegistry.registerGauge("nimbus:total-available-memory-non-negative", () -> nodeIdToResources.get().values() |
| .parallelStream() |
| .mapToDouble(supervisorResources -> Math.max(supervisorResources.getAvailableMem(), 0)) |
| .sum()); |
| metricsRegistry.registerGauge("nimbus:available-cpu-non-negative", () -> nodeIdToResources.get().values() |
| .parallelStream() |
| .mapToDouble(supervisorResources -> Math.max(supervisorResources.getAvailableCpu(), 0)) |
| .sum()); |
| metricsRegistry.registerGauge("nimbus:total-memory", () -> nodeIdToResources.get().values() |
| .parallelStream() |
| .mapToDouble(SupervisorResources::getTotalMem) |
| .sum()); |
| metricsRegistry.registerGauge("nimbus:total-cpu", () -> nodeIdToResources.get().values() |
| .parallelStream() |
| .mapToDouble(SupervisorResources::getTotalCpu) |
| .sum()); |
| metricsRegistry.registerGauge("nimbus:longest-scheduling-time-ms", () -> { |
| //We want to update longest scheduling time in real time in case scheduler get stuck |
| // Get current time before startTime to avoid potential race with scheduler's Timer |
| Long currTime = Time.nanoTime(); |
| Long startTime = schedulingStartTimeNs.get(); |
| return TimeUnit.NANOSECONDS.toMillis(startTime == null |
| ? longestSchedulingTime.get() |
| : Math.max(currTime - startTime, longestSchedulingTime.get())); |
| }); |
| metricsRegistry.registerMeter("nimbus:num-launched").mark(); |
| |
| timer.scheduleRecurring(0, ObjectReader.getInt(conf.get(DaemonConfig.STORM_CLUSTER_METRICS_CONSUMER_PUBLISH_INTERVAL_SECS)), |
| () -> { |
| try { |
| if (isLeader()) { |
| sendClusterMetricsToExecutors(); |
| } |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| |
| timer.scheduleRecurring(5, 5, clusterMetricSet); |
| } catch (Exception e) { |
| if (Utils.exceptionCauseIsInstanceOf(InterruptedException.class, e)) { |
| throw e; |
| } |
| |
| if (Utils.exceptionCauseIsInstanceOf(InterruptedIOException.class, e)) { |
| throw e; |
| } |
| LOG.error("Error on initialization of nimbus", e); |
| Utils.exitProcess(13, "Error on initialization of nimbus"); |
| } |
| } |
| |
| private static Nimbus launchServer(Map<String, Object> conf, INimbus inimbus) throws Exception { |
| StormCommon.validateDistributedMode(conf); |
| validatePortAvailable(conf); |
| OciUtils.validateImageInDaemonConf(conf); |
| StormMetricsRegistry metricsRegistry = new StormMetricsRegistry(); |
| final Nimbus nimbus = new Nimbus(conf, inimbus, metricsRegistry); |
| nimbus.launchServer(); |
| final ThriftServer server = new ThriftServer(conf, new Processor<>(nimbus), ThriftConnectionType.NIMBUS); |
| metricsRegistry.startMetricsReporters(conf); |
| Utils.addShutdownHookWithDelayedForceKill(() -> { |
| metricsRegistry.stopMetricsReporters(); |
| nimbus.shutdown(); |
| server.stop(); |
| }, 10); |
| if (ClientAuthUtils.areWorkerTokensEnabledServer(server, conf)) { |
| nimbus.initWorkerTokenManager(); |
| } |
| LOG.info("Starting nimbus server for storm version '{}'", STORM_VERSION); |
| server.serve(); |
| return nimbus; |
| } |
| |
| public static Nimbus launch(INimbus inimbus) throws Exception { |
| Map<String, Object> conf = Utils.merge(ConfigUtils.readStormConfig(), |
| ConfigUtils.readYamlConfig("storm-cluster-auth.yaml", false)); |
| boolean fixupAcl = (boolean) conf.get(DaemonConfig.STORM_NIMBUS_ZOOKEEPER_ACLS_FIXUP); |
| boolean checkAcl = fixupAcl || (boolean) conf.get(DaemonConfig.STORM_NIMBUS_ZOOKEEPER_ACLS_CHECK); |
| if (checkAcl) { |
| AclEnforcement.verifyAcls(conf, fixupAcl); |
| } |
| return launchServer(conf, inimbus); |
| } |
| |
| public static void main(String[] args) throws Exception { |
| Utils.setupDefaultUncaughtExceptionHandler(); |
| launch(new StandaloneINimbus()); |
| } |
| |
| @SuppressWarnings("checkstyle:AbbreviationAsWordInName") |
| private static CuratorFramework makeZKClient(Map<String, Object> conf) { |
| List<String> servers = (List<String>) conf.get(Config.STORM_ZOOKEEPER_SERVERS); |
| Object port = conf.get(Config.STORM_ZOOKEEPER_PORT); |
| String root = (String) conf.get(Config.STORM_ZOOKEEPER_ROOT); |
| CuratorFramework ret = null; |
| if (servers != null && port != null) { |
| ret = ClientZookeeper.mkClient(conf, servers, port, root, new DefaultWatcherCallBack(), conf, DaemonType.NIMBUS); |
| } |
| return ret; |
| } |
| |
| private static IStormClusterState makeStormClusterState(Map<String, Object> conf) throws Exception { |
| return ClusterUtils.mkStormClusterState(conf, new ClusterStateContext(DaemonType.NIMBUS, conf)); |
| } |
| |
| private static List<Integer> asIntExec(List<Long> exec) { |
| List<Integer> ret = new ArrayList<>(2); |
| ret.add(exec.get(0).intValue()); |
| ret.add(exec.get(1).intValue()); |
| return ret; |
| } |
| |
| /** |
| * Diff old/new assignment to find nodes which assigned assignments has changed. |
| * |
| * @param oldAss old assigned assignment |
| * @param newAss new assigned assignment |
| * @return nodeId -> host map of assignments changed nodes |
| */ |
| private static Map<String, String> assignmentChangedNodes(Assignment oldAss, Assignment newAss) { |
| Map<List<Long>, NodeInfo> oldExecutorNodePort = null; |
| Map<List<Long>, NodeInfo> newExecutorNodePort = null; |
| Map<String, String> allNodeHost = new HashMap<>(); |
| if (oldAss != null) { |
| oldExecutorNodePort = oldAss.get_executor_node_port(); |
| allNodeHost.putAll(oldAss.get_node_host()); |
| } |
| if (newAss != null) { |
| newExecutorNodePort = newAss.get_executor_node_port(); |
| allNodeHost.putAll(newAss.get_node_host()); |
| } |
| //kill or newly submit |
| if (oldAss == null || newAss == null) { |
| return allNodeHost; |
| } else { |
| // rebalance |
| Map<String, String> ret = new HashMap<>(); |
| for (Map.Entry<List<Long>, NodeInfo> entry : newExecutorNodePort.entrySet()) { |
| NodeInfo newNodeInfo = entry.getValue(); |
| NodeInfo oldNodeInfo = oldExecutorNodePort.get(entry.getKey()); |
| if (null != oldNodeInfo) { |
| if (!oldNodeInfo.equals(newNodeInfo)) { |
| ret.put(oldNodeInfo.get_node(), allNodeHost.get(oldNodeInfo.get_node())); |
| ret.put(newNodeInfo.get_node(), allNodeHost.get(newNodeInfo.get_node())); |
| } |
| } else { |
| ret.put(newNodeInfo.get_node(), allNodeHost.get(newNodeInfo.get_node())); |
| } |
| } |
| |
| return ret; |
| } |
| } |
| |
| /** |
| * Pick out assignments for a specific host from all assignments. This could include multiple NUMA |
| * supervisors on an individual host. |
| * @param assignmentMap stormId -> assignment map |
| * @param hostname hostname |
| * @return stormId -> assignment map for the node |
| */ |
| private static Map<String, Assignment> assignmentsForHost(Map<String, Assignment> assignmentMap, String hostname) { |
| Map<String, Assignment> ret = new HashMap<>(); |
| |
| assignmentMap.entrySet().stream().filter(assignmentEntry -> assignmentEntry.getValue().get_node_host().values() |
| .contains(hostname)) |
| .forEach(assignmentEntry -> { |
| ret.put(assignmentEntry.getKey(), assignmentEntry.getValue()); |
| }); |
| |
| return ret; |
| } |
| |
| /** |
| * Pick out assignments for specific NodeId from all assignments. |
| * |
| * @param assignmentMap stormId -> assignment map |
| * @param nodeId supervisor node id |
| * @return stormId -> assignment map for the node |
| */ |
| private static Map<String, Assignment> assignmentsForNodeId(Map<String, Assignment> assignmentMap, String nodeId) { |
| Map<String, Assignment> ret = new HashMap<>(); |
| |
| assignmentMap.entrySet().stream().filter(assignmentEntry -> assignmentEntry.getValue().get_node_host().keySet() |
| |
| .contains(nodeId)) |
| .forEach(assignmentEntry -> { |
| ret.put(assignmentEntry.getKey(), assignmentEntry.getValue()); |
| }); |
| |
| return ret; |
| } |
| |
| |
| /** |
| * Notify supervisors/nodes assigned assignments. |
| * |
| * @param assignments assignments map for nodes |
| * @param service {@link AssignmentDistributionService} for distributing assignments asynchronous |
| * @param nodeHost node -> host map |
| * @param supervisorDetails nodeId -> {@link SupervisorDetails} map |
| */ |
| private static void notifySupervisorsAssignments(Map<String, Assignment> assignments, |
| AssignmentDistributionService service, Map<String, String> nodeHost, |
| Map<String, SupervisorDetails> supervisorDetails, |
| StormMetricsRegistry metricsRegistry) { |
| for (Map.Entry<String, String> nodeEntry : nodeHost.entrySet()) { |
| try { |
| String nodeId = nodeEntry.getKey(); |
| String hostname = nodeEntry.getValue(); |
| SupervisorAssignments supervisorAssignments = new SupervisorAssignments(); |
| supervisorAssignments.set_storm_assignment(assignmentsForHost(assignments, hostname)); |
| SupervisorDetails details = supervisorDetails.get(nodeId); |
| Integer serverPort = details != null ? details.getServerPort() : null; |
| service.addAssignmentsForNode(nodeId, nodeEntry.getValue(), serverPort, supervisorAssignments, metricsRegistry); |
| } catch (Throwable tr1) { |
| //just skip when any error happens wait for next round assignments reassign |
| LOG.error("Exception when add assignments distribution task for node {}", nodeEntry.getKey()); |
| } |
| } |
| } |
| |
| private static void notifySupervisorsAsKilled(IStormClusterState clusterState, Assignment oldAss, |
| AssignmentDistributionService service, StormMetricsRegistry metricsRegistry) { |
| Map<String, String> nodeHost = assignmentChangedNodes(oldAss, null); |
| notifySupervisorsAssignments(clusterState.assignmentsInfo(), service, nodeHost, |
| basicSupervisorDetailsMap(clusterState), metricsRegistry); |
| } |
| |
| Map<String, Object> getConf() { |
| return conf; |
| } |
| |
| @VisibleForTesting |
| public void setAuthorizationHandler(IAuthorizer authorizationHandler) { |
| this.authorizationHandler = authorizationHandler; |
| } |
| |
| private IStormClusterState getStormClusterState() { |
| return stormClusterState; |
| } |
| |
| private AssignmentDistributionService getAssignmentsDistributer() { |
| return assignmentsDistributer; |
| } |
| |
| private StormMetricsRegistry getMetricsRegistry() { |
| return metricsRegistry; |
| } |
| |
| @VisibleForTesting |
| public HeartbeatCache getHeartbeatsCache() { |
| return heartbeatsCache; |
| } |
| |
| public AtomicReference<Map<String, Set<List<Integer>>>> getIdToExecutors() { |
| return idToExecutors; |
| } |
| |
| private Set<List<Integer>> getOrUpdateExecutors(String topoId, StormBase base, Map<String, Object> topoConf, |
| StormTopology topology) |
| throws InvalidTopologyException { |
| Set<List<Integer>> executors = idToExecutors.get().get(topoId); |
| if (null == executors) { |
| executors = new HashSet<>(computeExecutors(base, topoConf, topology)); |
| idToExecutors.getAndUpdate(new Assoc<>(topoId, executors)); |
| } |
| return executors; |
| } |
| |
| private BlobStore getBlobStore() { |
| return blobStore; |
| } |
| |
| private TopoCache getTopoCache() { |
| return topoCache; |
| } |
| |
| @VisibleForTesting |
| void initWorkerTokenManager() { |
| if (workerTokenManager == null) { |
| workerTokenManager = new WorkerTokenManager(conf, getStormClusterState()); |
| } |
| } |
| |
| private boolean isLeader() throws Exception { |
| return leaderElector.isLeader(); |
| } |
| |
| private void assertIsLeader() throws Exception { |
| if (!isLeader()) { |
| NimbusInfo leaderAddress = leaderElector.getLeader(); |
| throw new RuntimeException("not a leader, current leader is " + leaderAddress); |
| } |
| } |
| |
| private String getInbox() throws IOException { |
| return ServerConfigUtils.masterInbox(conf); |
| } |
| |
| /** |
| * Used for local cluster. |
| * |
| * @param supervisor {@link org.apache.storm.daemon.supervisor.Supervisor} |
| */ |
| public void addSupervisor(org.apache.storm.daemon.supervisor.Supervisor supervisor) { |
| assignmentsDistributer.addLocalSupervisor(supervisor); |
| } |
| |
| void delayEvent(String topoId, int delaySecs, TopologyActions event, Object args) { |
| LOG.info("Delaying event {} for {} secs for {}", event, delaySecs, topoId); |
| timer.schedule(delaySecs, () -> { |
| try { |
| transition(topoId, event, args, false); |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| }); |
| } |
| |
| void doRebalance(String topoId, StormBase stormBase) throws Exception { |
| RebalanceOptions rbo = stormBase.get_topology_action_options().get_rebalance_options(); |
| StormBase updated = new StormBase(); |
| updated.set_topology_action_options(null); |
| updated.set_component_debug(Collections.emptyMap()); |
| |
| if (rbo.is_set_num_executors()) { |
| updated.set_component_executors(rbo.get_num_executors()); |
| } |
| |
| if (rbo.is_set_num_workers()) { |
| updated.set_num_workers(rbo.get_num_workers()); |
| } |
| stormClusterState.updateStorm(topoId, updated); |
| updateBlobStore(topoId, rbo, ServerUtils.principalNameToSubject(rbo.get_principal())); |
| idToExecutors.getAndUpdate(new Dissoc<>(topoId)); // remove the executors cache to let it recompute. |
| mkAssignments(topoId); |
| } |
| |
| private String toTopoId(String topoName) throws NotAliveException { |
| return stormClusterState.getTopoId(topoName) |
| .orElseThrow(() -> new WrappedNotAliveException(topoName + " is not alive")); |
| } |
| |
| private void transitionName(String topoName, TopologyActions event, Object eventArg, boolean errorOnNoTransition) throws Exception { |
| transition(toTopoId(topoName), event, eventArg, errorOnNoTransition); |
| } |
| |
| private void transition(String topoId, TopologyActions event, Object eventArg) throws Exception { |
| transition(topoId, event, eventArg, false); |
| } |
| |
| private void transition(String topoId, TopologyActions event, Object eventArg, boolean errorOnNoTransition) |
| throws Exception { |
| LOG.info("TRANSITION: {} {} {} {}", topoId, event, eventArg, errorOnNoTransition); |
| assertIsLeader(); |
| synchronized (submitLock) { |
| IStormClusterState clusterState = stormClusterState; |
| StormBase base = clusterState.stormBase(topoId, null); |
| if (base == null || base.get_status() == null) { |
| LOG.info("Cannot apply event {} to {} because topology no longer exists", event, topoId); |
| } else { |
| TopologyStatus status = base.get_status(); |
| TopologyStateTransition transition = TOPO_STATE_TRANSITIONS.get(status).get(event); |
| if (transition == null) { |
| String message = "No transition for event: " + event + ", status: " + status + " storm-id: " + topoId; |
| if (errorOnNoTransition) { |
| throw new RuntimeException(message); |
| } |
| |
| if (TopologyActions.GAIN_LEADERSHIP != event) { |
| //GAIN_LEADERSHIP is a system event so don't log an issue |
| LOG.info(message); |
| } |
| transition = NOOP_TRANSITION; |
| } |
| StormBase updates = transition.transition(eventArg, this, topoId, base); |
| if (updates != null) { |
| clusterState.updateStorm(topoId, updates); |
| } |
| } |
| } |
| } |
| |
| private void setupStormCode(Map<String, Object> conf, String topoId, String tmpJarLocation, |
| Map<String, Object> topoConf, StormTopology topology) throws Exception { |
| Subject subject = getSubject(); |
| IStormClusterState clusterState = stormClusterState; |
| BlobStore store = blobStore; |
| String jarKey = ConfigUtils.masterStormJarKey(topoId); |
| if (tmpJarLocation != null) { |
| //in local mode there is no jar |
| try (FileInputStream fin = new FileInputStream(tmpJarLocation)) { |
| store.createBlob(jarKey, fin, new SettableBlobMeta(BlobStoreAclHandler.DEFAULT), subject); |
| } |
| } |
| |
| topoCache.addTopoConf(topoId, subject, topoConf); |
| topoCache.addTopology(topoId, subject, topology); |
| } |
| |
| private void updateTopologyResources(String topoId, Map<String, Map<String, Double>> resourceOverrides, Subject subject) |
| throws AuthorizationException, IOException, KeyNotFoundException { |
| StormTopology topo = topoCache.readTopology(topoId, subject); |
| topo = topo.deepCopy(); |
| ResourceUtils.updateStormTopologyResources(topo, resourceOverrides); |
| topoCache.updateTopology(topoId, subject, topo); |
| } |
| |
| private void updateTopologyConf(String topoId, Map<String, Object> configOverride, Subject subject) |
| throws AuthorizationException, IOException, KeyNotFoundException { |
| Map<String, Object> topoConf = new HashMap<>(topoCache.readTopoConf(topoId, subject)); //Copy the data |
| topoConf.putAll(configOverride); |
| topoCache.updateTopoConf(topoId, subject, topoConf); |
| } |
| |
| private void updateBlobStore(String topoId, RebalanceOptions rbo, Subject subject) |
| throws AuthorizationException, IOException, KeyNotFoundException { |
| Map<String, Map<String, Double>> resourceOverrides = rbo.get_topology_resources_overrides(); |
| if (resourceOverrides != null && !resourceOverrides.isEmpty()) { |
| updateTopologyResources(topoId, resourceOverrides, subject); |
| } |
| String confOverride = rbo.get_topology_conf_overrides(); |
| if (confOverride != null && !confOverride.isEmpty()) { |
| updateTopologyConf(topoId, Utils.parseJson(confOverride), subject); |
| } |
| } |
| |
| private Integer getBlobReplicationCount(String key) throws Exception { |
| BlobStore store = blobStore; |
| if (store != null) { |
| return store.getBlobReplication(key, NIMBUS_SUBJECT); |
| } |
| return null; |
| } |
| |
| private void waitForDesiredCodeReplication(Map<String, Object> topoConf, String topoId) throws Exception { |
| int minReplicationCount = ObjectReader.getInt(topoConf.get(Config.TOPOLOGY_MIN_REPLICATION_COUNT)); |
| int maxWaitTime = ObjectReader.getInt(topoConf.get(Config.TOPOLOGY_MAX_REPLICATION_WAIT_TIME_SEC)); |
| int jarCount = minReplicationCount; |
| if (!ConfigUtils.isLocalMode(topoConf)) { |
| jarCount = getBlobReplicationCount(ConfigUtils.masterStormJarKey(topoId)); |
| } |
| int codeCount = getBlobReplicationCount(ConfigUtils.masterStormCodeKey(topoId)); |
| int confCount = getBlobReplicationCount(ConfigUtils.masterStormConfKey(topoId)); |
| long totalWaitTime = 0; |
| //When is this ever null? |
| if (blobStore != null) { |
| while (jarCount < minReplicationCount |
| && codeCount < minReplicationCount |
| && confCount < minReplicationCount) { |
| if (maxWaitTime > 0 && totalWaitTime > maxWaitTime) { |
| LOG.info("desired replication count of {} not achieved for {} but we have hit the max wait time {}" |
| + " so moving on with replication count for conf key = {} for code key = {} for jar key = ", |
| minReplicationCount, topoId, maxWaitTime, confCount, codeCount, jarCount); |
| return; |
| } |
| LOG.debug("Checking if I am still the leader"); |
| assertIsLeader(); |
| LOG.info("WAITING... storm-id {}, {} <? {} {} {}", topoId, minReplicationCount, jarCount, codeCount, confCount); |
| LOG.info("WAITING... {} <? {}", totalWaitTime, maxWaitTime); |
| Time.sleepSecs(1); |
| totalWaitTime++; |
| if (!ConfigUtils.isLocalMode(topoConf)) { |
| jarCount = getBlobReplicationCount(ConfigUtils.masterStormJarKey(topoId)); |
| } |
| codeCount = getBlobReplicationCount(ConfigUtils.masterStormCodeKey(topoId)); |
| confCount = getBlobReplicationCount(ConfigUtils.masterStormConfKey(topoId)); |
| } |
| } |
| LOG.info("desired replication count {} achieved for topology {}, current-replication-count for conf key = {}," |
| + " current-replication-count for code key = {}, current-replication-count for jar key = {}", |
| minReplicationCount, topoId, confCount, codeCount, jarCount); |
| } |
| |
| private TopologyDetails readTopologyDetails(String topoId, StormBase base) throws KeyNotFoundException, |
| AuthorizationException, IOException, InvalidTopologyException { |
| assert (base != null); |
| assert (topoId != null); |
| |
| Map<String, Object> topoConf = readTopoConfAsNimbus(topoId, topoCache); |
| StormTopology topo = readStormTopologyAsNimbus(topoId, topoCache); |
| if (!base.is_set_principal()) { |
| fixupBase(base, topoConf); |
| stormClusterState.updateStorm(topoId, base); |
| } |
| Map<List<Integer>, String> rawExecToComponent = computeExecutorToComponent(topoId, base, topoConf, topo); |
| Map<ExecutorDetails, String> executorsToComponent = new HashMap<>(); |
| for (Entry<List<Integer>, String> entry : rawExecToComponent.entrySet()) { |
| List<Integer> execs = entry.getKey(); |
| ExecutorDetails execDetails = new ExecutorDetails(execs.get(0), execs.get(1)); |
| executorsToComponent.put(execDetails, entry.getValue()); |
| } |
| |
| return new TopologyDetails(topoId, topoConf, topo, base.get_num_workers(), executorsToComponent, |
| base.get_launch_time_secs(), base.get_owner()); |
| } |
| |
| private void updateHeartbeatsFromZkHeartbeat(String topoId, Set<List<Integer>> allExecutors, Assignment existingAssignment) { |
| LOG.debug("Updating heartbeats for {} {} (from ZK heartbeat)", topoId, allExecutors); |
| IStormClusterState state = stormClusterState; |
| Map<List<Integer>, Map<String, Object>> executorBeats = |
| StatsUtil.convertExecutorBeats(state.executorBeats(topoId, existingAssignment.get_executor_node_port())); |
| heartbeatsCache.updateFromZkHeartbeat(topoId, executorBeats, allExecutors, getTopologyHeartbeatTimeoutSecs(topoId)); |
| } |
| |
| /** |
| * Update all the heartbeats for all the topologies' executors. |
| * |
| * @param existingAssignments current assignments (thrift) |
| * @param topologyToExecutors topology ID to executors. |
| */ |
| private void updateAllHeartbeats(Map<String, Assignment> existingAssignments, |
| Map<String, Set<List<Integer>>> topologyToExecutors, Set<String> zkHeartbeatTopologies) { |
| for (Entry<String, Assignment> entry : existingAssignments.entrySet()) { |
| String topoId = entry.getKey(); |
| if (zkHeartbeatTopologies.contains(topoId)) { |
| updateHeartbeatsFromZkHeartbeat(topoId, topologyToExecutors.get(topoId), entry.getValue()); |
| } else { |
| LOG.debug("Timing out old heartbeats for {}", topoId); |
| heartbeatsCache.timeoutOldHeartbeats(topoId, getTopologyHeartbeatTimeoutSecs(topoId)); |
| } |
| } |
| } |
| |
| private void updateCachedHeartbeatsFromWorker(SupervisorWorkerHeartbeat workerHeartbeat, int heartbeatTimeoutSecs) { |
| heartbeatsCache.updateHeartbeat(workerHeartbeat, heartbeatTimeoutSecs); |
| } |
| |
| private void updateCachedHeartbeatsFromSupervisor(SupervisorWorkerHeartbeats workerHeartbeats) { |
| for (SupervisorWorkerHeartbeat hb : workerHeartbeats.get_worker_heartbeats()) { |
| String topoId = hb.get_storm_id(); |
| int heartbeatTimeoutSecs = getTopologyHeartbeatTimeoutSecs(topoId); |
| updateCachedHeartbeatsFromWorker(hb, heartbeatTimeoutSecs); |
| } |
| if (!heartbeatsReadyFlag.get() && !Strings.isNullOrEmpty(workerHeartbeats.get_supervisor_id())) { |
| heartbeatsRecoveryStrategy.reportNodeId(workerHeartbeats.get_supervisor_id()); |
| } |
| } |
| |
| /** |
| * Decide if the heartbeats is recovered for a master, will wait for all the assignments nodes to recovery, every node will take care |
| * its node heartbeats reporting. |
| * |
| * @return true if all nodes have reported heartbeats or exceeds max-time-out |
| */ |
| private boolean isHeartbeatsRecovered() { |
| if (heartbeatsReadyFlag.get()) { |
| return true; |
| } |
| Set<String> allNodes = new HashSet<>(); |
| for (Map.Entry<String, Assignment> assignmentEntry : stormClusterState.assignmentsInfo().entrySet()) { |
| allNodes.addAll(assignmentEntry.getValue().get_node_host().keySet()); |
| } |
| boolean isReady = heartbeatsRecoveryStrategy.isReady(allNodes); |
| if (isReady) { |
| heartbeatsReadyFlag.getAndSet(true); |
| } |
| return isReady; |
| } |
| |
| /** |
| * Decide if the assignments is synchronized. |
| * |
| * @return true if assignments have been synchronized from remote state store |
| */ |
| private boolean isAssignmentsRecovered() { |
| return stormClusterState.isAssignmentsBackendSynchronized(); |
| } |
| |
| private Set<List<Integer>> aliveExecutors(String topoId, Set<List<Integer>> allExecutors, Assignment assignment) { |
| return heartbeatsCache.getAliveExecutors(topoId, allExecutors, assignment, getTopologyLaunchHeartbeatTimeoutSec(topoId)); |
| } |
| |
| private List<List<Integer>> computeExecutors(StormBase base, Map<String, Object> topoConf, |
| StormTopology topology) |
| throws InvalidTopologyException { |
| |
| assert (base != null); |
| |
| Map<String, Integer> compToExecutors = base.get_component_executors(); |
| List<List<Integer>> ret = new ArrayList<>(); |
| if (compToExecutors != null) { |
| Map<Integer, String> taskInfo = StormCommon.stormTaskInfo(topology, topoConf); |
| Map<String, List<Integer>> compToTaskList = Utils.reverseMap(taskInfo); |
| for (Entry<String, List<Integer>> entry : compToTaskList.entrySet()) { |
| String compId = entry.getKey(); |
| List<Integer> tasks = entry.getValue(); |
| tasks.sort(null); |
| Integer numExecutors = compToExecutors.get(compId); |
| if (numExecutors != null) { |
| List<List<Integer>> partitioned = Utils.partitionFixed(numExecutors, tasks); |
| for (List<Integer> partition : partitioned) { |
| ret.add(Arrays.asList(partition.get(0), partition.get(partition.size() - 1))); |
| } |
| } |
| } |
| } |
| return ret; |
| } |
| |
| private Map<List<Integer>, String> computeExecutorToComponent(String topoId, StormBase base, |
| Map<String, Object> topoConf, StormTopology topology) |
| throws InvalidTopologyException { |
| List<List<Integer>> executors = new ArrayList<>(getOrUpdateExecutors(topoId, base, topoConf, topology)); |
| Map<Integer, String> taskToComponent = StormCommon.stormTaskInfo(topology, topoConf); |
| Map<List<Integer>, String> ret = new HashMap<>(); |
| for (List<Integer> executor : executors) { |
| ret.put(executor, taskToComponent.get(executor.get(0))); |
| } |
| return ret; |
| } |
| |
| private Map<String, Set<List<Integer>>> computeTopologyToExecutors(Map<String, StormBase> bases) |
| throws KeyNotFoundException, AuthorizationException, InvalidTopologyException, IOException { |
| Map<String, Set<List<Integer>>> ret = new HashMap<>(); |
| if (bases != null) { |
| for (Entry<String, StormBase> entry : bases.entrySet()) { |
| String topoId = entry.getKey(); |
| Set<List<Integer>> executors = idToExecutors.get().get(topoId); |
| if (executors == null) { |
| Map<String, Object> topoConf = readTopoConfAsNimbus(topoId, topoCache); |
| StormTopology topology = readStormTopologyAsNimbus(topoId, topoCache); |
| executors = getOrUpdateExecutors(topoId, entry.getValue(), topoConf, topology); |
| } |
| ret.put(topoId, executors); |
| } |
| } |
| return ret; |
| } |
| |
| /** |
| * compute a topology-id -> alive executors map. |
| * |
| * @param existingAssignment the current assignments |
| * @param topologyToExecutors the executors for the current topologies |
| * @param scratchTopologyId the topology being rebalanced and should be excluded |
| * @return the map of topology id to alive executors |
| */ |
| private Map<String, Set<List<Integer>>> computeTopologyToAliveExecutors(Map<String, Assignment> existingAssignment, |
| Map<String, Set<List<Integer>>> topologyToExecutors, |
| String scratchTopologyId) { |
| Map<String, Set<List<Integer>>> ret = new HashMap<>(); |
| for (Entry<String, Assignment> entry : existingAssignment.entrySet()) { |
| String topoId = entry.getKey(); |
| Assignment assignment = entry.getValue(); |
| Set<List<Integer>> allExecutors = topologyToExecutors.get(topoId); |
| Set<List<Integer>> aliveExecutors; |
| if (topoId.equals(scratchTopologyId)) { |
| aliveExecutors = allExecutors; |
| } else { |
| aliveExecutors = new HashSet<>(aliveExecutors(topoId, allExecutors, assignment)); |
| } |
| ret.put(topoId, aliveExecutors); |
| } |
| return ret; |
| } |
| |
| private Map<String, Set<Long>> computeSupervisorToDeadPorts(Map<String, Assignment> existingAssignments, |
| Map<String, Set<List<Integer>>> topologyToExecutors, |
| Map<String, Set<List<Integer>>> topologyToAliveExecutors) { |
| Map<String, Set<Long>> ret = new HashMap<>(); |
| for (Entry<String, Assignment> entry : existingAssignments.entrySet()) { |
| String topoId = entry.getKey(); |
| Assignment assignment = entry.getValue(); |
| Set<List<Integer>> allExecutors = topologyToExecutors.get(topoId); |
| Set<List<Integer>> aliveExecutors = topologyToAliveExecutors.get(topoId); |
| Set<List<Integer>> deadExecutors = new HashSet<>(allExecutors); |
| deadExecutors.removeAll(aliveExecutors); |
| Map<List<Long>, NodeInfo> execToNodePort = assignment.get_executor_node_port(); |
| for (Entry<List<Long>, NodeInfo> assigned : execToNodePort.entrySet()) { |
| if (deadExecutors.contains(asIntExec(assigned.getKey()))) { |
| NodeInfo info = assigned.getValue(); |
| String superId = info.get_node(); |
| Set<Long> ports = ret.get(superId); |
| if (ports == null) { |
| ports = new HashSet<>(); |
| ret.put(superId, ports); |
| } |
| ports.addAll(info.get_port()); |
| } |
| } |
| } |
| return ret; |
| } |
| |
| /** |
| * Convert assignment information in zk to SchedulerAssignment, so it can be used by scheduler api. |
| * |
| * @param existingAssignments current assignments |
| * @param topologyToAliveExecutors executors that are alive |
| * @return topo ID to schedulerAssignment |
| */ |
| private Map<String, SchedulerAssignmentImpl> computeTopologyToSchedulerAssignment(Map<String, Assignment> existingAssignments, |
| Map<String, Set<List<Integer>>> |
| topologyToAliveExecutors) { |
| Map<String, SchedulerAssignmentImpl> ret = new HashMap<>(); |
| for (Entry<String, Assignment> entry : existingAssignments.entrySet()) { |
| String topoId = entry.getKey(); |
| Assignment assignment = entry.getValue(); |
| Set<List<Integer>> aliveExecutors = topologyToAliveExecutors.get(topoId); |
| Map<List<Long>, NodeInfo> execToNodePort = assignment.get_executor_node_port(); |
| Map<NodeInfo, WorkerResources> workerToResources = assignment.get_worker_resources(); |
| Map<NodeInfo, WorkerSlot> nodePortToSlot = new HashMap<>(); |
| Map<WorkerSlot, WorkerResources> slotToResources = new HashMap<>(); |
| for (Entry<NodeInfo, WorkerResources> nodeAndResources : workerToResources.entrySet()) { |
| NodeInfo info = nodeAndResources.getKey(); |
| WorkerResources resources = nodeAndResources.getValue(); |
| WorkerSlot slot = new WorkerSlot(info.get_node(), info.get_port_iterator().next()); |
| nodePortToSlot.put(info, slot); |
| slotToResources.put(slot, resources); |
| } |
| Map<ExecutorDetails, WorkerSlot> execToSlot = new HashMap<>(); |
| for (Entry<List<Long>, NodeInfo> execAndNodePort : execToNodePort.entrySet()) { |
| List<Integer> exec = asIntExec(execAndNodePort.getKey()); |
| NodeInfo info = execAndNodePort.getValue(); |
| if (aliveExecutors.contains(exec)) { |
| execToSlot.put(new ExecutorDetails(exec.get(0), exec.get(1)), nodePortToSlot.get(info)); |
| } |
| } |
| ret.put(topoId, new SchedulerAssignmentImpl(topoId, execToSlot, slotToResources, null)); |
| } |
| return ret; |
| } |
| |
| /** |
| * Read supervisor details/exclude the dead slots. |
| * |
| * @param superToDeadPorts dead ports on the supervisor |
| * @param topologies all of the topologies |
| * @param missingAssignmentTopologies topologies that need assignments |
| * @return a map: {supervisor-id SupervisorDetails} |
| */ |
| private Map<String, SupervisorDetails> readAllSupervisorDetails(Map<String, Set<Long>> superToDeadPorts, |
| Topologies topologies, Collection<String> missingAssignmentTopologies) { |
| Map<String, SupervisorDetails> ret = new HashMap<>(); |
| IStormClusterState state = stormClusterState; |
| Map<String, SupervisorInfo> superInfos = state.allSupervisorInfo(); |
| List<SupervisorDetails> superDetails = new ArrayList<>(); |
| for (Entry<String, SupervisorInfo> entry : superInfos.entrySet()) { |
| SupervisorInfo info = entry.getValue(); |
| superDetails.add(new SupervisorDetails(entry.getKey(), info.get_meta(), info.get_resources_map())); |
| } |
| // Note that allSlotsAvailableForScheduling |
| // only uses the supervisor-details. The rest of the arguments |
| // are there to satisfy the INimbus interface. |
| Map<String, Set<Long>> superToPorts = new HashMap<>(); |
| for (WorkerSlot slot : inimbus.allSlotsAvailableForScheduling(superDetails, topologies, |
| new HashSet<>(missingAssignmentTopologies))) { |
| String superId = slot.getNodeId(); |
| Set<Long> ports = superToPorts.get(superId); |
| if (ports == null) { |
| ports = new HashSet<>(); |
| superToPorts.put(superId, ports); |
| } |
| ports.add((long) slot.getPort()); |
| } |
| for (Entry<String, SupervisorInfo> entry : superInfos.entrySet()) { |
| String superId = entry.getKey(); |
| SupervisorInfo info = entry.getValue(); |
| String hostname = info.get_hostname(); |
| // Hide the dead-ports from the all-ports |
| // these dead-ports can be reused in next round of assignments |
| Set<Long> deadPorts = superToDeadPorts.get(superId); |
| Set<Long> allPorts = superToPorts.get(superId); |
| if (allPorts == null) { |
| allPorts = new HashSet<>(); |
| } else { |
| allPorts = new HashSet<>(allPorts); |
| } |
| if (deadPorts != null) { |
| allPorts.removeAll(deadPorts); |
| } |
| ret.put(superId, new SupervisorDetails(superId, hostname, info.get_scheduler_meta(), |
| allPorts, info.get_resources_map())); |
| } |
| return ret; |
| } |
| |
| private boolean isFragmented(SupervisorResources supervisorResources) { |
| double minMemory = ObjectReader.getDouble(conf.get(Config.TOPOLOGY_COMPONENT_RESOURCES_ONHEAP_MEMORY_MB), 256.0) |
| + ObjectReader.getDouble(conf.get(Config.TOPOLOGY_ACKER_RESOURCES_ONHEAP_MEMORY_MB), 128.0); |
| double minCpu = ObjectReader.getDouble(conf.get(Config.TOPOLOGY_COMPONENT_CPU_PCORE_PERCENT), 50.0) |
| + ObjectReader.getDouble(conf.get(Config.TOPOLOGY_ACKER_CPU_PCORE_PERCENT), 50.0); |
| |
| return minMemory > supervisorResources.getAvailableMem() || minCpu > supervisorResources.getAvailableCpu(); |
| } |
| |
| private double fragmentedMemory() { |
| Double res = nodeIdToResources.get().values().parallelStream().filter(this::isFragmented) |
| .mapToDouble(SupervisorResources::getAvailableMem).filter(x -> x > 0).sum(); |
| return res.intValue(); |
| } |
| |
| private int fragmentedCpu() { |
| Double res = nodeIdToResources.get().values().parallelStream().filter(this::isFragmented) |
| .mapToDouble(SupervisorResources::getAvailableCpu).filter(x -> x > 0).sum(); |
| return res.intValue(); |
| } |
| |
| private Map<String, SchedulerAssignment> computeNewSchedulerAssignments(Map<String, Assignment> existingAssignments, |
| Topologies topologies, Map<String, StormBase> bases, |
| String scratchTopologyId) |
| throws KeyNotFoundException, AuthorizationException, InvalidTopologyException, IOException { |
| |
| Map<String, Set<List<Integer>>> topoToExec = computeTopologyToExecutors(bases); |
| |
| Set<String> zkHeartbeatTopologies = topologies.getTopologies().stream() |
| .filter(topo -> !supportRpcHeartbeat(topo)) |
| .map(TopologyDetails::getId) |
| .collect(Collectors.toSet()); |
| |
| updateAllHeartbeats(existingAssignments, topoToExec, zkHeartbeatTopologies); |
| |
| Map<String, Set<List<Integer>>> topoToAliveExecutors = computeTopologyToAliveExecutors(existingAssignments, topoToExec, |
| scratchTopologyId); |
| Map<String, Set<Long>> supervisorToDeadPorts = computeSupervisorToDeadPorts(existingAssignments, topoToExec, |
| topoToAliveExecutors); |
| Map<String, SchedulerAssignmentImpl> topoToSchedAssignment = computeTopologyToSchedulerAssignment(existingAssignments, |
| topoToAliveExecutors); |
| Set<String> missingAssignmentTopologies = new HashSet<>(); |
| for (TopologyDetails topo : topologies.getTopologies()) { |
| String id = topo.getId(); |
| Set<List<Integer>> allExecs = topoToExec.get(id); |
| Set<List<Integer>> aliveExecs = topoToAliveExecutors.get(id); |
| int numDesiredWorkers = topo.getNumWorkers(); |
| int numAssignedWorkers = numUsedWorkers(topoToSchedAssignment.get(id)); |
| if (allExecs == null || allExecs.isEmpty() || !allExecs.equals(aliveExecs) || numDesiredWorkers > numAssignedWorkers) { |
| //We have something to schedule... |
| missingAssignmentTopologies.add(id); |
| } |
| } |
| Map<String, SupervisorDetails> supervisors = |
| readAllSupervisorDetails(supervisorToDeadPorts, topologies, missingAssignmentTopologies); |
| Cluster cluster = new Cluster(inimbus, resourceMetrics, supervisors, topoToSchedAssignment, topologies, conf); |
| cluster.setStatusMap(idToSchedStatus.get()); |
| |
| schedulingStartTimeNs.set(Time.nanoTime()); |
| scheduler.schedule(topologies, cluster); |
| //Get and set the start time before getting current time in order to avoid potential race with the longest-scheduling-time-ms gauge |
| final Long startTime = schedulingStartTimeNs.getAndSet(null); |
| long elapsed = Time.nanoTime() - startTime; |
| longestSchedulingTime.accumulateAndGet(elapsed, Math::max); |
| schedulingDuration.update(elapsed, TimeUnit.NANOSECONDS); |
| LOG.debug("Scheduling took {} ms for {} topologies", elapsed, topologies.getTopologies().size()); |
| |
| //merge with existing statuses |
| idToSchedStatus.set(Utils.merge(idToSchedStatus.get(), cluster.getStatusMap())); |
| nodeIdToResources.set(cluster.getSupervisorsResourcesMap()); |
| |
| // This is a hack for non-ras scheduler topology and worker resources |
| Map<String, TopologyResources> resources = cluster.getTopologyResourcesMap(); |
| idToResources.getAndAccumulate(resources, (orig, update) -> Utils.merge(orig, update)); |
| |
| Map<String, Map<WorkerSlot, WorkerResources>> workerResources = new HashMap<>(); |
| for (Entry<String, Map<WorkerSlot, WorkerResources>> uglyWorkerResources : cluster.getWorkerResourcesMap().entrySet()) { |
| Map<WorkerSlot, WorkerResources> slotToResources = new HashMap<>(); |
| for (Entry<WorkerSlot, WorkerResources> uglySlotToResources : uglyWorkerResources.getValue().entrySet()) { |
| WorkerResources wr = uglySlotToResources.getValue(); |
| slotToResources.put(uglySlotToResources.getKey(), wr); |
| } |
| workerResources.put(uglyWorkerResources.getKey(), slotToResources); |
| } |
| idToWorkerResources.getAndAccumulate(workerResources, (orig, update) -> Utils.merge(orig, update)); |
| |
| return cluster.getAssignments(); |
| } |
| |
| private boolean supportRpcHeartbeat(TopologyDetails topo) { |
| if (stormClusterState.isPacemakerStateStore()) { |
| // While using PacemakerStateStorage, ignore RPC heartbeat. |
| return false; |
| } |
| |
| if (!topo.getTopology().is_set_storm_version()) { |
| // current version supports RPC heartbeat |
| return true; |
| } |
| |
| String stormVersionStr = topo.getTopology().get_storm_version(); |
| |
| SimpleVersion stormVersion = new SimpleVersion(stormVersionStr); |
| return stormVersion.compareTo(MIN_VERSION_SUPPORT_RPC_HEARTBEAT) >= 0; |
| } |
| |
| private TopologyResources getResourcesForTopology(String topoId, StormBase base) |
| throws NotAliveException, AuthorizationException, InvalidTopologyException, IOException { |
| TopologyResources ret = idToResources.get().get(topoId); |
| if (ret == null) { |
| try { |
| IStormClusterState state = stormClusterState; |
| TopologyDetails details = readTopologyDetails(topoId, base); |
| Assignment assignment = state.assignmentInfo(topoId, null); |
| ret = new TopologyResources(details, assignment); |
| } catch (KeyNotFoundException e) { |
| //This can happen when a topology is first coming up |
| // It's thrown by the blobstore code |
| LOG.error("Failed to get topology details", e); |
| ret = new TopologyResources(); |
| } |
| } |
| return ret; |
| } |
| |
| private Map<WorkerSlot, WorkerResources> getWorkerResourcesForTopology(String topoId) { |
| Map<WorkerSlot, WorkerResources> ret = idToWorkerResources.get().get(topoId); |
| if (ret == null) { |
| IStormClusterState state = stormClusterState; |
| ret = new HashMap<>(); |
| Assignment assignment = state.assignmentInfo(topoId, null); |
| if (assignment != null && assignment.is_set_worker_resources()) { |
| for (Entry<NodeInfo, WorkerResources> entry : assignment.get_worker_resources().entrySet()) { |
| NodeInfo ni = entry.getKey(); |
| WorkerSlot slot = new WorkerSlot(ni.get_node(), ni.get_port_iterator().next()); |
| ret.put(slot, entry.getValue()); |
| } |
| idToWorkerResources.getAndUpdate(new Assoc<>(topoId, ret)); |
| } |
| } |
| return ret; |
| } |
| |
| @SuppressWarnings("checkstyle:AbbreviationAsWordInName") |
| private boolean isReadyForMKAssignments() throws Exception { |
| if (isLeader()) { |
| if (isHeartbeatsRecovered()) { |
| if (isAssignmentsRecovered()) { |
| return true; |
| } |
| LOG.warn("waiting for assignments recovery, skipping assignments"); |
| } |
| LOG.warn("waiting for worker heartbeats recovery, skipping assignments"); |
| } else { |
| LOG.info("not a leader, skipping assignments"); |
| } |
| return false; |
| } |
| |
| private void mkAssignments() throws Exception { |
| mkAssignments(null); |
| } |
| |
| private void mkAssignments(String scratchTopoId) throws Exception { |
| try { |
| if (!isReadyForMKAssignments()) { |
| return; |
| } |
| // get existing assignment (just the topologyToExecutorToNodePort map) -> default to {} |
| // filter out ones which have a executor timeout |
| // figure out available slots on cluster. add to that the used valid slots to get total slots. figure out how many executors |
| // should be in each slot (e.g., 4, 4, 4, 5) |
| // only keep existing slots that satisfy one of those slots. for rest, reassign them across remaining slots |
| // edge case for slots with no executor timeout but with supervisor timeout... just treat these as valid slots that can be |
| // reassigned to. worst comes to worse the executor will timeout and won't assign here next time around |
| |
| IStormClusterState state = stormClusterState; |
| //read all the topologies |
| Map<String, StormBase> bases; |
| Map<String, TopologyDetails> tds = new HashMap<>(); |
| synchronized (submitLock) { |
| // should promote: only fetch storm bases of topologies that need scheduling. |
| bases = state.topologyBases(); |
| |
| for (Iterator<Entry<String, StormBase>> it = bases.entrySet().iterator(); it.hasNext(); ) { |
| Entry<String, StormBase> entry = it.next(); |
| String id = entry.getKey(); |
| StormBase base = entry.getValue(); |
| try { |
| tds.put(id, readTopologyDetails(id, base)); |
| } catch (KeyNotFoundException e) { |
| //A race happened and it is probably not running |
| it.remove(); |
| } |
| } |
| } |
| List<String> assignedTopologyIds = state.assignments(null); |
| Map<String, Assignment> existingAssignments = new HashMap<>(); |
| for (String id : assignedTopologyIds) { |
| //for the topology which wants rebalance (specified by the scratchTopoId) |
| // we exclude its assignment, meaning that all the slots occupied by its assignment |
| // will be treated as free slot in the scheduler code. |
| if (!id.equals(scratchTopoId)) { |
| Assignment currentAssignment = state.assignmentInfo(id, null); |
| if (!currentAssignment.is_set_owner()) { |
| TopologyDetails td = tds.get(id); |
| if (td != null) { |
| currentAssignment.set_owner(td.getTopologySubmitter()); |
| state.setAssignment(id, currentAssignment, td.getConf()); |
| } |
| } |
| existingAssignments.put(id, currentAssignment); |
| } |
| } |
| |
| // make the new assignments for topologies |
| lockingMkAssignments(existingAssignments, bases, scratchTopoId, assignedTopologyIds, state, tds); |
| } catch (Exception e) { |
| this.mkAssignmentsErrors.mark(); |
| throw e; |
| } |
| } |
| |
| private void lockingMkAssignments(Map<String, Assignment> existingAssignments, Map<String, StormBase> bases, |
| String scratchTopoId, List<String> assignedTopologyIds, IStormClusterState state, |
| Map<String, TopologyDetails> tds) throws Exception { |
| Topologies topologies = new Topologies(tds); |
| |
| synchronized (schedLock) { |
| Map<String, SchedulerAssignment> newSchedulerAssignments = |
| computeNewSchedulerAssignments(existingAssignments, topologies, bases, scratchTopoId); |
| |
| Map<String, Map<List<Long>, List<Object>>> topologyToExecutorToNodePort = |
| computeTopoToExecToNodePort(newSchedulerAssignments, assignedTopologyIds); |
| Map<String, Map<WorkerSlot, WorkerResources>> newAssignedWorkerToResources = |
| computeTopoToNodePortToResources(newSchedulerAssignments); |
| int nowSecs = Time.currentTimeSecs(); |
| Map<String, SupervisorDetails> basicSupervisorDetailsMap = basicSupervisorDetailsMap(state); |
| //construct the final Assignments by adding start-times etc into it |
| Map<String, Assignment> newAssignments = new HashMap<>(); |
| for (Entry<String, Map<List<Long>, List<Object>>> entry : topologyToExecutorToNodePort.entrySet()) { |
| String topoId = entry.getKey(); |
| Map<List<Long>, List<Object>> execToNodePort = entry.getValue(); |
| if (execToNodePort == null) { |
| execToNodePort = new HashMap<>(); |
| } |
| Set<String> allNodes = new HashSet<>(); |
| for (List<Object> nodePort : execToNodePort.values()) { |
| allNodes.add((String) nodePort.get(0)); |
| } |
| Map<String, String> allNodeHost = new HashMap<>(); |
| Assignment existingAssignment = existingAssignments.get(topoId); |
| if (existingAssignment != null) { |
| allNodeHost.putAll(existingAssignment.get_node_host()); |
| } |
| for (String node : allNodes) { |
| String host = inimbus.getHostName(basicSupervisorDetailsMap, node); |
| if (host != null) { |
| allNodeHost.put(node, host); |
| } |
| } |
| Map<List<Long>, NodeInfo> execNodeInfo = null; |
| if (existingAssignment != null) { |
| execNodeInfo = existingAssignment.get_executor_node_port(); |
| } |
| List<List<Long>> reassignExecutors = changedExecutors(execNodeInfo, execToNodePort); |
| Map<List<Long>, Long> startTimes = new HashMap<>(); |
| if (existingAssignment != null) { |
| startTimes.putAll(existingAssignment.get_executor_start_time_secs()); |
| } |
| for (List<Long> id : reassignExecutors) { |
| startTimes.put(id, (long) nowSecs); |
| } |
| Map<WorkerSlot, WorkerResources> workerToResources = newAssignedWorkerToResources.get(topoId); |
| if (workerToResources == null) { |
| workerToResources = new HashMap<>(); |
| } |
| Assignment newAssignment = new Assignment((String) conf.get(Config.STORM_LOCAL_DIR)); |
| Map<String, String> justAssignedKeys = new HashMap<>(allNodeHost); |
| //Modifies justAssignedKeys |
| justAssignedKeys.keySet().retainAll(allNodes); |
| newAssignment.set_node_host(justAssignedKeys); |
| //convert NodePort to NodeInfo (again!!!). |
| Map<List<Long>, NodeInfo> execToNodeInfo = new HashMap<>(); |
| for (Entry<List<Long>, List<Object>> execAndNodePort : execToNodePort.entrySet()) { |
| List<Object> nodePort = execAndNodePort.getValue(); |
| NodeInfo ni = new NodeInfo(); |
| ni.set_node((String) nodePort.get(0)); |
| ni.add_to_port((Long) nodePort.get(1)); |
| execToNodeInfo.put(execAndNodePort.getKey(), ni); |
| } |
| newAssignment.set_executor_node_port(execToNodeInfo); |
| newAssignment.set_executor_start_time_secs(startTimes); |
| //do another conversion (lets just make this all common) |
| Map<NodeInfo, WorkerResources> workerResources = new HashMap<>(); |
| for (Entry<WorkerSlot, WorkerResources> wr : workerToResources.entrySet()) { |
| WorkerSlot nodePort = wr.getKey(); |
| NodeInfo ni = new NodeInfo(); |
| ni.set_node(nodePort.getNodeId()); |
| ni.add_to_port(nodePort.getPort()); |
| WorkerResources resources = wr.getValue(); |
| workerResources.put(ni, resources); |
| } |
| newAssignment.set_worker_resources(workerResources); |
| TopologyDetails td = tds.get(topoId); |
| newAssignment.set_owner(td.getTopologySubmitter()); |
| newAssignments.put(topoId, newAssignment); |
| } |
| |
| boolean assignmentChanged = auditAssignmentChanges(existingAssignments, newAssignments); |
| if (assignmentChanged) { |
| LOG.debug("RESETTING id->resources and id->worker-resources cache!"); |
| idToResources.set(new HashMap<>()); |
| idToWorkerResources.set(new HashMap<>()); |
| } |
| |
| //tasks figure out what tasks to talk to by looking at topology at runtime |
| // only log/set when there's been a change to the assignment |
| for (Entry<String, Assignment> entry : newAssignments.entrySet()) { |
| String topoId = entry.getKey(); |
| Assignment assignment = entry.getValue(); |
| Assignment existingAssignment = existingAssignments.get(topoId); |
| TopologyDetails td = topologies.getById(topoId); |
| if (assignment.equals(existingAssignment)) { |
| LOG.debug("Assignment for {} hasn't changed", topoId); |
| } else { |
| LOG.info("Setting new assignment for topology id {}: {}", topoId, assignment); |
| state.setAssignment(topoId, assignment, td.getConf()); |
| } |
| } |
| |
| //grouping assignment by node to see the nodes diff, then notify nodes/supervisors to synchronize its owned assignment |
| //because the number of existing assignments is small for every scheduling round, |
| //we expect to notify supervisors at almost the same time |
| Map<String, String> totalAssignmentsChangedNodes = new HashMap<>(); |
| for (Entry<String, Assignment> entry : newAssignments.entrySet()) { |
| String topoId = entry.getKey(); |
| Assignment assignment = entry.getValue(); |
| Assignment existingAssignment = existingAssignments.get(topoId); |
| totalAssignmentsChangedNodes.putAll(assignmentChangedNodes(existingAssignment, assignment)); |
| } |
| notifySupervisorsAssignments(newAssignments, assignmentsDistributer, totalAssignmentsChangedNodes, |
| basicSupervisorDetailsMap, getMetricsRegistry()); |
| |
| Map<String, Collection<WorkerSlot>> addedSlots = new HashMap<>(); |
| for (Entry<String, Assignment> entry : newAssignments.entrySet()) { |
| String topoId = entry.getKey(); |
| Assignment assignment = entry.getValue(); |
| Assignment existingAssignment = existingAssignments.get(topoId); |
| if (existingAssignment == null) { |
| existingAssignment = new Assignment(); |
| existingAssignment.set_executor_node_port(new HashMap<>()); |
| existingAssignment.set_executor_start_time_secs(new HashMap<>()); |
| } |
| Set<WorkerSlot> newSlots = newlyAddedSlots(existingAssignment, assignment); |
| addedSlots.put(topoId, newSlots); |
| } |
| inimbus.assignSlots(topologies, addedSlots); |
| } |
| } |
| |
| private void notifyTopologyActionListener(String topoId, String action) { |
| ITopologyActionNotifierPlugin notifier = nimbusTopologyActionNotifier; |
| if (notifier != null) { |
| try { |
| notifier.notify(topoId, action); |
| } catch (Exception e) { |
| LOG.warn("Ignoring exception from Topology action notifier for storm-Id {}", topoId, e); |
| } |
| } |
| } |
| |
| private void fixupBase(StormBase base, Map<String, Object> topoConf) { |
| base.set_owner((String) topoConf.get(Config.TOPOLOGY_SUBMITTER_USER)); |
| base.set_principal((String) topoConf.get(Config.TOPOLOGY_SUBMITTER_PRINCIPAL)); |
| } |
| |
| // Topology may set custom heartbeat timeout. |
| private int getTopologyHeartbeatTimeoutSecs(Map<String, Object> topoConf) { |
| int defaultNimbusTimeout = ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_TASK_TIMEOUT_SECS)); |
| if (topoConf.containsKey(Config.TOPOLOGY_WORKER_TIMEOUT_SECS)) { |
| int topoTimeout = ObjectReader.getInt(topoConf.get(Config.TOPOLOGY_WORKER_TIMEOUT_SECS)); |
| topoTimeout = Math.max(topoTimeout, defaultNimbusTimeout); |
| return topoTimeout; |
| } |
| |
| return defaultNimbusTimeout; |
| } |
| |
| private int getTopologyHeartbeatTimeoutSecs(String topoId) { |
| try { |
| Map<String, Object> topoConf = tryReadTopoConf(topoId, topoCache); |
| return getTopologyHeartbeatTimeoutSecs(topoConf); |
| } catch (Exception e) { |
| // contain any exception |
| LOG.warn("Exception when getting heartbeat timeout.", e.getMessage()); |
| return ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_TASK_TIMEOUT_SECS)); |
| } |
| } |
| |
| private int getTopologyLaunchHeartbeatTimeoutSec(String topoId) { |
| int nimbusLaunchTimeout = ObjectReader.getInt(conf.get(DaemonConfig.NIMBUS_TASK_LAUNCH_SECS)); |
| int topoHeartbeatTimeoutSecs = getTopologyHeartbeatTimeoutSecs(topoId); |
| return Math.max(nimbusLaunchTimeout, topoHeartbeatTimeoutSecs); |
| } |
| |
| private void startTopology(String topoName, String topoId, TopologyStatus initStatus, String owner, |
| String principal, Map<String, Object> topoConf, StormTopology stormTopology) |
| throws InvalidTopologyException { |
| assert (TopologyStatus.ACTIVE == initStatus || TopologyStatus.INACTIVE == initStatus); |
| Map<String, Integer> numExecutors = new HashMap<>(); |
| StormTopology topology = StormCommon.systemTopology(topoConf, stormTopology); |
| for (Entry<String, Object> entry : StormCommon.allComponents(topology).entrySet()) { |
| numExecutors.put(entry.getKey(), StormCommon.numStartExecutors(entry.getValue())); |
| } |
| LOG.info("Activating {}: {}", topoName, topoId); |
| StormBase base = new StormBase(); |
| base.set_name(topoName); |
| if (topoConf.containsKey(Config.TOPOLOGY_VERSION)) { |
| base.set_topology_version(ObjectReader.getString(topoConf.get(Config.TOPOLOGY_VERSION))); |
| } |
| base.set_launch_time_secs(Time.currentTimeSecs()); |
| base.set_status(initStatus); |
| base.set_num_workers(ObjectReader.getInt(topoConf.get(Config.TOPOLOGY_WORKERS), 0)); |
| base.set_component_executors(numExecutors); |
| base.set_owner(owner); |
| base.set_principal(principal); |
| base.set_component_debug(new HashMap<>()); |
| IStormClusterState state = stormClusterState; |
| state.activateStorm(topoId, base, topoConf); |
| idToExecutors.getAndUpdate(new Assoc<>(topoId, |
| new HashSet<>(computeExecutors(base, topoConf, stormTopology)))); |
| notifyTopologyActionListener(topoName, "activate"); |
| } |
| |
| private void assertTopoActive(String topoName, boolean expectActive) throws NotAliveException, AlreadyAliveException { |
| if (isTopologyActive(stormClusterState, topoName) != expectActive) { |
| if (expectActive) { |
| throw new WrappedNotAliveException(topoName + " is not alive"); |
| } |
| throw new WrappedAlreadyAliveException(topoName + " is already alive"); |
| } |
| } |
| |
| private Map<String, Object> tryReadTopoConfFromName(final String topoName) throws NotAliveException, |
| AuthorizationException, IOException { |
| return tryReadTopoConf(toTopoId(topoName), topoCache); |
| } |
| |
| private StormTopology tryReadTopologyFromName(final String topoName) throws NotAliveException, |
| AuthorizationException, IOException { |
| return tryReadTopology(toTopoId(topoName), topoCache); |
| } |
| |
| @VisibleForTesting |
| public void checkAuthorization(String topoName, Map<String, Object> topoConf, String operation) |
| throws AuthorizationException { |
| checkAuthorization(topoName, topoConf, operation, null); |
| } |
| |
| @VisibleForTesting |
| public void checkAuthorization(String topoName, Map<String, Object> topoConf, String operation, ReqContext context) |
| throws AuthorizationException { |
| IAuthorizer impersonationAuthorizer = impersonationAuthorizationHandler; |
| if (context == null) { |
| context = ReqContext.context(); |
| } |
| Map<String, Object> checkConf = new HashMap<>(); |
| if (topoConf != null) { |
| checkConf.putAll(topoConf); |
| } else if (topoName != null) { |
| checkConf.put(Config.TOPOLOGY_NAME, topoName); |
| } |
| |
| if (context.isImpersonating()) { |
| LOG.info("principal: {} is trying to impersonate principal: {}", context.realPrincipal(), context.principal()); |
| if (impersonationAuthorizer == null) { |
| LOG.warn("impersonation attempt but {} has no authorizer configured. potential security risk, " |
| + "please see SECURITY.MD to learn how to configure impersonation authorizer.", |
| DaemonConfig.NIMBUS_IMPERSONATION_AUTHORIZER); |
| } else { |
| if (!impersonationAuthorizer.permit(context, operation, checkConf)) { |
| ThriftAccessLogger.logAccess(context.requestID(), context.remoteAddress(), |
| context.principal(), operation, topoName, "access-denied"); |
| throw new WrappedAuthorizationException("principal " + context.realPrincipal() |
| + " is not authorized to impersonate principal " + context.principal() |
| + " from host " + context.remoteAddress() |
| + " Please see SECURITY.MD to learn how to configure impersonation acls."); |
| } |
| } |
| } |
| |
| IAuthorizer aclHandler = authorizationHandler; |
| if (aclHandler != null) { |
| if (!aclHandler.permit(context, operation, checkConf)) { |
| ThriftAccessLogger.logAccess(context.requestID(), context.remoteAddress(), context.principal(), operation, |
| topoName, "access-denied"); |
| throw new WrappedAuthorizationException(operation + (topoName != null ? " on topology " + topoName : "") |
| + " is not authorized"); |
| } else { |
| ThriftAccessLogger.logAccess(context.requestID(), context.remoteAddress(), context.principal(), |
| operation, topoName, "access-granted"); |
| } |
| } |
| } |
| |
| private boolean isAuthorized(String operation, String topoId) throws NotAliveException, AuthorizationException, IOException { |
| Map<String, Object> topoConf = tryReadTopoConf(topoId, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| String topoName = (String) topoConf.get(Config.TOPOLOGY_NAME); |
| try { |
| checkAuthorization(topoName, topoConf, operation); |
| return true; |
| } catch (AuthorizationException e) { |
| return false; |
| } |
| } |
| |
| @VisibleForTesting |
| public Set<String> filterAuthorized(String operation, Collection<String> topoIds) throws NotAliveException, |
| AuthorizationException, IOException { |
| Set<String> ret = new HashSet<>(); |
| for (String topoId : topoIds) { |
| if (isAuthorized(operation, topoId)) { |
| ret.add(topoId); |
| } |
| } |
| return ret; |
| } |
| |
| @VisibleForTesting |
| public void rmDependencyJarsInTopology(String topoId) { |
| try { |
| BlobStore store = blobStore; |
| IStormClusterState state = stormClusterState; |
| StormTopology topo = readStormTopologyAsNimbus(topoId, topoCache); |
| List<String> dependencyJars = topo.get_dependency_jars(); |
| LOG.info("Removing dependency jars from blobs - {}", dependencyJars); |
| if (dependencyJars != null && !dependencyJars.isEmpty()) { |
| for (String key : dependencyJars) { |
| rmBlobKey(store, key, state); |
| } |
| } |
| } catch (Exception e) { |
| //Yes eat the exception |
| LOG.info("Exception {}", e); |
| } |
| } |
| |
| @VisibleForTesting |
| public void rmTopologyKeys(String topoId) { |
| BlobStore store = blobStore; |
| IStormClusterState state = stormClusterState; |
| try { |
| topoCache.deleteTopoConf(topoId, NIMBUS_SUBJECT); |
| } catch (Exception e) { |
| //Just go on and try to delete the others |
| } |
| try { |
| topoCache.deleteTopology(topoId, NIMBUS_SUBJECT); |
| } catch (Exception e) { |
| //Just go on and try to delte the others |
| } |
| rmBlobKey(store, ConfigUtils.masterStormJarKey(topoId), state); |
| } |
| |
| @VisibleForTesting |
| public void forceDeleteTopoDistDir(String topoId) throws IOException { |
| Utils.forceDelete(ServerConfigUtils.masterStormDistRoot(conf, topoId)); |
| } |
| |
| @VisibleForTesting |
| public void doCleanup() throws Exception { |
| if (!isLeader()) { |
| LOG.info("not a leader, skipping cleanup"); |
| return; |
| } |
| IStormClusterState state = stormClusterState; |
| Set<String> toClean; |
| synchronized (submitLock) { |
| toClean = topoIdsToClean(state, blobStore, this.conf); |
| } |
| if (toClean != null) { |
| for (String topoId : toClean) { |
| LOG.info("Cleaning up {}", topoId); |
| state.teardownHeartbeats(topoId); |
| state.teardownTopologyErrors(topoId); |
| state.removeAllPrivateWorkerKeys(topoId); |
| state.removeBackpressure(topoId); |
| rmDependencyJarsInTopology(topoId); |
| forceDeleteTopoDistDir(topoId); |
| rmTopologyKeys(topoId); |
| heartbeatsCache.removeTopo(topoId); |
| idToExecutors.getAndUpdate(new Dissoc<>(topoId)); |
| } |
| } |
| } |
| |
| /** |
| * Deletes topologies from history older than mins minutes. |
| * |
| * @param mins the number of mins for old topologies |
| */ |
| private void cleanTopologyHistory(int mins) { |
| int cutoffAgeSecs = Time.currentTimeSecs() - (mins * 60); |
| synchronized (topologyHistoryLock) { |
| LocalState state = topologyHistoryState; |
| state.filterOldTopologies(cutoffAgeSecs); |
| } |
| } |
| |
| private void addTopoToHistoryLog(String topoId, Map<String, Object> topoConf) { |
| LOG.info("Adding topo to history log: {}", topoId); |
| LocalState state = topologyHistoryState; |
| List<String> users = ServerConfigUtils.getTopoLogsUsers(topoConf); |
| List<String> groups = ServerConfigUtils.getTopoLogsGroups(topoConf); |
| synchronized (topologyHistoryLock) { |
| state.addTopologyHistory(new LSTopoHistory(topoId, Time.currentTimeSecs(), users, groups)); |
| } |
| } |
| |
| private Set<String> userGroups(String user) throws IOException { |
| if (user == null || user.isEmpty()) { |
| return Collections.emptySet(); |
| } |
| return groupMapper.getGroups(user); |
| } |
| |
| /** |
| * Check to see if any of the users groups intersect with the list of groups passed in. |
| * |
| * @param user the user to check |
| * @param groupsToCheck the groups to see if user is a part of |
| * @return true if user is a part of groups, else false |
| * |
| * @throws IOException on any error |
| */ |
| private boolean isUserPartOf(String user, Collection<String> groupsToCheck) throws IOException { |
| Set<String> userGroups = new HashSet<>(userGroups(user)); |
| userGroups.retainAll(groupsToCheck); |
| return !userGroups.isEmpty(); |
| } |
| |
| private List<String> readTopologyHistory(String user, Collection<String> adminUsers) throws IOException { |
| LocalState state = topologyHistoryState; |
| List<LSTopoHistory> topoHistoryList = state.getTopoHistoryList(); |
| if (topoHistoryList == null || topoHistoryList.isEmpty()) { |
| return Collections.emptyList(); |
| } |
| |
| List<String> ret = new ArrayList<>(); |
| for (LSTopoHistory history : topoHistoryList) { |
| if (user == null || //Security off |
| adminUsers.contains(user) || //is admin |
| isUserPartOf(user, history.get_groups()) || //is in allowed group |
| history.get_users().contains(user)) { //is an allowed user |
| ret.add(history.get_topology_id()); |
| } |
| } |
| return ret; |
| } |
| |
| private void renewCredentials() throws Exception { |
| if (!isLeader()) { |
| LOG.info("not a leader, skipping credential renewal."); |
| return; |
| } |
| IStormClusterState state = stormClusterState; |
| Collection<ICredentialsRenewer> renewers = credRenewers; |
| Map<String, StormBase> assignedBases = state.topologyBases(); |
| if (assignedBases != null) { |
| for (Entry<String, StormBase> entry : assignedBases.entrySet()) { |
| String id = entry.getKey(); |
| String ownerPrincipal = entry.getValue().get_principal(); |
| Map<String, Object> topoConf = Collections.unmodifiableMap(Utils.merge(conf, tryReadTopoConf(id, topoCache))); |
| synchronized (credUpdateLock) { |
| Credentials origCreds = state.credentials(id, null); |
| if (origCreds != null) { |
| Map<String, String> origCredsMap = origCreds.get_creds(); |
| Map<String, String> newCredsMap = new HashMap<>(origCredsMap); |
| for (ICredentialsRenewer renewer : renewers) { |
| LOG.info("Renewing Creds For {} with {} owned by {}", id, renewer, ownerPrincipal); |
| renewer.renew(newCredsMap, topoConf, ownerPrincipal); |
| } |
| //Update worker tokens if needed |
| upsertWorkerTokensInCreds(newCredsMap, ownerPrincipal, id); |
| if (!newCredsMap.equals(origCredsMap)) { |
| state.setCredentials(id, new Credentials(newCredsMap), topoConf); |
| } |
| } |
| } |
| } |
| } |
| } |
| |
| private SupervisorSummary makeSupervisorSummary(String supervisorId, SupervisorInfo info) { |
| Set<String> blacklistedSupervisorIds = Collections.emptySet(); |
| if (scheduler instanceof BlacklistScheduler) { |
| BlacklistScheduler bs = (BlacklistScheduler) scheduler; |
| blacklistedSupervisorIds = bs.getBlacklistSupervisorIds(); |
| } |
| |
| LOG.debug("INFO: {} ID: {}", info, supervisorId); |
| int numPorts = 0; |
| if (info.is_set_meta()) { |
| numPorts = info.get_meta_size(); |
| } |
| int numUsedPorts = 0; |
| if (info.is_set_used_ports()) { |
| numUsedPorts = info.get_used_ports_size(); |
| } |
| LOG.debug("NUM PORTS: {}", numPorts); |
| SupervisorSummary ret = new SupervisorSummary(info.get_hostname(), |
| (int) info.get_uptime_secs(), numPorts, numUsedPorts, supervisorId); |
| ret.set_total_resources(info.get_resources_map()); |
| SupervisorResources resources = nodeIdToResources.get().get(supervisorId); |
| if (resources != null && underlyingScheduler instanceof ResourceAwareScheduler) { |
| ret.set_used_mem(resources.getUsedMem()); |
| ret.set_used_cpu(resources.getUsedCpu()); |
| ret.set_used_generic_resources(resources.getUsedGenericResources()); |
| if (isFragmented(resources)) { |
| final double availableCpu = resources.getAvailableCpu(); |
| if (availableCpu < 0) { |
| LOG.warn("Negative fragmented CPU on {}", supervisorId); |
| } |
| ret.set_fragmented_cpu(availableCpu); |
| final double availableMem = resources.getAvailableMem(); |
| if (availableMem < 0) { |
| LOG.warn("Negative fragmented Mem on {}", supervisorId); |
| } |
| ret.set_fragmented_mem(availableMem); |
| } |
| } |
| if (info.is_set_version()) { |
| ret.set_version(info.get_version()); |
| } |
| |
| if (blacklistedSupervisorIds.contains(supervisorId)) { |
| ret.set_blacklisted(true); |
| } else { |
| ret.set_blacklisted(false); |
| } |
| |
| return ret; |
| } |
| |
| private ClusterSummary getClusterInfoImpl() throws Exception { |
| IStormClusterState state = stormClusterState; |
| Map<String, SupervisorInfo> infos = state.allSupervisorInfo(); |
| List<SupervisorSummary> summaries = new ArrayList<>(infos.size()); |
| for (Entry<String, SupervisorInfo> entry : infos.entrySet()) { |
| summaries.add(makeSupervisorSummary(entry.getKey(), entry.getValue())); |
| } |
| int uptime = this.uptime.upTime(); |
| List<NimbusSummary> nimbuses = state.nimbuses(); |
| //update the isLeader field for each nimbus summary |
| NimbusInfo leader = leaderElector.getLeader(); |
| for (NimbusSummary nimbusSummary : nimbuses) { |
| nimbusSummary.set_uptime_secs(Time.deltaSecs(nimbusSummary.get_uptime_secs())); |
| // sometimes Leader election indicates the current nimbus is leader, but the host was recently restarted, |
| // and is currently not a leader. |
| boolean isLeader = leader.getHost().equals(nimbusSummary.get_host()) && leader.getPort() == nimbusSummary.get_port(); |
| if (isLeader && this.nimbusHostPortInfo.getHost().equals(leader.getHost()) && !this.isLeader()) { |
| isLeader = false; |
| } |
| nimbusSummary.set_isLeader(isLeader); |
| } |
| |
| List<TopologySummary> topologySummaries = getTopologySummariesImpl(); |
| |
| ClusterSummary ret = new ClusterSummary(summaries, topologySummaries, nimbuses); |
| return ret; |
| } |
| |
| private List<TopologySummary> getTopologySummariesImpl() throws IOException, TException { |
| IStormClusterState state = stormClusterState; |
| List<TopologySummary> topologySummaries = new ArrayList<>(); |
| Map<String, StormBase> bases = state.topologyBases(); |
| for (Entry<String, StormBase> entry : bases.entrySet()) { |
| StormBase base = entry.getValue(); |
| if (base == null) { |
| continue; |
| } |
| String topoId = entry.getKey(); |
| TopologySummary summary = getTopologySummaryImpl(topoId, base); |
| topologySummaries.add(summary); |
| } |
| return topologySummaries; |
| } |
| |
| private TopologySummary getTopologySummaryImpl(String topoId, StormBase base) throws IOException, TException { |
| IStormClusterState state = stormClusterState; |
| Assignment assignment = state.assignmentInfo(topoId, null); |
| |
| int numTasks = 0; |
| int numExecutors = 0; |
| int numWorkers = 0; |
| if (assignment != null && assignment.is_set_executor_node_port()) { |
| for (List<Long> ids : assignment.get_executor_node_port().keySet()) { |
| numTasks += StormCommon.executorIdToTasks(ids).size(); |
| } |
| |
| numExecutors = assignment.get_executor_node_port_size(); |
| numWorkers = new HashSet<>(assignment.get_executor_node_port().values()).size(); |
| } |
| |
| TopologySummary summary = new TopologySummary(topoId, base.get_name(), numTasks, numExecutors, numWorkers, |
| Time.deltaSecs(base.get_launch_time_secs()), extractStatusStr(base)); |
| try { |
| StormTopology topo = tryReadTopology(topoId, topoCache); |
| if (topo != null && topo.is_set_storm_version()) { |
| summary.set_storm_version(topo.get_storm_version()); |
| } |
| } catch (NotAliveException e) { |
| //Ignored it is not set |
| } |
| |
| if (base.is_set_owner()) { |
| summary.set_owner(base.get_owner()); |
| } |
| |
| if (base.is_set_topology_version()) { |
| summary.set_topology_version(base.get_topology_version()); |
| } |
| |
| String status = idToSchedStatus.get().get(topoId); |
| if (status != null) { |
| summary.set_sched_status(status); |
| } |
| TopologyResources resources = getResourcesForTopology(topoId, base); |
| if (resources != null) { |
| summary.set_requested_memonheap(resources.getRequestedMemOnHeap()); |
| summary.set_requested_memoffheap(resources.getRequestedMemOffHeap()); |
| summary.set_requested_cpu(resources.getRequestedCpu()); |
| summary.set_requested_generic_resources(resources.getRequestedGenericResources()); |
| summary.set_assigned_memonheap(resources.getAssignedMemOnHeap()); |
| summary.set_assigned_memoffheap(resources.getAssignedMemOffHeap()); |
| summary.set_assigned_cpu(resources.getAssignedCpu()); |
| summary.set_assigned_generic_resources(resources.getAssignedGenericResources()); |
| } |
| try { |
| summary.set_replication_count(getBlobReplicationCount(ConfigUtils.masterStormCodeKey(topoId))); |
| } catch (Exception e) { |
| // This could fail if a blob gets deleted by mistake. Don't crash nimbus. |
| LOG.error("Unable to find blob entry", e); |
| } |
| return summary; |
| } |
| |
| private void sendClusterMetricsToExecutors() throws Exception { |
| ClusterInfo clusterInfo = mkClusterInfo(); |
| ClusterSummary clusterSummary = getClusterInfoImpl(); |
| List<DataPoint> clusterMetrics = extractClusterMetrics(clusterSummary); |
| Map<IClusterMetricsConsumer.SupervisorInfo, List<DataPoint>> supervisorMetrics = extractSupervisorMetrics(clusterSummary); |
| for (ClusterMetricsConsumerExecutor consumerExecutor : clusterConsumerExceutors) { |
| consumerExecutor.handleDataPoints(clusterInfo, clusterMetrics); |
| for (Entry<IClusterMetricsConsumer.SupervisorInfo, List<DataPoint>> entry : supervisorMetrics.entrySet()) { |
| consumerExecutor.handleDataPoints(entry.getKey(), entry.getValue()); |
| } |
| } |
| } |
| |
| private CommonTopoInfo getCommonTopoInfo(String topoId, String operation) throws NotAliveException, |
| AuthorizationException, IOException, InvalidTopologyException { |
| CommonTopoInfo ret = new CommonTopoInfo(); |
| ret.topoConf = tryReadTopoConf(topoId, topoCache); |
| ret.topoName = (String) ret.topoConf.get(Config.TOPOLOGY_NAME); |
| checkAuthorization(ret.topoName, ret.topoConf, operation); |
| StormTopology topology = tryReadTopology(topoId, topoCache); |
| ret.topology = StormCommon.systemTopology(ret.topoConf, topology); |
| ret.taskToComponent = StormCommon.stormTaskInfo(topology, ret.topoConf); |
| IStormClusterState state = stormClusterState; |
| ret.base = state.stormBase(topoId, null); |
| if (ret.base != null && ret.base.is_set_launch_time_secs()) { |
| ret.launchTimeSecs = ret.base.get_launch_time_secs(); |
| } else { |
| ret.launchTimeSecs = 0; |
| } |
| ret.assignment = state.assignmentInfo(topoId, null); |
| //get it from cluster state/zookeeper every time to collect the UI stats, may replace it with other StateStore later |
| ret.beats = ret.assignment != null ? StatsUtil.convertExecutorBeats(state.executorBeats(topoId, |
| ret.assignment |
| .get_executor_node_port())) : |
| Collections |
| .emptyMap(); |
| ret.allComponents = new HashSet<>(ret.taskToComponent.values()); |
| return ret; |
| } |
| |
| @VisibleForTesting |
| public boolean awaitLeadership(long timeout, TimeUnit timeUnit) throws InterruptedException { |
| return leaderElector.awaitLeadership(timeout, timeUnit); |
| } |
| |
| @Override |
| public void submitTopology(String name, String uploadedJarLocation, String jsonConf, StormTopology topology) |
| throws AlreadyAliveException, InvalidTopologyException, AuthorizationException, TException { |
| submitTopologyCalls.mark(); |
| submitTopologyWithOpts(name, uploadedJarLocation, jsonConf, topology, new SubmitOptions(TopologyInitialStatus.ACTIVE)); |
| } |
| |
| private void upsertWorkerTokensInCreds(Map<String, String> creds, String user, String topologyId) { |
| if (workerTokenManager != null) { |
| workerTokenManager.upsertWorkerTokensInCredsForTopo(creds, user, topologyId); |
| } |
| //Remove any expired keys after possibly inserting new ones. |
| stormClusterState.removeExpiredPrivateWorkerKeys(topologyId); |
| } |
| |
| @Override |
| public void submitTopologyWithOpts(String topoName, String uploadedJarLocation, String jsonConf, |
| StormTopology topology, SubmitOptions options) |
| throws AlreadyAliveException, InvalidTopologyException, AuthorizationException, TException { |
| try { |
| submitTopologyWithOptsCalls.mark(); |
| assertIsLeader(); |
| assert (options != null); |
| validateTopologyName(topoName); |
| checkAuthorization(topoName, null, "submitTopology"); |
| assertTopoActive(topoName, false); |
| @SuppressWarnings("unchecked") |
| Map<String, Object> topoConf = (Map<String, Object>) JSONValue.parse(jsonConf); |
| try { |
| ConfigValidation.validateTopoConf(topoConf); |
| } catch (IllegalArgumentException ex) { |
| throw new WrappedInvalidTopologyException(ex.getMessage()); |
| } |
| validator.validate(topoName, topoConf, topology); |
| if ((boolean) conf.getOrDefault(Config.DISABLE_SYMLINKS, false)) { |
| @SuppressWarnings("unchecked") |
| Map<String, Object> blobMap = (Map<String, Object>) topoConf.get(Config.TOPOLOGY_BLOBSTORE_MAP); |
| if (blobMap != null && !blobMap.isEmpty()) { |
| throw new WrappedInvalidTopologyException("symlinks are disabled so blobs are not supported but " |
| + Config.TOPOLOGY_BLOBSTORE_MAP + " = " + blobMap); |
| } |
| } |
| ServerUtils.validateTopologyWorkerMaxHeapSizeConfigs(topoConf, topology, |
| ObjectReader.getDouble(conf.get(Config.TOPOLOGY_WORKER_MAX_HEAP_SIZE_MB))); |
| Utils.validateTopologyBlobStoreMap(topoConf, blobStore); |
| long uniqueNum = submittedCount.incrementAndGet(); |
| String topoId = topoName + "-" + uniqueNum + "-" + Time.currentTimeSecs(); |
| Map<String, String> creds = null; |
| if (options.is_set_creds()) { |
| creds = options.get_creds().get_creds(); |
| } |
| topoConf.put(Config.STORM_ID, topoId); |
| topoConf.put(Config.TOPOLOGY_NAME, topoName); |
| topoConf = normalizeConf(conf, topoConf, topology); |
| |
| OciUtils.adjustImageConfigForTopo(conf, topoConf, topoId); |
| |
| ReqContext req = ReqContext.context(); |
| Principal principal = req.principal(); |
| String submitterPrincipal = principal == null ? null : principal.toString(); |
| Set<String> topoAcl = new HashSet<>(ObjectReader.getStrings(topoConf.get(Config.TOPOLOGY_USERS))); |
| topoAcl.add(submitterPrincipal); |
| String submitterUser = principalToLocal.toLocal(principal); |
| topoAcl.add(submitterUser); |
| |
| String topologyPrincipal = Utils.OR(submitterPrincipal, ""); |
| topoConf.put(Config.TOPOLOGY_SUBMITTER_PRINCIPAL, topologyPrincipal); |
| String systemUser = System.getProperty("user.name"); |
| String topologyOwner = Utils.OR(submitterUser, systemUser); |
| topoConf.put(Config.TOPOLOGY_SUBMITTER_USER, topologyOwner); //Don't let the user set who we launch as |
| topoConf.put(Config.TOPOLOGY_USERS, new ArrayList<>(topoAcl)); |
| topoConf.put(Config.STORM_ZOOKEEPER_SUPERACL, conf.get(Config.STORM_ZOOKEEPER_SUPERACL)); |
| if (!Utils.isZkAuthenticationConfiguredStormServer(conf)) { |
| topoConf.remove(Config.STORM_ZOOKEEPER_TOPOLOGY_AUTH_SCHEME); |
| topoConf.remove(Config.STORM_ZOOKEEPER_TOPOLOGY_AUTH_PAYLOAD); |
| } |
| if (!(Boolean) conf.getOrDefault(DaemonConfig.STORM_TOPOLOGY_CLASSPATH_BEGINNING_ENABLED, false)) { |
| topoConf.remove(Config.TOPOLOGY_CLASSPATH_BEGINNING); |
| } |
| |
| String topoVersionString = topology.get_storm_version(); |
| if (topoVersionString == null) { |
| topoVersionString = (String) conf.getOrDefault(Config.SUPERVISOR_WORKER_DEFAULT_VERSION, VersionInfo.getVersion()); |
| } |
| //Check if we can run a topology with that version of storm. |
| SimpleVersion topoVersion = new SimpleVersion(topoVersionString); |
| List<String> cp = Utils.getCompatibleVersion(supervisorClasspaths, topoVersion, "classpath", null); |
| if (cp == null) { |
| throw new WrappedInvalidTopologyException("Topology submitted with storm version " + topoVersionString |
| + " but could not find a configured compatible version to use " |
| + supervisorClasspaths.keySet()); |
| } |
| Map<String, Object> otherConf = Utils.getConfigFromClasspath(cp, conf); |
| Map<String, Object> totalConfToSave = Utils.merge(otherConf, topoConf); |
| Map<String, Object> totalConf = Utils.merge(conf, totalConfToSave); |
| |
| |
| //When reading the conf in nimbus we want to fall back to our own settings |
| // if the other config does not have it set. |
| topology = normalizeTopology(totalConf, topology); |
| |
| // if the Resource Aware Scheduler is used, |
| // we might need to set the number of acker executors and eventlogger executors to be the estimated number of workers. |
| if (ServerUtils.isRas(conf)) { |
| int estimatedNumWorker = ServerUtils.getEstimatedWorkerCountForRasTopo(totalConf, topology); |
| |
| setUpAckerExecutorConfigs(topoName, totalConfToSave, totalConf, estimatedNumWorker); |
| ServerUtils.validateTopologyAckerBundleResource(totalConfToSave, topology, topoName); |
| |
| int numEventLoggerExecs = ObjectReader.getInt(totalConf.get(Config.TOPOLOGY_EVENTLOGGER_EXECUTORS), estimatedNumWorker); |
| totalConfToSave.put(Config.TOPOLOGY_EVENTLOGGER_EXECUTORS, numEventLoggerExecs); |
| LOG.debug("Config {} set to: {} for topology: {}", |
| Config.TOPOLOGY_EVENTLOGGER_EXECUTORS, numEventLoggerExecs, topoName); |
| |
| } |
| |
| //Remove any configs that are specific to a host that might mess with the running topology. |
| totalConfToSave.remove(Config.STORM_LOCAL_HOSTNAME); //Don't override the host name, or everything looks like it is on nimbus |
| |
| IStormClusterState state = stormClusterState; |
| |
| if (creds == null && workerTokenManager != null) { |
| //Make sure we can store the worker tokens even if no creds are provided. |
| creds = new HashMap<>(); |
| } |
| if (creds != null) { |
| Map<String, Object> finalConf = Collections.unmodifiableMap(topoConf); |
| for (INimbusCredentialPlugin autocred : nimbusAutocredPlugins) { |
| autocred.populateCredentials(creds, finalConf); |
| } |
| upsertWorkerTokensInCreds(creds, topologyPrincipal, topoId); |
| } |
| |
| if (ObjectReader.getBoolean(conf.get(Config.SUPERVISOR_RUN_WORKER_AS_USER), false) |
| && (submitterUser == null || submitterUser.isEmpty())) { |
| throw new WrappedAuthorizationException("Could not determine the user to run this topology as."); |
| } |
| StormCommon.systemTopology(totalConf, topology); //this validates the structure of the topology |
| validateTopologySize(topoConf, conf, topology); |
| if (Utils.isZkAuthenticationConfiguredStormServer(conf) |
| && !Utils.isZkAuthenticationConfiguredTopology(topoConf)) { |
| throw new IllegalArgumentException("The cluster is configured for zookeeper authentication, but no payload was provided."); |
| } |
| LOG.info("Received topology submission for {} (storm-{} JDK-{}) with conf {}", topoName, |
| topoVersionString, topology.get_jdk_version(), ConfigUtils.maskPasswords(topoConf)); |
| |
| // lock protects against multiple topologies being submitted at once and |
| // cleanup thread killing topology in b/w assignment and starting the topology |
| synchronized (submitLock) { |
| assertTopoActive(topoName, false); |
| //cred-update-lock is not needed here because creds are being added for the first time. |
| if (creds != null) { |
| state.setCredentials(topoId, new Credentials(creds), topoConf); |
| } |
| LOG.info("uploadedJar {} for {}", uploadedJarLocation, topoName); |
| setupStormCode(conf, topoId, uploadedJarLocation, totalConfToSave, topology); |
| waitForDesiredCodeReplication(totalConf, topoId); |
| state.setupHeatbeats(topoId, topoConf); |
| state.setupErrors(topoId, topoConf); |
| if (ObjectReader.getBoolean(totalConf.get(Config.TOPOLOGY_BACKPRESSURE_ENABLE), false)) { |
| state.setupBackpressure(topoId, topoConf); |
| } |
| notifyTopologyActionListener(topoName, "submitTopology"); |
| TopologyStatus status = null; |
| switch (options.get_initial_status()) { |
| case INACTIVE: |
| status = TopologyStatus.INACTIVE; |
| break; |
| case ACTIVE: |
| status = TopologyStatus.ACTIVE; |
| break; |
| default: |
| throw new IllegalArgumentException("Inital Status of " + options.get_initial_status() + " is not allowed."); |
| |
| } |
| startTopology(topoName, topoId, status, topologyOwner, topologyPrincipal, totalConfToSave, topology); |
| } |
| } catch (Exception e) { |
| LOG.warn("Topology submission exception. (topology name='{}')", topoName, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @VisibleForTesting |
| public static void setUpAckerExecutorConfigs(String topoName, Map<String, Object> totalConfToSave, |
| Map<String, Object> totalConf, int estimatedNumWorker) { |
| |
| int numAckerExecs; |
| int numAckerExecsPerWorker; |
| |
| if (totalConf.get(Config.TOPOLOGY_ACKER_EXECUTORS) == null) { |
| numAckerExecsPerWorker = ObjectReader.getInt( |
| totalConf.get(Config.TOPOLOGY_RAS_ACKER_EXECUTORS_PER_WORKER)); |
| numAckerExecs = estimatedNumWorker * numAckerExecsPerWorker; |
| } else { |
| numAckerExecs = ObjectReader.getInt(totalConf.get(Config.TOPOLOGY_ACKER_EXECUTORS)); |
| if (estimatedNumWorker == 0) { |
| numAckerExecsPerWorker = 0; |
| } else { |
| numAckerExecsPerWorker = (int) Math.ceil((double) numAckerExecs / (double) estimatedNumWorker); |
| } |
| } |
| |
| totalConfToSave.put(Config.TOPOLOGY_RAS_ACKER_EXECUTORS_PER_WORKER, numAckerExecsPerWorker); |
| totalConfToSave.put(Config.TOPOLOGY_ACKER_EXECUTORS, numAckerExecs); |
| |
| LOG.info("Config {} set to: {} for topology: {}", |
| Config.TOPOLOGY_RAS_ACKER_EXECUTORS_PER_WORKER, numAckerExecsPerWorker, topoName); |
| LOG.info("Config {} set to: {} for topology: {}", |
| Config.TOPOLOGY_ACKER_EXECUTORS, numAckerExecs, topoName); |
| |
| } |
| |
| @Override |
| public void killTopology(String name) throws NotAliveException, AuthorizationException, TException { |
| killTopologyCalls.mark(); |
| killTopologyWithOpts(name, new KillOptions()); |
| } |
| |
| @Override |
| public void killTopologyWithOpts(final String topoName, final KillOptions options) |
| throws NotAliveException, AuthorizationException, TException { |
| killTopologyWithOptsCalls.mark(); |
| assertTopoActive(topoName, true); |
| try { |
| Map<String, Object> topoConf = tryReadTopoConfFromName(topoName); |
| topoConf = Utils.merge(conf, topoConf); |
| final String operation = "killTopology"; |
| checkAuthorization(topoName, topoConf, operation); |
| Integer waitAmount = null; |
| if (options.is_set_wait_secs()) { |
| waitAmount = options.get_wait_secs(); |
| } |
| transitionName(topoName, TopologyActions.KILL, waitAmount, true); |
| notifyTopologyActionListener(topoName, operation); |
| addTopoToHistoryLog((String) topoConf.get(Config.STORM_ID), topoConf); |
| } catch (Exception e) { |
| LOG.warn("Kill topology exception. (topology name='{}')", topoName, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void activate(String topoName) throws NotAliveException, AuthorizationException, TException { |
| activateCalls.mark(); |
| try { |
| Map<String, Object> topoConf = tryReadTopoConfFromName(topoName); |
| topoConf = Utils.merge(conf, topoConf); |
| final String operation = "activate"; |
| checkAuthorization(topoName, topoConf, operation); |
| transitionName(topoName, TopologyActions.ACTIVATE, null, true); |
| notifyTopologyActionListener(topoName, operation); |
| } catch (Exception e) { |
| LOG.warn("Activate topology exception. (topology name='{}')", topoName, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void deactivate(String topoName) throws NotAliveException, AuthorizationException, TException { |
| deactivateCalls.mark(); |
| try { |
| Map<String, Object> topoConf = tryReadTopoConfFromName(topoName); |
| topoConf = Utils.merge(conf, topoConf); |
| final String operation = "deactivate"; |
| checkAuthorization(topoName, topoConf, operation); |
| transitionName(topoName, TopologyActions.INACTIVATE, null, true); |
| notifyTopologyActionListener(topoName, operation); |
| } catch (Exception e) { |
| LOG.warn("Deactivate topology exception. (topology name='{}')", topoName, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void rebalance(String topoName, RebalanceOptions options) |
| throws NotAliveException, InvalidTopologyException, AuthorizationException, TException { |
| rebalanceCalls.mark(); |
| assertTopoActive(topoName, true); |
| try { |
| Map<String, Object> topoConf = tryReadTopoConfFromName(topoName); |
| topoConf = Utils.merge(conf, topoConf); |
| final String operation = "rebalance"; |
| checkAuthorization(topoName, topoConf, operation); |
| // Set principal in RebalanceOptions to nil because users are not suppose to set this |
| options.set_principal(null); |
| // check if executor counts are correctly specified |
| StormTopology stormTopology = tryReadTopologyFromName(topoName); |
| Set<String> comps = new TreeSet<>(); |
| comps.addAll(stormTopology.get_spouts().keySet()); |
| comps.addAll(stormTopology.get_bolts().keySet()); |
| Map<String, Integer> execOverrides = options.is_set_num_executors() ? options.get_num_executors() : Collections.emptyMap(); |
| for (Map.Entry<String, Integer> e: execOverrides.entrySet()) { |
| String comp = e.getKey(); |
| // validate non-system component ids |
| if (!Utils.isSystemId(comp) && !comps.contains(comp)) { |
| throw new WrappedInvalidTopologyException( |
| String.format("Invalid component %s for topology %s, valid values are %s", |
| comp, topoName, String.join(",", comps)) |
| ); |
| } |
| // validate executor count for component |
| Integer value = e.getValue(); |
| if (value == null || value <= 0) { |
| throw new WrappedInvalidTopologyException("Number of executors must be greater than 0"); |
| } |
| } |
| if (options.is_set_topology_conf_overrides()) { |
| Map<String, Object> topoConfigOverrides = Utils.parseJson(options.get_topology_conf_overrides()); |
| //Clean up some things the user should not set. (Not a security issue, just might confuse the topology) |
| topoConfigOverrides.remove(Config.TOPOLOGY_SUBMITTER_PRINCIPAL); |
| topoConfigOverrides.remove(Config.TOPOLOGY_SUBMITTER_USER); |
| topoConfigOverrides.remove(Config.STORM_ZOOKEEPER_SUPERACL); |
| topoConfigOverrides.remove(Config.STORM_ZOOKEEPER_TOPOLOGY_AUTH_SCHEME); |
| topoConfigOverrides.remove(Config.STORM_ZOOKEEPER_TOPOLOGY_AUTH_PAYLOAD); |
| if ((boolean) conf.getOrDefault(DaemonConfig.STORM_TOPOLOGY_CLASSPATH_BEGINNING_ENABLED, false)) { |
| topoConfigOverrides.remove(Config.TOPOLOGY_CLASSPATH_BEGINNING); |
| } |
| topoConfigOverrides.remove(Config.STORM_LOCAL_HOSTNAME); |
| options.set_topology_conf_overrides(JSONValue.toJSONString(topoConfigOverrides)); |
| } |
| Subject subject = getSubject(); |
| if (subject != null) { |
| options.set_principal(subject.getPrincipals().iterator().next().getName()); |
| } |
| |
| transitionName(topoName, TopologyActions.REBALANCE, options, true); |
| notifyTopologyActionListener(topoName, operation); |
| } catch (Exception e) { |
| LOG.warn("rebalance topology exception. (topology name='{}')", topoName, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void setLogConfig(String topoId, LogConfig config) throws TException { |
| try { |
| setLogConfigCalls.mark(); |
| Map<String, Object> topoConf = tryReadTopoConf(topoId, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| String topoName = (String) topoConf.get(Config.TOPOLOGY_NAME); |
| checkAuthorization(topoName, topoConf, "setLogConfig"); |
| IStormClusterState state = stormClusterState; |
| LogConfig mergedLogConfig = state.topologyLogConfig(topoId, null); |
| if (mergedLogConfig == null) { |
| mergedLogConfig = new LogConfig(); |
| } |
| |
| if (mergedLogConfig.is_set_named_logger_level()) { |
| Map<String, LogLevel> namedLoggers = mergedLogConfig.get_named_logger_level(); |
| for (LogLevel level : namedLoggers.values()) { |
| level.set_action(LogLevelAction.UNCHANGED); |
| } |
| } |
| |
| if (config.is_set_named_logger_level()) { |
| for (Entry<String, LogLevel> entry : config.get_named_logger_level().entrySet()) { |
| LogLevel logConfig = entry.getValue(); |
| String loggerName = entry.getKey(); |
| LogLevelAction action = logConfig.get_action(); |
| if (loggerName.isEmpty()) { |
| throw new RuntimeException("Named loggers need a valid name. Use ROOT for the root logger"); |
| } |
| switch (action) { |
| case UPDATE: |
| setLoggerTimeouts(logConfig); |
| mergedLogConfig.put_to_named_logger_level(loggerName, logConfig); |
| break; |
| case REMOVE: |
| Map<String, LogLevel> nl = mergedLogConfig.get_named_logger_level(); |
| if (nl != null) { |
| nl.remove(loggerName); |
| } |
| break; |
| default: |
| //NOOP |
| break; |
| } |
| } |
| } |
| LOG.info("Setting log config for {}:{}", topoName, mergedLogConfig); |
| state.setTopologyLogConfig(topoId, mergedLogConfig, topoConf); |
| } catch (Exception e) { |
| LOG.warn("set log config topology exception. (topology id='{}')", topoId, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public LogConfig getLogConfig(String topoId) throws TException { |
| try { |
| getLogConfigCalls.mark(); |
| Map<String, Object> topoConf = tryReadTopoConf(topoId, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| String topoName = (String) topoConf.get(Config.TOPOLOGY_NAME); |
| checkAuthorization(topoName, topoConf, "getLogConfig"); |
| IStormClusterState state = stormClusterState; |
| LogConfig logConfig = state.topologyLogConfig(topoId, null); |
| if (logConfig == null) { |
| logConfig = new LogConfig(); |
| } |
| return logConfig; |
| } catch (Exception e) { |
| LOG.warn("get log conf topology exception. (topology id='{}')", topoId, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void debug(String topoName, String componentId, boolean enable, double samplingPercentage) |
| throws NotAliveException, AuthorizationException, TException { |
| debugCalls.mark(); |
| try { |
| IStormClusterState state = stormClusterState; |
| String topoId = toTopoId(topoName); |
| Map<String, Object> topoConf = tryReadTopoConf(topoId, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| // make sure samplingPct is within bounds. |
| double spct = Math.max(Math.min(samplingPercentage, 100.0), 0.0); |
| // while disabling we retain the sampling pct. |
| checkAuthorization(topoName, topoConf, "debug"); |
| if (topoId == null) { |
| throw new WrappedNotAliveException(topoName); |
| } |
| |
| DebugOptions options = new DebugOptions(); |
| options.set_enable(enable); |
| if (enable) { |
| options.set_samplingpct(spct); |
| } |
| StormBase updates = new StormBase(); |
| //For backwards compatability |
| updates.set_component_executors(Collections.emptyMap()); |
| boolean hasCompId = componentId != null && !componentId.isEmpty(); |
| String key = hasCompId ? componentId : topoId; |
| updates.put_to_component_debug(key, options); |
| |
| LOG.info("Nimbus setting debug to {} for storm-name '{}' storm-id '{}' sanpling pct '{}'" |
| + (hasCompId ? " component-id '" + componentId + "'" : ""), |
| enable, topoName, topoId, spct); |
| synchronized (submitLock) { |
| state.updateStorm(topoId, updates); |
| } |
| } catch (Exception e) { |
| LOG.warn("debug topology exception. (topology name='{}')", topoName, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void setWorkerProfiler(String topoId, ProfileRequest profileRequest) throws TException { |
| try { |
| setWorkerProfilerCalls.mark(); |
| Map<String, Object> topoConf = tryReadTopoConf(topoId, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| String topoName = (String) topoConf.get(Config.TOPOLOGY_NAME); |
| checkAuthorization(topoName, topoConf, "setWorkerProfiler"); |
| IStormClusterState state = stormClusterState; |
| state.setWorkerProfileRequest(topoId, profileRequest); |
| } catch (Exception e) { |
| LOG.warn("set worker profiler topology exception. (topology id='{}')", topoId, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public List<ProfileRequest> getComponentPendingProfileActions(String id, String componentId, ProfileAction action) |
| throws TException { |
| try { |
| getComponentPendingProfileActionsCalls.mark(); |
| CommonTopoInfo info = getCommonTopoInfo(id, "getComponentPendingProfileActions"); |
| Map<String, String> nodeToHost = info.assignment.get_node_host(); |
| Map<List<? extends Number>, List<Object>> exec2hostPort = new HashMap<>(); |
| for (Entry<List<Long>, NodeInfo> entry : info.assignment.get_executor_node_port().entrySet()) { |
| NodeInfo ni = entry.getValue(); |
| List<Object> hostPort = Arrays.asList(nodeToHost.get(ni.get_node()), ni.get_port_iterator().next().intValue()); |
| exec2hostPort.put(entry.getKey(), hostPort); |
| } |
| List<Map<String, Object>> nodeInfos = |
| StatsUtil.extractNodeInfosFromHbForComp(exec2hostPort, info.taskToComponent, false, componentId); |
| List<ProfileRequest> ret = new ArrayList<>(); |
| for (Map<String, Object> ni : nodeInfos) { |
| String niHost = (String) ni.get("host"); |
| int niPort = ((Integer) ni.get("port")).intValue(); |
| ProfileRequest newestMatch = null; |
| long reqTime = -1; |
| for (ProfileRequest req : stormClusterState.getTopologyProfileRequests(id)) { |
| String expectedHost = req.get_nodeInfo().get_node(); |
| int expectedPort = req.get_nodeInfo().get_port_iterator().next().intValue(); |
| ProfileAction expectedAction = req.get_action(); |
| if (niHost.equals(expectedHost) && niPort == expectedPort && action == expectedAction) { |
| long time = req.get_time_stamp(); |
| if (time > reqTime) { |
| reqTime = time; |
| newestMatch = req; |
| } |
| } |
| } |
| if (newestMatch != null) { |
| ret.add(newestMatch); |
| } |
| } |
| LOG.info("Latest profile actions for topology {} component {} {}", id, componentId, ret); |
| return ret; |
| } catch (Exception e) { |
| LOG.warn("Get comp actions topology exception. (topology id='{}')", id, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void uploadNewCredentials(String topoName, Credentials credentials) |
| throws NotAliveException, InvalidTopologyException, AuthorizationException, TException { |
| try { |
| uploadNewCredentialsCalls.mark(); |
| IStormClusterState state = stormClusterState; |
| String topoId = toTopoId(topoName); |
| if (topoId == null) { |
| throw new WrappedNotAliveException(topoName + " is not alive"); |
| } |
| Map<String, Object> topoConf = tryReadTopoConf(topoId, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| if (credentials == null) { |
| credentials = new Credentials(Collections.emptyMap()); |
| } |
| checkAuthorization(topoName, topoConf, "uploadNewCredentials"); |
| String realPrincipal = (String) topoConf.get(Config.TOPOLOGY_SUBMITTER_PRINCIPAL); |
| String realUser = (String) topoConf.get(Config.TOPOLOGY_SUBMITTER_USER); |
| String expectedOwner = null; |
| if (credentials.is_set_topoOwner()) { |
| expectedOwner = credentials.get_topoOwner(); |
| } else { |
| Principal p = ReqContext.context().principal(); |
| if (p != null) { |
| expectedOwner = p.getName(); |
| } |
| } |
| // expectedOwner being null means that security is disabled (which why are we uploading credentials with security disabled??? |
| if (expectedOwner == null) { |
| LOG.warn("Please check you settings. Credentials are being uploaded to {} with security disabled.", topoId); |
| } else if (!realPrincipal.equals(expectedOwner) && !realUser.equals(expectedOwner)) { |
| throw new AuthorizationException(topoId + " is expected to be owned by " + expectedOwner |
| + " but is actually owned by " + realPrincipal); |
| } |
| |
| synchronized (credUpdateLock) { |
| //Merge the old credentials so creds nimbus created are not lost. |
| // And in case the user forgot to upload something important this time. |
| Credentials origCreds = state.credentials(topoId, null); |
| if (origCreds != null) { |
| Map<String, String> mergedCreds = origCreds.get_creds(); |
| mergedCreds.putAll(credentials.get_creds()); |
| credentials.set_creds(mergedCreds); |
| } |
| state.setCredentials(topoId, credentials, topoConf); |
| } |
| } catch (Exception e) { |
| LOG.warn("Upload Creds topology exception. (topology name='{}')", topoName, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public String beginCreateBlob(String key, SettableBlobMeta meta) |
| throws AuthorizationException, KeyAlreadyExistsException, TException { |
| try { |
| String sessionId = Utils.uuid(); |
| blobUploaders.put(sessionId, blobStore.createBlob(key, meta, getSubject())); |
| LOG.info("Created blob {} for session {}", key, sessionId); |
| return sessionId; |
| } catch (Exception e) { |
| LOG.warn("begin create blob exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public String beginUpdateBlob(String key) throws AuthorizationException, KeyNotFoundException, TException { |
| try { |
| String sessionId = Utils.uuid(); |
| blobUploaders.put(sessionId, blobStore.updateBlob(key, getSubject())); |
| LOG.info("Created upload session for {}", key); |
| return sessionId; |
| } catch (Exception e) { |
| LOG.warn("begin update blob exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public void uploadBlobChunk(String session, ByteBuffer chunk) throws AuthorizationException, TException { |
| try { |
| OutputStream os = blobUploaders.get(session); |
| if (os == null) { |
| throw new RuntimeException("Blob for session " + session + " does not exist (or timed out)"); |
| } |
| byte[] array = chunk.array(); |
| int remaining = chunk.remaining(); |
| int offset = chunk.arrayOffset(); |
| int position = chunk.position(); |
| os.write(array, offset + position, remaining); |
| blobUploaders.put(session, os); |
| } catch (Exception e) { |
| LOG.warn("upload blob chunk exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public void finishBlobUpload(String session) throws AuthorizationException, TException { |
| try { |
| OutputStream os = blobUploaders.get(session); |
| if (os == null) { |
| throw new RuntimeException("Blob for session " + session + " does not exist (or timed out)"); |
| } |
| os.close(); |
| LOG.info("Finished uploading blob for session {}. Closing session.", session); |
| blobUploaders.remove(session); |
| } catch (Exception e) { |
| LOG.warn("finish blob upload exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public void cancelBlobUpload(String session) throws AuthorizationException, TException { |
| try { |
| AtomicOutputStream os = (AtomicOutputStream) blobUploaders.get(session); |
| if (os == null) { |
| throw new RuntimeException("Blob for session " + session + " does not exist (or timed out)"); |
| } |
| os.cancel(); |
| LOG.info("Canceled uploading blob for session {}. Closing session.", session); |
| blobUploaders.remove(session); |
| } catch (Exception e) { |
| LOG.warn("finish blob upload exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public ReadableBlobMeta getBlobMeta(String key) throws AuthorizationException, KeyNotFoundException, TException { |
| try { |
| return blobStore.getBlobMeta(key, getSubject()); |
| } catch (Exception e) { |
| LOG.warn("get blob meta exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void setBlobMeta(String key, SettableBlobMeta meta) |
| throws AuthorizationException, KeyNotFoundException, TException { |
| try { |
| blobStore.setBlobMeta(key, meta, getSubject()); |
| } catch (Exception e) { |
| LOG.warn("set blob meta exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public BeginDownloadResult beginBlobDownload(String key) |
| throws AuthorizationException, KeyNotFoundException, TException { |
| try { |
| InputStreamWithMeta is = blobStore.getBlob(key, getSubject()); |
| String sessionId = Utils.uuid(); |
| BeginDownloadResult ret = new BeginDownloadResult(is.getVersion(), sessionId); |
| ret.set_data_size(is.getFileLength()); |
| blobDownloaders.put(sessionId, new BufferInputStream(is, |
| (int) conf |
| .getOrDefault(Config.STORM_BLOBSTORE_INPUTSTREAM_BUFFER_SIZE_BYTES, |
| 65536))); |
| LOG.info("Created download session {} for {}", sessionId, key); |
| return ret; |
| } catch (Exception e) { |
| LOG.warn("begin blob download exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public ByteBuffer downloadBlobChunk(String session) throws AuthorizationException, TException { |
| try { |
| BufferInputStream is = blobDownloaders.get(session); |
| if (is == null) { |
| throw new RuntimeException("Blob for session " + session + " does not exist (or timed out)"); |
| } |
| byte[] ret = is.read(); |
| if (ret.length == 0) { |
| is.close(); |
| blobDownloaders.remove(session); |
| } else { |
| blobDownloaders.put(session, is); |
| } |
| LOG.debug("Sending {} bytes", ret.length); |
| return ByteBuffer.wrap(ret); |
| } catch (Exception e) { |
| LOG.warn("download blob chunk exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void deleteBlob(String key) throws AuthorizationException, KeyNotFoundException, IllegalStateException, TException { |
| try { |
| String topoName = ConfigUtils.getIdFromBlobKey(key); |
| if (topoName != null) { |
| if (isTopologyActiveOrActivating(stormClusterState, topoName)) { |
| String message = "Attempting to delete blob " + key + " from under active topology " + topoName; |
| LOG.warn(message); |
| throw new WrappedIllegalStateException(message); |
| } |
| } |
| blobStore.deleteBlob(key, getSubject()); |
| LOG.info("Deleted blob for key {}", key); |
| } catch (Exception e) { |
| LOG.warn("delete blob exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public ListBlobsResult listBlobs(String session) throws TException { |
| try { |
| Iterator<String> keyIt; |
| //Create a new session id if the user gave an empty session string. |
| // This is the use case when the user wishes to list blobs |
| // starting from the beginning. |
| if (session == null || session.isEmpty()) { |
| keyIt = blobStore.listKeys(); |
| session = Utils.uuid(); |
| } else { |
| keyIt = blobListers.get(session); |
| } |
| |
| if (keyIt == null) { |
| throw new RuntimeException("Blob list for session " + session + " does not exist (or timed out)"); |
| } |
| |
| if (!keyIt.hasNext()) { |
| blobListers.remove(session); |
| LOG.info("No more blobs to list for session {}", session); |
| // A blank result communicates that there are no more blobs. |
| return new ListBlobsResult(Collections.emptyList(), session); |
| } |
| |
| ArrayList<String> listChunk = new ArrayList<>(); |
| for (int i = 0; i < 100 && keyIt.hasNext(); i++) { |
| listChunk.add(keyIt.next()); |
| } |
| blobListers.put(session, keyIt); |
| LOG.info("Downloading {} entries", listChunk.size()); |
| return new ListBlobsResult(listChunk, session); |
| } catch (Exception e) { |
| LOG.warn("list blobs exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public int getBlobReplication(String key) throws AuthorizationException, KeyNotFoundException, TException { |
| try { |
| return blobStore.getBlobReplication(key, getSubject()); |
| } catch (Exception e) { |
| LOG.warn("get blob replication exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public int updateBlobReplication(String key, int replication) |
| throws AuthorizationException, KeyNotFoundException, TException { |
| try { |
| return blobStore.updateBlobReplication(key, replication, getSubject()); |
| } catch (Exception e) { |
| LOG.warn("update blob replication exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public void createStateInZookeeper(String key) throws TException { |
| try { |
| IStormClusterState state = stormClusterState; |
| BlobStore store = blobStore; |
| NimbusInfo ni = nimbusHostPortInfo; |
| if (store instanceof LocalFsBlobStore) { |
| state.setupBlob(key, ni, getVersionForKey(key, ni, zkClient)); |
| } |
| LOG.debug("Created state in zookeeper {} {} {}", state, store, ni); |
| } catch (Exception e) { |
| LOG.warn("Exception while creating state in zookeeper - key: " + key, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public String beginFileUpload() throws AuthorizationException, TException { |
| try { |
| beginFileUploadCalls.mark(); |
| assertIsLeader(); |
| checkAuthorization(null, null, "fileUpload"); |
| String fileloc = getInbox() + "/stormjar-" + Utils.uuid() + ".jar"; |
| uploaders.put(fileloc, new TimedWritableByteChannel(Channels.newChannel(new FileOutputStream(fileloc)), fileUploadDuration)); |
| LOG.info("Uploading file from client to {}", fileloc); |
| return fileloc; |
| } catch (Exception e) { |
| LOG.warn("Begin file upload exception", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public void uploadChunk(String location, ByteBuffer chunk) throws AuthorizationException, TException { |
| try { |
| uploadChunkCalls.mark(); |
| checkAuthorization(null, null, "fileUpload"); |
| WritableByteChannel channel = uploaders.get(location); |
| if (channel == null) { |
| throw new RuntimeException("File for that location does not exist (or timed out)"); |
| } |
| channel.write(chunk); |
| uploaders.put(location, channel); |
| } catch (Exception e) { |
| LOG.warn("uploadChunk exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public void finishFileUpload(String location) throws AuthorizationException, TException { |
| try { |
| finishFileUploadCalls.mark(); |
| checkAuthorization(null, null, "fileUpload"); |
| WritableByteChannel channel = uploaders.get(location); |
| if (channel == null) { |
| throw new RuntimeException("File for that location does not exist (or timed out)"); |
| } |
| channel.close(); |
| LOG.info("Finished uploading file from client: {}", location); |
| uploaders.remove(location); |
| } catch (Exception e) { |
| LOG.warn("finish file upload exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public ByteBuffer downloadChunk(String id) throws AuthorizationException, TException { |
| try { |
| downloadChunkCalls.mark(); |
| checkAuthorization(null, null, "fileDownload"); |
| BufferInputStream is = downloaders.get(id); |
| if (is == null) { |
| throw new RuntimeException("Could not find input stream for id " + id); |
| } |
| byte[] ret = is.read(); |
| if (ret.length == 0) { |
| is.close(); |
| downloaders.remove(id); |
| } |
| return ByteBuffer.wrap(ret); |
| } catch (Exception e) { |
| LOG.warn("download chunk exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public String getNimbusConf() throws AuthorizationException, TException { |
| try { |
| getNimbusConfCalls.mark(); |
| checkAuthorization(null, null, "getNimbusConf"); |
| return JSONValue.toJSONString(conf); |
| } catch (Exception e) { |
| LOG.warn("get nimbus conf exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public TopologyInfo getTopologyInfo(String id) throws NotAliveException, AuthorizationException, TException { |
| try { |
| getTopologyInfoCalls.mark(); |
| GetInfoOptions options = new GetInfoOptions(); |
| options.set_num_err_choice(NumErrorsChoice.ALL); |
| return getTopologyInfoWithOptsImpl(id, options); |
| } catch (Exception e) { |
| LOG.warn("get topology ino exception. (topology id={})", id, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public TopologyInfo getTopologyInfoByName(String name) throws TException { |
| try { |
| getTopologyInfoByNameCalls.mark(); |
| GetInfoOptions options = new GetInfoOptions(); |
| options.set_num_err_choice(NumErrorsChoice.ALL); |
| return getTopologyInfoByNameImpl(name, options); |
| } catch (Exception e) { |
| LOG.warn("get topology info exception. (topology name={})", name, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| private TopologyInfo getTopologyInfoByNameImpl(String name, GetInfoOptions options) |
| throws NotAliveException, AuthorizationException, Exception { |
| IStormClusterState state = stormClusterState; |
| String id = state.getTopoId(name).orElseThrow(() -> new WrappedNotAliveException(name + " is not alive")); |
| return getTopologyInfoWithOptsImpl(id, options); |
| } |
| |
| @Override |
| public TopologyInfo getTopologyInfoByNameWithOpts(String name, GetInfoOptions options) |
| throws NotAliveException, AuthorizationException, TException { |
| try { |
| getTopologyInfoByNameWithOptsCalls.mark(); |
| return getTopologyInfoByNameImpl(name, options); |
| } catch (Exception e) { |
| LOG.warn("get topology info withOpts by name exception. (topology name={})", name, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public TopologyInfo getTopologyInfoWithOpts(String topoId, GetInfoOptions options) |
| throws NotAliveException, AuthorizationException, TException { |
| getTopologyInfoWithOptsCalls.mark(); |
| |
| try { |
| return getTopologyInfoWithOptsImpl(topoId, options); |
| } catch (Exception e) { |
| LOG.warn("Get topo info exception. (topology id='{}')", topoId, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| private TopologyInfo getTopologyInfoWithOptsImpl(String topoId, GetInfoOptions options) throws NotAliveException, |
| AuthorizationException, InvalidTopologyException, Exception { |
| CommonTopoInfo common = getCommonTopoInfo(topoId, "getTopologyInfo"); |
| if (common.base == null) { |
| throw new WrappedNotAliveException(topoId); |
| } |
| IStormClusterState state = stormClusterState; |
| NumErrorsChoice numErrChoice = Utils.OR(options.get_num_err_choice(), NumErrorsChoice.ALL); |
| Map<String, List<ErrorInfo>> errors = new HashMap<>(); |
| for (String component : common.allComponents) { |
| switch (numErrChoice) { |
| case NONE: |
| errors.put(component, Collections.emptyList()); |
| break; |
| case ONE: |
| List<ErrorInfo> errList = new ArrayList<>(); |
| ErrorInfo info = state.lastError(topoId, component); |
| if (info != null) { |
| errList.add(info); |
| } |
| errors.put(component, errList); |
| break; |
| case ALL: |
| errors.put(component, state.errors(topoId, component)); |
| break; |
| default: |
| LOG.warn("Got invalid NumErrorsChoice '{}'", numErrChoice); |
| errors.put(component, state.errors(topoId, component)); |
| break; |
| } |
| } |
| |
| List<ExecutorSummary> summaries = new ArrayList<>(); |
| if (common.assignment != null) { |
| for (Entry<List<Long>, NodeInfo> entry : common.assignment.get_executor_node_port().entrySet()) { |
| NodeInfo ni = entry.getValue(); |
| ExecutorInfo execInfo = toExecInfo(entry.getKey()); |
| Map<String, String> nodeToHost = common.assignment.get_node_host(); |
| Map<String, Object> heartbeat = common.beats.get(ClientStatsUtil.convertExecutor(entry.getKey())); |
| if (heartbeat == null) { |
| heartbeat = Collections.emptyMap(); |
| } |
| ExecutorSummary summ = new ExecutorSummary(execInfo, |
| common.taskToComponent.get(execInfo.get_task_start()), |
| nodeToHost.get(ni.get_node()), ni.get_port_iterator().next().intValue(), |
| (Integer) heartbeat.getOrDefault("uptime", 0)); |
| |
| //heartbeats "stats" |
| Map ex = (Map) heartbeat.get("stats"); |
| if (ex != null) { |
| ExecutorStats stats = StatsUtil.thriftifyExecutorStats(ex); |
| summ.set_stats(stats); |
| } |
| summaries.add(summ); |
| } |
| } |
| TopologyInfo topoInfo = new TopologyInfo(topoId, common.topoName, Time.deltaSecs(common.launchTimeSecs), |
| summaries, extractStatusStr(common.base), errors); |
| if (common.topology.is_set_storm_version()) { |
| topoInfo.set_storm_version(common.topology.get_storm_version()); |
| } |
| if (common.base.is_set_owner()) { |
| topoInfo.set_owner(common.base.get_owner()); |
| } |
| String schedStatus = idToSchedStatus.get().get(topoId); |
| if (schedStatus != null) { |
| topoInfo.set_sched_status(schedStatus); |
| } |
| TopologyResources resources = getResourcesForTopology(topoId, common.base); |
| if (resources != null && underlyingScheduler instanceof ResourceAwareScheduler) { |
| topoInfo.set_requested_memonheap(resources.getRequestedMemOnHeap()); |
| topoInfo.set_requested_memoffheap(resources.getRequestedMemOffHeap()); |
| topoInfo.set_requested_cpu(resources.getRequestedCpu()); |
| topoInfo.set_assigned_memonheap(resources.getAssignedMemOnHeap()); |
| topoInfo.set_assigned_memoffheap(resources.getAssignedMemOffHeap()); |
| topoInfo.set_assigned_cpu(resources.getAssignedCpu()); |
| |
| } |
| if (common.base.is_set_component_debug()) { |
| topoInfo.set_component_debug(common.base.get_component_debug()); |
| } |
| topoInfo.set_replication_count(getBlobReplicationCount(ConfigUtils.masterStormCodeKey(topoId))); |
| return topoInfo; |
| } |
| |
| @Override |
| public TopologyPageInfo getTopologyPageInfo(String topoId, String window, boolean includeSys) |
| throws NotAliveException, AuthorizationException, TException { |
| try { |
| getTopologyPageInfoCalls.mark(); |
| CommonTopoInfo common = getCommonTopoInfo(topoId, "getTopologyPageInfo"); |
| String topoName = common.topoName; |
| IStormClusterState state = stormClusterState; |
| Assignment assignment = common.assignment; |
| Map<List<Integer>, Map<String, Object>> beats = common.beats; |
| Map<Integer, String> taskToComp = common.taskToComponent; |
| StormTopology topology = common.topology; |
| StormBase base = common.base; |
| if (base == null) { |
| throw new WrappedNotAliveException(topoId); |
| } |
| String owner = base.get_owner(); |
| Map<WorkerSlot, WorkerResources> workerToResources = getWorkerResourcesForTopology(topoId); |
| List<WorkerSummary> workerSummaries = null; |
| Map<List<Long>, List<Object>> exec2NodePort = new HashMap<>(); |
| if (assignment != null) { |
| Map<List<Long>, NodeInfo> execToNodeInfo = assignment.get_executor_node_port(); |
| Map<String, String> nodeToHost = assignment.get_node_host(); |
| for (Entry<List<Long>, NodeInfo> entry : execToNodeInfo.entrySet()) { |
| NodeInfo ni = entry.getValue(); |
| List<Object> nodePort = Arrays.asList(ni.get_node(), ni.get_port_iterator().next()); |
| exec2NodePort.put(entry.getKey(), nodePort); |
| } |
| |
| workerSummaries = StatsUtil.aggWorkerStats(topoId, |
| topoName, |
| taskToComp, |
| beats, |
| exec2NodePort, |
| nodeToHost, |
| workerToResources, |
| includeSys, |
| true, //this is the topology page, so we know the user is authorized |
| null, |
| owner); |
| } |
| |
| TopologyPageInfo topoPageInfo = StatsUtil.aggTopoExecsStats(topoId, |
| exec2NodePort, |
| taskToComp, |
| beats, |
| topology, |
| window, |
| includeSys, |
| state); |
| |
| if (topology.is_set_storm_version()) { |
| topoPageInfo.set_storm_version(topology.get_storm_version()); |
| } |
| |
| Map<String, Object> topoConf = Utils.merge(conf, common.topoConf); |
| |
| |
| addSpoutAggStats(topoPageInfo, topology, topoConf); |
| addBoltAggStats(topoPageInfo, topology, topoConf, includeSys); |
| |
| if (workerSummaries != null) { |
| topoPageInfo.set_workers(workerSummaries); |
| } |
| if (base.is_set_owner()) { |
| topoPageInfo.set_owner(base.get_owner()); |
| } |
| |
| if (base.is_set_topology_version()) { |
| topoPageInfo.set_topology_version(base.get_topology_version()); |
| } |
| |
| String schedStatus = idToSchedStatus.get().get(topoId); |
| if (schedStatus != null) { |
| topoPageInfo.set_sched_status(schedStatus); |
| } |
| TopologyResources resources = getResourcesForTopology(topoId, base); |
| if (resources != null && underlyingScheduler instanceof ResourceAwareScheduler) { |
| topoPageInfo.set_requested_memonheap(resources.getRequestedMemOnHeap()); |
| topoPageInfo.set_requested_memoffheap(resources.getRequestedMemOffHeap()); |
| topoPageInfo.set_requested_cpu(resources.getRequestedCpu()); |
| topoPageInfo.set_assigned_memonheap(resources.getAssignedMemOnHeap()); |
| topoPageInfo.set_assigned_memoffheap(resources.getAssignedMemOffHeap()); |
| topoPageInfo.set_assigned_cpu(resources.getAssignedCpu()); |
| topoPageInfo.set_requested_shared_off_heap_memory(resources.getRequestedSharedMemOffHeap()); |
| topoPageInfo.set_requested_regular_off_heap_memory(resources.getRequestedNonSharedMemOffHeap()); |
| topoPageInfo.set_requested_shared_on_heap_memory(resources.getRequestedSharedMemOnHeap()); |
| topoPageInfo.set_requested_regular_on_heap_memory(resources.getRequestedNonSharedMemOnHeap()); |
| topoPageInfo.set_assigned_shared_off_heap_memory(resources.getAssignedSharedMemOffHeap()); |
| topoPageInfo.set_assigned_regular_off_heap_memory(resources.getAssignedNonSharedMemOffHeap()); |
| topoPageInfo.set_assigned_shared_on_heap_memory(resources.getAssignedSharedMemOnHeap()); |
| topoPageInfo.set_assigned_regular_on_heap_memory(resources.getAssignedNonSharedMemOnHeap()); |
| topoPageInfo.set_assigned_generic_resources(resources.getAssignedGenericResources()); |
| topoPageInfo.set_requested_generic_resources(resources.getRequestedGenericResources()); |
| } |
| int launchTimeSecs = common.launchTimeSecs; |
| topoPageInfo.set_name(topoName); |
| topoPageInfo.set_status(extractStatusStr(base)); |
| topoPageInfo.set_uptime_secs(Time.deltaSecs(launchTimeSecs)); |
| topoPageInfo.set_topology_conf(JSONValue.toJSONString(topoConf)); |
| topoPageInfo.set_replication_count(getBlobReplicationCount(ConfigUtils.masterStormCodeKey(topoId))); |
| if (base.is_set_component_debug()) { |
| DebugOptions debug = base.get_component_debug().get(topoId); |
| if (debug != null) { |
| topoPageInfo.set_debug_options(debug); |
| } |
| } |
| return topoPageInfo; |
| } catch (Exception e) { |
| LOG.warn("Get topo page info exception. (topology id='{}')", topoId, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| /** |
| * If aggStats are not populated, compute common and component(spout) agg and create placeholder stat. |
| * This allow the topology page to show component spec even the topo is not scheduled. |
| * Otherwise, just fetch data from current topoPageInfo. |
| * |
| * @param topoPageInfo topology page info holding spout AggStats |
| * @param topology storm topology used to get spout names |
| * @param topoConf storm topology config |
| */ |
| private void addSpoutAggStats(TopologyPageInfo topoPageInfo, StormTopology topology, Map<String, Object> topoConf) { |
| Map<String, NormalizedResourceRequest> spoutResources = ResourceUtils.getSpoutsResources(topology, topoConf); |
| |
| // if agg stats were not populated yet, create placeholder |
| if (topoPageInfo.get_id_to_spout_agg_stats().isEmpty()) { |
| for (Entry<String, SpoutSpec> entry : topology.get_spouts().entrySet()) { |
| String spoutName = entry.getKey(); |
| SpoutSpec spoutSpec = entry.getValue(); |
| |
| // component |
| ComponentAggregateStats placeholderComponentStats = new ComponentAggregateStats(); |
| placeholderComponentStats.set_type(ComponentType.SPOUT); |
| |
| // common aggregate |
| CommonAggregateStats commonStats = getPlaceholderCommonAggregateStats(spoutSpec); |
| commonStats.set_resources_map(spoutResources.getOrDefault(spoutName, new NormalizedResourceRequest()) |
| .toNormalizedMap()); |
| placeholderComponentStats.set_common_stats(commonStats); |
| |
| // spout aggregate |
| SpoutAggregateStats spoutAggStats = new SpoutAggregateStats(); |
| spoutAggStats.set_complete_latency_ms(0); |
| SpecificAggregateStats specificStats = new SpecificAggregateStats(); |
| specificStats.set_spout(spoutAggStats); |
| placeholderComponentStats.set_specific_stats(specificStats); |
| topoPageInfo.get_id_to_spout_agg_stats().put(spoutName, placeholderComponentStats); |
| } |
| } else { |
| for (Entry<String, ComponentAggregateStats> entry : topoPageInfo.get_id_to_spout_agg_stats().entrySet()) { |
| CommonAggregateStats commonStats = entry.getValue().get_common_stats(); |
| setResourcesDefaultIfNotSet(spoutResources, entry.getKey(), topoConf); |
| commonStats.set_resources_map(spoutResources.get(entry.getKey()).toNormalizedMap()); |
| } |
| } |
| } |
| |
| /** |
| * If aggStats are not populated, compute common and component(bolt) agg and create placeholder stat. |
| * This allow the topology page to show component spec even the topo is not scheduled. |
| * Otherwise, just fetch data from current topoPageInfo. |
| * |
| * @param topoPageInfo topology page info holding bolt AggStats |
| * @param topology storm topology used to get bolt names |
| * @param topoConf storm topology config |
| * @param includeSys whether to show system bolts |
| */ |
| private void addBoltAggStats(TopologyPageInfo topoPageInfo, StormTopology topology, |
| Map<String, Object> topoConf, boolean includeSys) { |
| Map<String, NormalizedResourceRequest> boltResources = ResourceUtils.getBoltsResources(topology, topoConf); |
| |
| // if agg stats were not populated yet, create placeholder |
| if (topoPageInfo.get_id_to_bolt_agg_stats().isEmpty()) { |
| for (Entry<String, Bolt> entry : topology.get_bolts().entrySet()) { |
| String boltName = entry.getKey(); |
| Bolt bolt = entry.getValue(); |
| if ((!includeSys && Utils.isSystemId(boltName)) || boltName.equals(Constants.SYSTEM_COMPONENT_ID)) { |
| continue; |
| } |
| |
| // component |
| ComponentAggregateStats placeholderComponentStats = new ComponentAggregateStats(); |
| placeholderComponentStats.set_type(ComponentType.BOLT); |
| |
| // common aggregate |
| CommonAggregateStats commonStats = getPlaceholderCommonAggregateStats(bolt); |
| commonStats.set_resources_map(boltResources.getOrDefault(boltName, new NormalizedResourceRequest()) |
| .toNormalizedMap()); |
| placeholderComponentStats.set_common_stats(commonStats); |
| |
| // bolt aggregate |
| BoltAggregateStats boltAggStats = new BoltAggregateStats(); |
| boltAggStats.set_execute_latency_ms(0); |
| boltAggStats.set_process_latency_ms(0); |
| boltAggStats.set_executed(0); |
| boltAggStats.set_capacity(0); |
| SpecificAggregateStats specificStats = new SpecificAggregateStats(); |
| specificStats.set_bolt(boltAggStats); |
| placeholderComponentStats.set_specific_stats(specificStats); |
| |
| topoPageInfo.get_id_to_bolt_agg_stats().put(boltName, placeholderComponentStats); |
| } |
| } else { |
| for (Entry<String, ComponentAggregateStats> entry : topoPageInfo.get_id_to_bolt_agg_stats().entrySet()) { |
| CommonAggregateStats commonStats = entry.getValue().get_common_stats(); |
| setResourcesDefaultIfNotSet(boltResources, entry.getKey(), topoConf); |
| commonStats.set_resources_map(boltResources.get(entry.getKey()).toNormalizedMap()); |
| } |
| } |
| } |
| |
| private CommonAggregateStats getPlaceholderCommonAggregateStats(Object component) { |
| // common aggregate |
| CommonAggregateStats commonStats = new CommonAggregateStats(); |
| |
| // get num_executors |
| int numExecutors = 0; |
| try { |
| numExecutors = StormCommon.numStartExecutors(component); |
| } catch (InvalidTopologyException e) { |
| // ignore |
| } |
| |
| // get num_tasks |
| Map<String, Object> jsonMap = StormCommon.componentConf(component); |
| int numTasks = ObjectReader.getInt(jsonMap.getOrDefault(Config.TOPOLOGY_TASKS, numExecutors)); |
| |
| commonStats.set_num_executors(numExecutors); |
| commonStats.set_num_tasks(numTasks); |
| commonStats.set_emitted(0); |
| commonStats.set_transferred(0); |
| commonStats.set_acked(0); |
| |
| return commonStats; |
| } |
| |
| @Override |
| public SupervisorPageInfo getSupervisorPageInfo(String superId, String host, boolean includeSys) |
| throws NotAliveException, AuthorizationException, TException { |
| try { |
| getSupervisorPageInfoCalls.mark(); |
| IStormClusterState state = stormClusterState; |
| Map<String, SupervisorInfo> superInfos = state.allSupervisorInfo(); |
| Map<String, List<String>> hostToSuperId = new HashMap<>(); |
| for (Entry<String, SupervisorInfo> entry : superInfos.entrySet()) { |
| String h = entry.getValue().get_hostname(); |
| List<String> superIds = hostToSuperId.get(h); |
| if (superIds == null) { |
| superIds = new ArrayList<>(); |
| hostToSuperId.put(h, superIds); |
| } |
| superIds.add(entry.getKey()); |
| } |
| List<String> supervisorIds = null; |
| if (superId == null) { |
| supervisorIds = hostToSuperId.get(host); |
| } else { |
| supervisorIds = Arrays.asList(superId); |
| } |
| SupervisorPageInfo pageInfo = new SupervisorPageInfo(); |
| Map<String, Assignment> topoToAssignment = state.assignmentsInfo(); |
| for (String sid : supervisorIds) { |
| SupervisorInfo info = superInfos.get(sid); |
| LOG.info("SIDL {} SI: {} ALL: {}", sid, info, superInfos); |
| SupervisorSummary supSum = makeSupervisorSummary(sid, info); |
| pageInfo.add_to_supervisor_summaries(supSum); |
| List<String> superTopologies = topologiesOnSupervisor(topoToAssignment, sid); |
| Set<String> userTopologies = filterAuthorized("getTopology", superTopologies); |
| for (String topoId : superTopologies) { |
| CommonTopoInfo common = getCommonTopoInfo(topoId, "getSupervisorPageInfo"); |
| String topoName = common.topoName; |
| Assignment assignment = common.assignment; |
| Map<List<Integer>, Map<String, Object>> beats = common.beats; |
| Map<Integer, String> taskToComp = common.taskToComponent; |
| Map<List<Long>, List<Object>> exec2NodePort = new HashMap<>(); |
| Map<String, String> nodeToHost; |
| if (assignment != null) { |
| Map<List<Long>, NodeInfo> execToNodeInfo = assignment.get_executor_node_port(); |
| for (Entry<List<Long>, NodeInfo> entry : execToNodeInfo.entrySet()) { |
| NodeInfo ni = entry.getValue(); |
| List<Object> nodePort = Arrays.asList(ni.get_node(), ni.get_port_iterator().next()); |
| exec2NodePort.put(entry.getKey(), nodePort); |
| } |
| nodeToHost = assignment.get_node_host(); |
| } else { |
| nodeToHost = Collections.emptyMap(); |
| } |
| Map<WorkerSlot, WorkerResources> workerResources = getWorkerResourcesForTopology(topoId); |
| boolean isAllowed = userTopologies.contains(topoId); |
| String owner = (common.base == null) ? null : common.base.get_owner(); |
| for (WorkerSummary workerSummary : StatsUtil.aggWorkerStats(topoId, topoName, taskToComp, beats, |
| exec2NodePort, nodeToHost, workerResources, includeSys, |
| isAllowed, sid, owner)) { |
| pageInfo.add_to_worker_summaries(workerSummary); |
| } |
| } |
| } |
| return pageInfo; |
| } catch (Exception e) { |
| LOG.warn("Get super page info exception. (super id='{}')", superId, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public ComponentPageInfo getComponentPageInfo(String topoId, String componentId, String window, boolean includeSys) |
| throws NotAliveException, AuthorizationException, TException { |
| try { |
| getComponentPageInfoCalls.mark(); |
| CommonTopoInfo info = getCommonTopoInfo(topoId, "getComponentPageInfo"); |
| if (info.base == null) { |
| throw new WrappedNotAliveException(topoId); |
| } |
| StormTopology topology = info.topology; |
| Map<String, Object> topoConf = info.topoConf; |
| topoConf = Utils.merge(conf, topoConf); |
| Assignment assignment = info.assignment; |
| Map<List<Long>, List<Object>> exec2NodePort = new HashMap<>(); |
| Map<String, String> nodeToHost; |
| Map<List<Long>, List<Object>> exec2HostPort = new HashMap<>(); |
| if (assignment != null) { |
| Map<List<Long>, NodeInfo> execToNodeInfo = assignment.get_executor_node_port(); |
| nodeToHost = assignment.get_node_host(); |
| for (Entry<List<Long>, NodeInfo> entry : execToNodeInfo.entrySet()) { |
| NodeInfo ni = entry.getValue(); |
| List<Object> nodePort = Arrays.asList(ni.get_node(), ni.get_port_iterator().next()); |
| List<Object> hostPort = Arrays.asList(nodeToHost.get(ni.get_node()), ni.get_port_iterator().next()); |
| exec2NodePort.put(entry.getKey(), nodePort); |
| exec2HostPort.put(entry.getKey(), hostPort); |
| } |
| } else { |
| nodeToHost = Collections.emptyMap(); |
| } |
| |
| ComponentPageInfo compPageInfo = StatsUtil.aggCompExecsStats(exec2HostPort, info.taskToComponent, info.beats, window, |
| includeSys, topoId, topology, componentId); |
| if (compPageInfo.get_component_type() == ComponentType.SPOUT) { |
| NormalizedResourceRequest spoutResources = ResourceUtils.getSpoutResources(topology, topoConf, componentId); |
| if (spoutResources == null) { |
| spoutResources = new NormalizedResourceRequest(topoConf, componentId); |
| } |
| compPageInfo.set_resources_map(spoutResources.toNormalizedMap()); |
| } else { //bolt |
| NormalizedResourceRequest boltResources = ResourceUtils.getBoltResources(topology, topoConf, componentId); |
| if (boltResources == null) { |
| boltResources = new NormalizedResourceRequest(topoConf, componentId); |
| } |
| compPageInfo.set_resources_map(boltResources.toNormalizedMap()); |
| } |
| compPageInfo.set_topology_name(info.topoName); |
| compPageInfo.set_errors(stormClusterState.errors(topoId, componentId)); |
| compPageInfo.set_topology_status(extractStatusStr(info.base)); |
| if (info.base.is_set_component_debug()) { |
| DebugOptions debug = info.base.get_component_debug().get(componentId); |
| if (debug != null) { |
| compPageInfo.set_debug_options(debug); |
| } |
| } |
| // Add the event logger details. |
| Map<String, List<Integer>> compToTasks = Utils.reverseMap(info.taskToComponent); |
| if (compToTasks.containsKey(StormCommon.EVENTLOGGER_COMPONENT_ID)) { |
| List<Integer> tasks = compToTasks.get(StormCommon.EVENTLOGGER_COMPONENT_ID); |
| tasks.sort(null); |
| // Find the task the events from this component route to. |
| int taskIndex = TupleUtils.chooseTaskIndex(Collections.singletonList(componentId), tasks.size()); |
| int taskId = tasks.get(taskIndex); |
| String host = null; |
| Integer port = null; |
| for (Entry<List<Long>, List<Object>> entry : exec2HostPort.entrySet()) { |
| int start = entry.getKey().get(0).intValue(); |
| int end = entry.getKey().get(1).intValue(); |
| if (taskId >= start && taskId <= end) { |
| host = (String) entry.getValue().get(0); |
| port = ((Number) entry.getValue().get(1)).intValue(); |
| break; |
| } |
| } |
| |
| if (host != null && port != null) { |
| compPageInfo.set_eventlog_host(host); |
| compPageInfo.set_eventlog_port(port); |
| } |
| } |
| return compPageInfo; |
| } catch (Exception e) { |
| LOG.warn("getComponentPageInfo exception. (topo id='{}')", topoId, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public String getTopologyConf(String id) throws NotAliveException, AuthorizationException, TException { |
| try { |
| getTopologyConfCalls.mark(); |
| Map<String, Object> topoConf = tryReadTopoConf(id, topoCache); |
| Map<String, Object> checkConf = Utils.merge(conf, topoConf); |
| String topoName = (String) checkConf.get(Config.TOPOLOGY_NAME); |
| checkAuthorization(topoName, checkConf, "getTopologyConf"); |
| return JSONValue.toJSONString(topoConf); |
| } catch (Exception e) { |
| LOG.warn("Get topo conf exception. (topology id='{}')", id, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public StormTopology getTopology(String id) throws NotAliveException, AuthorizationException, TException { |
| try { |
| getTopologyCalls.mark(); |
| Map<String, Object> topoConf = tryReadTopoConf(id, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| String topoName = (String) topoConf.get(Config.TOPOLOGY_NAME); |
| checkAuthorization(topoName, topoConf, "getTopology"); |
| return StormCommon.systemTopology(topoConf, tryReadTopology(id, topoCache)); |
| } catch (Exception e) { |
| LOG.warn("Get topology exception. (topology id='{}')", id, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public StormTopology getUserTopology(String id) throws NotAliveException, AuthorizationException, TException { |
| try { |
| getUserTopologyCalls.mark(); |
| Map<String, Object> topoConf = tryReadTopoConf(id, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| String topoName = (String) topoConf.get(Config.TOPOLOGY_NAME); |
| checkAuthorization(topoName, topoConf, "getUserTopology"); |
| return tryReadTopology(id, topoCache); |
| } catch (Exception e) { |
| LOG.warn("Get user topology exception. (topology id='{}')", id, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("unchecked") |
| @Override |
| public TopologyHistoryInfo getTopologyHistory(String user) throws AuthorizationException, TException { |
| try { |
| List<String> adminUsers = (List<String>) conf.getOrDefault(Config.NIMBUS_ADMINS, Collections.emptyList()); |
| List<String> adminGroups = (List<String>) conf.getOrDefault(Config.NIMBUS_ADMINS_GROUPS, Collections.emptyList()); |
| IStormClusterState state = stormClusterState; |
| List<String> assignedIds = state.assignments(null); |
| Set<String> ret = new HashSet<>(); |
| boolean isAdmin = adminUsers.contains(user); |
| for (String topoId : assignedIds) { |
| Map<String, Object> topoConf = tryReadTopoConf(topoId, topoCache); |
| topoConf = Utils.merge(conf, topoConf); |
| List<String> groups = ServerConfigUtils.getTopoLogsGroups(topoConf); |
| List<String> topoLogUsers = ServerConfigUtils.getTopoLogsUsers(topoConf); |
| if (user == null || isAdmin |
| || isUserPartOf(user, groups) |
| || isUserPartOf(user, adminGroups) |
| || topoLogUsers.contains(user)) { |
| ret.add(topoId); |
| } |
| } |
| ret.addAll(readTopologyHistory(user, adminUsers)); |
| return new TopologyHistoryInfo(new ArrayList<>(ret)); |
| } catch (Exception e) { |
| LOG.warn("Get topology history. (user='{}')", user, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public ClusterSummary getClusterInfo() throws AuthorizationException, TException { |
| try { |
| getClusterInfoCalls.mark(); |
| checkAuthorization(null, null, "getClusterInfo"); |
| return getClusterInfoImpl(); |
| } catch (Exception e) { |
| LOG.warn("Get cluster info exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public List<TopologySummary> getTopologySummaries() throws AuthorizationException, TException { |
| try { |
| getTopologySummariesCalls.mark(); |
| checkAuthorization(null, null, "getTopologySummaries"); |
| return getTopologySummariesImpl(); |
| } catch (Exception e) { |
| LOG.warn("Get TopologySummary info exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public TopologySummary getTopologySummaryByName(String name) |
| throws NotAliveException, AuthorizationException, TException { |
| try { |
| getTopologySummaryByNameCalls.mark(); |
| checkAuthorization(name, null, "getTopologySummaryByName"); |
| IStormClusterState state = stormClusterState; |
| String topoId = state.getTopoId(name).orElseThrow(() -> new WrappedNotAliveException(name + " is not alive")); |
| return getTopologySummaryImpl(topoId, state.topologyBases().get(topoId)); |
| } catch (Exception e) { |
| LOG.warn("Get TopologySummaryByName info exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public TopologySummary getTopologySummary(String id) |
| throws NotAliveException, AuthorizationException, TException { |
| try { |
| getTopologySummaryCalls.mark(); |
| IStormClusterState state = stormClusterState; |
| StormBase base = state.topologyBases().get(id); |
| if (base == null) { |
| throw new WrappedNotAliveException(id + " is not alive"); |
| } |
| checkAuthorization(base.get_name(), null, "getTopologySummary"); |
| return getTopologySummaryImpl(id, base); |
| } catch (Exception e) { |
| LOG.warn("Get TopologySummaryById info exception.", e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public NimbusSummary getLeader() throws AuthorizationException, TException { |
| getLeaderCalls.mark(); |
| checkAuthorization(null, null, "getLeader"); |
| List<NimbusSummary> nimbuses = stormClusterState.nimbuses(); |
| NimbusInfo leader = leaderElector.getLeader(); |
| for (NimbusSummary nimbusSummary : nimbuses) { |
| if (leader.getHost().equals(nimbusSummary.get_host()) |
| && leader.getPort() == nimbusSummary.get_port()) { |
| nimbusSummary.set_uptime_secs(Time.deltaSecs(nimbusSummary.get_uptime_secs())); |
| nimbusSummary.set_isLeader(true); |
| return nimbusSummary; |
| } |
| } |
| return null; |
| } |
| |
| @Override |
| public boolean isTopologyNameAllowed(String name) throws AuthorizationException, TException { |
| isTopologyNameAllowedCalls.mark(); |
| try { |
| checkAuthorization(name, null, "isTopologyNameAllowed"); |
| validateTopologyName(name); |
| assertTopoActive(name, false); |
| return true; |
| } catch (InvalidTopologyException | AlreadyAliveException e) { |
| return false; |
| } |
| } |
| |
| @Override |
| public List<OwnerResourceSummary> getOwnerResourceSummaries(String owner) throws AuthorizationException, TException { |
| try { |
| getOwnerResourceSummariesCalls.mark(); |
| checkAuthorization(null, null, "getOwnerResourceSummaries"); |
| IStormClusterState state = stormClusterState; |
| Map<String, Assignment> topoIdToAssignments = state.assignmentsInfo(); |
| Map<String, StormBase> topoIdToBases = state.topologyBases(); |
| Map<String, Number> clusterSchedulerConfig = scheduler.config(); |
| |
| //put [owner-> StormBase-list] mapping to ownerToBasesMap |
| //if this owner (the input parameter) is null, add all the owners with stormbase and guarantees |
| //else, add only this owner (the input paramter) to the map |
| Map<String, List<StormBase>> ownerToBasesMap = new HashMap<>(); |
| |
| if (owner == null) { |
| // add all the owners to the map |
| for (StormBase base : topoIdToBases.values()) { |
| String baseOwner = base.get_owner(); |
| if (!ownerToBasesMap.containsKey(baseOwner)) { |
| List<StormBase> stormbases = new ArrayList<>(); |
| stormbases.add(base); |
| ownerToBasesMap.put(baseOwner, stormbases); |
| } else { |
| ownerToBasesMap.get(baseOwner).add(base); |
| } |
| } |
| //in addition, add all the owners with guarantees |
| List<String> ownersWithGuarantees = new ArrayList<>(clusterSchedulerConfig.keySet()); |
| for (String ownerWithGuarantees : ownersWithGuarantees) { |
| if (!ownerToBasesMap.containsKey(ownerWithGuarantees)) { |
| ownerToBasesMap.put(ownerWithGuarantees, new ArrayList<>()); |
| } |
| } |
| } else { |
| //only put this owner to the map |
| List<StormBase> stormbases = new ArrayList<>(); |
| for (StormBase base : topoIdToBases.values()) { |
| if (owner.equals(base.get_owner())) { |
| stormbases.add(base); |
| } |
| } |
| ownerToBasesMap.put(owner, stormbases); |
| } |
| |
| List<OwnerResourceSummary> ret = new ArrayList<>(); |
| |
| //for each owner, get resources, configs, and aggregate |
| for (Entry<String, List<StormBase>> ownerToBasesEntry : ownerToBasesMap.entrySet()) { |
| String theOwner = ownerToBasesEntry.getKey(); |
| TopologyResources totalResourcesAggregate = new TopologyResources(); |
| |
| int totalExecutors = 0; |
| int totalWorkers = 0; |
| int totalTasks = 0; |
| |
| for (StormBase base : ownerToBasesEntry.getValue()) { |
| try { |
| String topoId = toTopoId(base.get_name()); |
| TopologyResources resources = getResourcesForTopology(topoId, base); |
| totalResourcesAggregate = totalResourcesAggregate.add(resources); |
| Assignment ownerAssignment = topoIdToAssignments.get(topoId); |
| if (ownerAssignment != null && ownerAssignment.get_executor_node_port() != null) { |
| totalExecutors += ownerAssignment.get_executor_node_port().keySet().size(); |
| totalWorkers += new HashSet(ownerAssignment.get_executor_node_port().values()).size(); |
| for (List<Long> executorId : ownerAssignment.get_executor_node_port().keySet()) { |
| totalTasks += StormCommon.executorIdToTasks(executorId).size(); |
| } |
| } |
| } catch (NotAliveException e) { |
| LOG.warn("{} is not alive.", base.get_name()); |
| } |
| } |
| |
| double requestedTotalMemory = totalResourcesAggregate.getRequestedMemOnHeap() |
| + totalResourcesAggregate.getRequestedMemOffHeap(); |
| double assignedTotalMemory = totalResourcesAggregate.getAssignedMemOnHeap() |
| + totalResourcesAggregate.getAssignedMemOffHeap(); |
| |
| OwnerResourceSummary ownerResourceSummary = new OwnerResourceSummary(theOwner); |
| ownerResourceSummary.set_total_topologies(ownerToBasesEntry.getValue().size()); |
| ownerResourceSummary.set_total_executors(totalExecutors); |
| ownerResourceSummary.set_total_workers(totalWorkers); |
| ownerResourceSummary.set_total_tasks(totalTasks); |
| ownerResourceSummary.set_memory_usage(assignedTotalMemory); |
| ownerResourceSummary.set_cpu_usage(totalResourcesAggregate.getAssignedCpu()); |
| ownerResourceSummary.set_requested_on_heap_memory(totalResourcesAggregate.getRequestedMemOnHeap()); |
| ownerResourceSummary.set_requested_off_heap_memory(totalResourcesAggregate.getRequestedMemOffHeap()); |
| ownerResourceSummary.set_requested_total_memory(requestedTotalMemory); |
| ownerResourceSummary.set_requested_cpu(totalResourcesAggregate.getRequestedCpu()); |
| ownerResourceSummary.set_assigned_on_heap_memory(totalResourcesAggregate.getAssignedMemOnHeap()); |
| ownerResourceSummary.set_assigned_off_heap_memory(totalResourcesAggregate.getAssignedMemOffHeap()); |
| |
| if (clusterSchedulerConfig.containsKey(theOwner)) { |
| if (underlyingScheduler instanceof ResourceAwareScheduler) { |
| Map<String, Object> schedulerConfig = (Map) clusterSchedulerConfig.get(theOwner); |
| if (schedulerConfig != null) { |
| ownerResourceSummary.set_memory_guarantee((double) schedulerConfig.getOrDefault("memory", 0)); |
| ownerResourceSummary.set_cpu_guarantee((double) schedulerConfig.getOrDefault("cpu", 0)); |
| ownerResourceSummary.set_memory_guarantee_remaining(ownerResourceSummary.get_memory_guarantee() |
| - ownerResourceSummary.get_memory_usage()); |
| ownerResourceSummary.set_cpu_guarantee_remaining(ownerResourceSummary.get_cpu_guarantee() |
| - ownerResourceSummary.get_cpu_usage()); |
| } |
| } else if (underlyingScheduler instanceof MultitenantScheduler) { |
| ownerResourceSummary.set_isolated_node_guarantee((int) clusterSchedulerConfig.getOrDefault(theOwner, 0)); |
| } |
| } |
| |
| LOG.debug("{}", ownerResourceSummary.toString()); |
| ret.add(ownerResourceSummary); |
| } |
| |
| return ret; |
| } catch (Exception e) { |
| LOG.warn("Get owner resource summaries exception. (owner = '{}')", owner); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public SupervisorAssignments getSupervisorAssignments(String nodeId) throws AuthorizationException, TException { |
| checkAuthorization(null, null, "getSupervisorAssignments"); |
| try { |
| if (isLeader() && isAssignmentsRecovered()) { |
| SupervisorAssignments supervisorAssignments = new SupervisorAssignments(); |
| supervisorAssignments.set_storm_assignment(assignmentsForNodeId(stormClusterState.assignmentsInfo(), nodeId)); |
| return supervisorAssignments; |
| } |
| } catch (Exception e) { |
| LOG.debug("Exception when node {} fetching assignments", nodeId); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| // When this master is not leader and get a sync request from node, |
| // just return nil which will cause client/node to get an unknown error, |
| // the node/supervisor will sync it as a timer task. |
| LOG.debug("Exception when node {} fetching assignments", nodeId); |
| } |
| return null; |
| } |
| |
| @Override |
| public void sendSupervisorWorkerHeartbeats(SupervisorWorkerHeartbeats heartbeats) |
| throws AuthorizationException, TException { |
| checkAuthorization(null, null, "sendSupervisorWorkerHeartbeats"); |
| try { |
| if (isLeader()) { |
| updateCachedHeartbeatsFromSupervisor(heartbeats); |
| } |
| } catch (Exception e) { |
| LOG.debug("Exception when update heartbeats for node {} heartbeats report.", |
| heartbeats.get_supervisor_id()); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| // When this master is not leader and get heartbeats report from supervisor/node, just ignore it. |
| } |
| } |
| |
| @Override |
| public void sendSupervisorWorkerHeartbeat(SupervisorWorkerHeartbeat hb) throws AuthorizationException, TException { |
| String id = hb.get_storm_id(); |
| try { |
| Map<String, Object> topoConf = tryReadTopoConf(id, topoCache); |
| String topoName = (String) topoConf.get(Config.TOPOLOGY_NAME); |
| checkAuthorization(topoName, topoConf, "sendSupervisorWorkerHeartbeat"); |
| if (isLeader()) { |
| int heartbeatTimeoutSecs = getTopologyHeartbeatTimeoutSecs(topoConf); |
| updateCachedHeartbeatsFromWorker(hb, heartbeatTimeoutSecs); |
| } |
| } catch (Exception e) { |
| LOG.warn("Send HB exception. (topology id='{}')", id, e); |
| if (e instanceof TException) { |
| throw (TException) e; |
| } |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @SuppressWarnings("deprecation") |
| @Override |
| public void shutdown() { |
| shutdownCalls.mark(); |
| try { |
| LOG.info("Shutting down master"); |
| timer.close(); |
| stormClusterState.disconnect(); |
| downloaders.cleanup(); |
| uploaders.cleanup(); |
| blobDownloaders.cleanup(); |
| blobUploaders.cleanup(); |
| blobListers.cleanup(); |
| scheduler.cleanup(); |
| blobStore.shutdown(); |
| leaderElector.close(); |
| assignmentsDistributer.close(); |
| ITopologyActionNotifierPlugin actionNotifier = nimbusTopologyActionNotifier; |
| if (actionNotifier != null) { |
| actionNotifier.cleanup(); |
| } |
| zkClient.close(); |
| if (metricsStore != null) { |
| metricsStore.close(); |
| } |
| clusterMetricSet.setActive(false); |
| LOG.info("Shut down master"); |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| } |
| |
| @Override |
| public boolean isWaiting() { |
| return timer.isTimerWaiting(); |
| } |
| |
| @Override |
| public void processWorkerMetrics(WorkerMetrics metrics) throws TException { |
| processWorkerMetricsCalls.mark(); |
| |
| checkAuthorization(null, null, "processWorkerMetrics"); |
| |
| if (this.metricsStore == null) { |
| return; |
| } |
| |
| for (WorkerMetricPoint m : metrics.get_metricList().get_metrics()) { |
| try { |
| Metric metric = new Metric(m.get_metricName(), m.get_timestamp(), metrics.get_topologyId(), |
| m.get_metricValue(), m.get_componentId(), m.get_executorId(), metrics.get_hostname(), |
| m.get_streamId(), metrics.get_port(), AggLevel.AGG_LEVEL_NONE); |
| this.metricsStore.insert(metric); |
| } catch (Exception e) { |
| LOG.error("Failed to save metric", e); |
| } |
| } |
| } |
| |
| @Override |
| public boolean isRemoteBlobExists(String blobKey) throws AuthorizationException, TException { |
| try { |
| blobStore.getBlobMeta(blobKey, getSubject()); |
| } catch (KeyNotFoundException e) { |
| return false; |
| } |
| return true; |
| } |
| |
| private static final class Assoc<K, V> implements UnaryOperator<Map<K, V>> { |
| private final K key; |
| private final V value; |
| |
| Assoc(K key, V value) { |
| this.key = key; |
| this.value = value; |
| } |
| |
| @Override |
| public Map<K, V> apply(Map<K, V> t) { |
| Map<K, V> ret = new HashMap<>(t); |
| ret.put(key, value); |
| return ret; |
| } |
| } |
| |
| // Shutdownable methods |
| |
| private static final class Dissoc<K, V> implements UnaryOperator<Map<K, V>> { |
| private final K key; |
| |
| Dissoc(K key) { |
| this.key = key; |
| } |
| |
| @Override |
| public Map<K, V> apply(Map<K, V> t) { |
| Map<K, V> ret = new HashMap<>(t); |
| ret.remove(key); |
| return ret; |
| } |
| } |
| |
| //Daemon common methods |
| |
| @VisibleForTesting |
| public static class StandaloneINimbus implements INimbus { |
| |
| @Override |
| public void prepare(Map<String, Object> topoConf, String schedulerLocalDir) { |
| //NOOP |
| } |
| |
| @SuppressWarnings("unchecked") |
| @Override |
| public Collection<WorkerSlot> allSlotsAvailableForScheduling(Collection<SupervisorDetails> supervisors, |
| Topologies topologies, Set<String> topologiesMissingAssignments) { |
| Set<WorkerSlot> ret = new HashSet<>(); |
| for (SupervisorDetails sd : supervisors) { |
| String id = sd.getId(); |
| for (Number port : (Collection<Number>) sd.getMeta()) { |
| ret.add(new WorkerSlot(id, port)); |
| } |
| } |
| return ret; |
| } |
| |
| @Override |
| public void assignSlots(Topologies topologies, Map<String, Collection<WorkerSlot>> newSlotsByTopologyId) { |
| //NOOP |
| } |
| |
| @Override |
| public String getHostName(Map<String, SupervisorDetails> supervisors, String nodeId) { |
| SupervisorDetails sd = supervisors.get(nodeId); |
| if (sd != null) { |
| return sd.getHost(); |
| } |
| return null; |
| } |
| |
| @Override |
| public IScheduler getForcedScheduler() { |
| return null; |
| } |
| |
| } |
| |
| private static class CommonTopoInfo { |
| public Map<String, Object> topoConf; |
| public String topoName; |
| public StormTopology topology; |
| public Map<Integer, String> taskToComponent; |
| public StormBase base; |
| public int launchTimeSecs; |
| public Assignment assignment; |
| public Map<List<Integer>, Map<String, Object>> beats; |
| public HashSet<String> allComponents; |
| |
| } |
| |
| private static class ClusterSummaryMetrics implements MetricSet { |
| private static final String SUMMARY = "summary"; |
| private final Map<String, com.codahale.metrics.Metric> metrics = new HashMap<>(); |
| |
| public com.codahale.metrics.Metric put(String key, com.codahale.metrics.Metric value) { |
| return metrics.put(MetricRegistry.name(SUMMARY, key), value); |
| } |
| |
| @Override |
| public Map<String, com.codahale.metrics.Metric> getMetrics() { |
| return metrics; |
| } |
| } |
| |
| private class ClusterSummaryMetricSet implements Runnable { |
| private static final int CACHING_WINDOW = 5; |
| |
| private final ClusterSummaryMetrics clusterSummaryMetrics = new ClusterSummaryMetrics(); |
| |
| private final Function<String, Histogram> registerHistogram = (name) -> { |
| //This histogram reflects the data distribution across only one ClusterSummary, i.e., |
| // data distribution across all entities of a type (e.g., data from all nimbus/topologies) at one moment. |
| // Hence we use half of the CACHING_WINDOW time to ensure it retains only data from the most recent update |
| final Histogram histogram = new Histogram(new SlidingTimeWindowReservoir(CACHING_WINDOW / 2, TimeUnit.SECONDS)); |
| clusterSummaryMetrics.put(name, histogram); |
| return histogram; |
| }; |
| private volatile boolean active = false; |
| |
| //NImbus metrics distribution |
| private final Histogram nimbusUptime = registerHistogram.apply("nimbuses:uptime-secs"); |
| |
| //Supervisor metrics distribution |
| private final Histogram supervisorsUptime = registerHistogram.apply("supervisors:uptime-secs"); |
| private final Histogram supervisorsNumWorkers = registerHistogram.apply("supervisors:num-workers"); |
| private final Histogram supervisorsNumUsedWorkers = registerHistogram.apply("supervisors:num-used-workers"); |
| private final Histogram supervisorsUsedMem = registerHistogram.apply("supervisors:used-mem"); |
| private final Histogram supervisorsUsedCpu = registerHistogram.apply("supervisors:used-cpu"); |
| private final Histogram supervisorsFragmentedMem = registerHistogram.apply("supervisors:fragmented-mem"); |
| private final Histogram supervisorsFragmentedCpu = registerHistogram.apply("supervisors:fragmented-cpu"); |
| |
| //Topology metrics distribution |
| private final Histogram topologiesNumTasks = registerHistogram.apply("topologies:num-tasks"); |
| private final Histogram topologiesNumExecutors = registerHistogram.apply("topologies:num-executors"); |
| private final Histogram topologiesNumWorker = registerHistogram.apply("topologies:num-workers"); |
| private final Histogram topologiesUptime = registerHistogram.apply("topologies:uptime-secs"); |
| private final Histogram topologiesReplicationCount = registerHistogram.apply("topologies:replication-count"); |
| private final Histogram topologiesRequestedMemOnHeap = registerHistogram.apply("topologies:requested-mem-on-heap"); |
| private final Histogram topologiesRequestedMemOffHeap = registerHistogram.apply("topologies:requested-mem-off-heap"); |
| private final Histogram topologiesRequestedCpu = registerHistogram.apply("topologies:requested-cpu"); |
| private final Histogram topologiesAssignedMemOnHeap = registerHistogram.apply("topologies:assigned-mem-on-heap"); |
| private final Histogram topologiesAssignedMemOffHeap = registerHistogram.apply("topologies:assigned-mem-off-heap"); |
| private final Histogram topologiesAssignedCpu = registerHistogram.apply("topologies:assigned-cpu"); |
| private final StormMetricsRegistry metricsRegistry; |
| |
| /** |
| * Constructor to put all items in ClusterSummary in MetricSet as a metric. |
| * All metrics are derived from a cached ClusterSummary object, |
| * expired {@link ClusterSummaryMetricSet#CACHING_WINDOW} seconds after first query in a while from reporters. |
| * In case of {@link com.codahale.metrics.ScheduledReporter}, CACHING_WINDOW should be set shorter than |
| * reporting interval to avoid outdated reporting. |
| */ |
| ClusterSummaryMetricSet(StormMetricsRegistry metricsRegistry) { |
| this.metricsRegistry = metricsRegistry; |
| //Break the code if out of sync to thrift protocol |
| assert ClusterSummary._Fields.values().length == 3 |
| && ClusterSummary._Fields.findByName("supervisors") == ClusterSummary._Fields.SUPERVISORS |
| && ClusterSummary._Fields.findByName("topologies") == ClusterSummary._Fields.TOPOLOGIES |
| && ClusterSummary._Fields.findByName("nimbuses") == ClusterSummary._Fields.NIMBUSES; |
| |
| final CachedGauge<ClusterSummary> cachedSummary = new CachedGauge<ClusterSummary>(CACHING_WINDOW, TimeUnit.SECONDS) { |
| @Override |
| protected ClusterSummary loadValue() { |
| try { |
| ClusterSummary newSummary = getClusterInfoImpl(); |
| LOG.debug("The new summary is {}", newSummary); |
| /* |
| * Update histograms based on the new summary. Most common implementation of Reporter reports Gauges before |
| * Histograms. Because DerivativeGauge will trigger cache refresh upon reporter's query, histogram will also be |
| * updated before query |
| */ |
| updateHistogram(newSummary); |
| return newSummary; |
| } catch (Exception e) { |
| LOG.warn("Get cluster info exception.", e); |
| throw new RuntimeException(e); |
| } |
| } |
| }; |
| |
| clusterSummaryMetrics.put("cluster:num-nimbus-leaders", |
| new DerivativeGauge<ClusterSummary, Long>(cachedSummary) { |
| @Override |
| protected Long transform(ClusterSummary clusterSummary) { |
| return clusterSummary.get_nimbuses().stream() |
| .filter(NimbusSummary::is_isLeader) |
| .count(); |
| } |
| }); |
| clusterSummaryMetrics.put("cluster:num-nimbuses", |
| new DerivativeGauge<ClusterSummary, Integer>(cachedSummary) { |
| @Override |
| protected Integer transform(ClusterSummary clusterSummary) { |
| return clusterSummary.get_nimbuses_size(); |
| } |
| }); |
| clusterSummaryMetrics.put("cluster:num-supervisors", |
| new DerivativeGauge<ClusterSummary, Integer>(cachedSummary) { |
| @Override |
| protected Integer transform(ClusterSummary clusterSummary) { |
| return clusterSummary.get_supervisors_size(); |
| } |
| }); |
| clusterSummaryMetrics.put("cluster:num-topologies", |
| new DerivativeGauge<ClusterSummary, Integer>(cachedSummary) { |
| @Override |
| protected Integer transform(ClusterSummary clusterSummary) { |
| return clusterSummary.get_topologies_size(); |
| } |
| }); |
| clusterSummaryMetrics.put("cluster:num-total-workers", |
| new DerivativeGauge<ClusterSummary, Integer>(cachedSummary) { |
| @Override |
| protected Integer transform(ClusterSummary clusterSummary) { |
| return clusterSummary.get_supervisors().stream() |
| .mapToInt(SupervisorSummary::get_num_workers) |
| .sum(); |
| } |
| }); |
| clusterSummaryMetrics.put("cluster:num-total-used-workers", |
| new DerivativeGauge<ClusterSummary, Integer>(cachedSummary) { |
| @Override |
| protected Integer transform(ClusterSummary clusterSummary) { |
| return clusterSummary.get_supervisors().stream() |
| .mapToInt(SupervisorSummary::get_num_used_workers) |
| .sum(); |
| } |
| }); |
| clusterSummaryMetrics.put("cluster:total-fragmented-memory-non-negative", |
| new DerivativeGauge<ClusterSummary, Double>(cachedSummary) { |
| @Override |
| protected Double transform(ClusterSummary clusterSummary) { |
| return clusterSummary.get_supervisors().stream() |
| //Filtered negative value |
| .mapToDouble(supervisorSummary -> Math.max(supervisorSummary.get_fragmented_mem(), 0)) |
| .sum(); |
| } |
| }); |
| clusterSummaryMetrics.put("cluster:total-fragmented-cpu-non-negative", |
| new DerivativeGauge<ClusterSummary, Double>(cachedSummary) { |
| @Override |
| protected Double transform(ClusterSummary clusterSummary) { |
| return clusterSummary.get_supervisors().stream() |
| //Filtered negative value |
| .mapToDouble(supervisorSummary -> Math.max(supervisorSummary.get_fragmented_cpu(), 0)) |
| .sum(); |
| } |
| }); |
| } |
| |
| private void updateHistogram(ClusterSummary newSummary) { |
| for (NimbusSummary nimbusSummary : newSummary.get_nimbuses()) { |
| nimbusUptime.update(nimbusSummary.get_uptime_secs()); |
| } |
| for (SupervisorSummary summary : newSummary.get_supervisors()) { |
| supervisorsUptime.update(summary.get_uptime_secs()); |
| supervisorsNumWorkers.update(summary.get_num_workers()); |
| supervisorsNumUsedWorkers.update(summary.get_num_used_workers()); |
| supervisorsUsedMem.update(Math.round(summary.get_used_mem())); |
| supervisorsUsedCpu.update(Math.round(summary.get_used_cpu())); |
| supervisorsFragmentedMem.update(Math.round(summary.get_fragmented_mem())); |
| supervisorsFragmentedCpu.update(Math.round(summary.get_fragmented_cpu())); |
| } |
| for (TopologySummary summary : newSummary.get_topologies()) { |
| topologiesNumTasks.update(summary.get_num_tasks()); |
| topologiesNumExecutors.update(summary.get_num_executors()); |
| topologiesNumWorker.update(summary.get_num_workers()); |
| topologiesUptime.update(summary.get_uptime_secs()); |
| topologiesReplicationCount.update(summary.get_replication_count()); |
| topologiesRequestedMemOnHeap.update(Math.round(summary.get_requested_memonheap())); |
| topologiesRequestedMemOffHeap.update(Math.round(summary.get_requested_memoffheap())); |
| topologiesRequestedCpu.update(Math.round(summary.get_requested_cpu())); |
| topologiesAssignedMemOnHeap.update(Math.round(summary.get_assigned_memonheap())); |
| topologiesAssignedMemOffHeap.update(Math.round(summary.get_assigned_memoffheap())); |
| topologiesAssignedCpu.update(Math.round(summary.get_assigned_cpu())); |
| } |
| } |
| |
| void setActive(final boolean active) { |
| if (this.active != active) { |
| this.active = active; |
| if (active) { |
| metricsRegistry.registerAll(clusterSummaryMetrics); |
| } else { |
| metricsRegistry.removeAll(clusterSummaryMetrics); |
| } |
| } |
| } |
| |
| @Override |
| public void run() { |
| try { |
| setActive(isLeader()); |
| } catch (Exception e) { |
| throw new RuntimeException(e); |
| } |
| } |
| } |
| } |
| |