| /* |
| * ==================================================================== |
| * Licensed to the Apache Software Foundation (ASF) under one or more |
| * contributor license agreements. See the NOTICE file distributed with |
| * this work for additional information regarding copyright ownership. |
| * The ASF licenses this file to You under the Apache License, Version 2.0 |
| * (the "License"); you may not use this file except in compliance with |
| * the License. You may obtain a copy of the License at |
| * |
| * http://www.apache.org/licenses/LICENSE-2.0 |
| * |
| * Unless required by applicable law or agreed to in writing, software |
| * distributed under the License is distributed on an "AS IS" BASIS, |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| * See the License for the specific language governing permissions and |
| * limitations under the License. |
| * ==================================================================== |
| */ |
| |
| package org.apache.poi.xslf.usermodel; |
| |
| import java.awt.Color; |
| import java.awt.geom.Rectangle2D; |
| |
| import javax.xml.stream.XMLStreamException; |
| import javax.xml.stream.XMLStreamReader; |
| |
| import org.apache.poi.ooxml.util.POIXMLUnits; |
| import org.apache.poi.openxml4j.opc.PackagePart; |
| import org.apache.poi.sl.draw.DrawPaint; |
| import org.apache.poi.sl.draw.geom.CustomGeometry; |
| import org.apache.poi.sl.draw.geom.Guide; |
| import org.apache.poi.sl.draw.geom.PresetGeometries; |
| import org.apache.poi.sl.usermodel.FillStyle; |
| import org.apache.poi.sl.usermodel.LineDecoration; |
| import org.apache.poi.sl.usermodel.LineDecoration.DecorationShape; |
| import org.apache.poi.sl.usermodel.LineDecoration.DecorationSize; |
| import org.apache.poi.sl.usermodel.PaintStyle; |
| import org.apache.poi.sl.usermodel.PaintStyle.SolidPaint; |
| import org.apache.poi.sl.usermodel.ShapeType; |
| import org.apache.poi.sl.usermodel.SimpleShape; |
| import org.apache.poi.sl.usermodel.StrokeStyle; |
| import org.apache.poi.sl.usermodel.StrokeStyle.LineCap; |
| import org.apache.poi.sl.usermodel.StrokeStyle.LineCompound; |
| import org.apache.poi.sl.usermodel.StrokeStyle.LineDash; |
| import org.apache.poi.util.Beta; |
| import org.apache.poi.util.POILogFactory; |
| import org.apache.poi.util.POILogger; |
| import org.apache.poi.util.Units; |
| import org.apache.poi.xslf.model.PropertyFetcher; |
| import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFEffectProperties; |
| import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFFillProperties; |
| import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFGeometryProperties; |
| import org.apache.xmlbeans.XmlObject; |
| import org.openxmlformats.schemas.drawingml.x2006.main.*; |
| |
| /** |
| * Represents a single (non-group) shape in a .pptx slide show |
| */ |
| @Beta |
| public abstract class XSLFSimpleShape extends XSLFShape |
| implements SimpleShape<XSLFShape,XSLFTextParagraph> { |
| private static final CTOuterShadowEffect NO_SHADOW = CTOuterShadowEffect.Factory.newInstance(); |
| private static final POILogger LOG = POILogFactory.getLogger(XSLFSimpleShape.class); |
| |
| /* package */XSLFSimpleShape(XmlObject shape, XSLFSheet sheet) { |
| super(shape,sheet); |
| } |
| |
| @Override |
| public void setShapeType(ShapeType type) { |
| XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); |
| if (gp == null) { |
| return; |
| } |
| if (gp.isSetCustGeom()) { |
| gp.unsetCustGeom(); |
| } |
| CTPresetGeometry2D prst = (gp.isSetPrstGeom()) ? gp.getPrstGeom() : gp.addNewPrstGeom(); |
| prst.setPrst(STShapeType.Enum.forInt(type.ooxmlId)); |
| } |
| |
| @Override |
| public ShapeType getShapeType(){ |
| XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); |
| if (gp != null && gp.isSetPrstGeom()) { |
| STShapeType.Enum geom = gp.getPrstGeom().getPrst(); |
| if (geom != null) { |
| return ShapeType.forId(geom.intValue(), true); |
| } |
| } |
| return null; |
| } |
| |
| protected CTTransform2D getXfrm(boolean create) { |
| PropertyFetcher<CTTransform2D> fetcher = new PropertyFetcher<CTTransform2D>() { |
| @Override |
| public boolean fetch(XSLFShape shape) { |
| XmlObject xo = shape.getShapeProperties(); |
| if (xo instanceof CTShapeProperties && ((CTShapeProperties)xo).isSetXfrm()) { |
| setValue(((CTShapeProperties)xo).getXfrm()); |
| return true; |
| } |
| return false; |
| } |
| }; |
| fetchShapeProperty(fetcher); |
| |
| CTTransform2D xfrm = fetcher.getValue(); |
| if (!create || xfrm != null) { |
| return xfrm; |
| } else { |
| XmlObject xo = getShapeProperties(); |
| if (xo instanceof CTShapeProperties) { |
| return ((CTShapeProperties)xo).addNewXfrm(); |
| } else { |
| // ... group shapes have their own getXfrm() |
| LOG.log(POILogger.WARN, getClass() +" doesn't have xfrm element."); |
| return null; |
| } |
| } |
| } |
| |
| @Override |
| public Rectangle2D getAnchor() { |
| |
| CTTransform2D xfrm = getXfrm(false); |
| if (xfrm == null || !xfrm.isSetOff()) { |
| return null; |
| } |
| |
| CTPoint2D off = xfrm.getOff(); |
| double x = Units.toPoints(POIXMLUnits.parseLength(off.xgetX())); |
| double y = Units.toPoints(POIXMLUnits.parseLength(off.xgetY())); |
| CTPositiveSize2D ext = xfrm.getExt(); |
| double cx = Units.toPoints(ext.getCx()); |
| double cy = Units.toPoints(ext.getCy()); |
| return new Rectangle2D.Double(x, y, cx, cy); |
| } |
| |
| @Override |
| public void setAnchor(Rectangle2D anchor) { |
| CTTransform2D xfrm = getXfrm(true); |
| if (xfrm == null) { |
| return; |
| } |
| CTPoint2D off = xfrm.isSetOff() ? xfrm.getOff() : xfrm.addNewOff(); |
| long x = Units.toEMU(anchor.getX()); |
| long y = Units.toEMU(anchor.getY()); |
| off.setX(x); |
| off.setY(y); |
| CTPositiveSize2D ext = xfrm.isSetExt() ? xfrm.getExt() : xfrm |
| .addNewExt(); |
| long cx = Units.toEMU(anchor.getWidth()); |
| long cy = Units.toEMU(anchor.getHeight()); |
| ext.setCx(cx); |
| ext.setCy(cy); |
| } |
| |
| @Override |
| public void setRotation(double theta) { |
| CTTransform2D xfrm = getXfrm(true); |
| if (xfrm != null) { |
| xfrm.setRot((int) (theta * 60000)); |
| } |
| } |
| |
| @Override |
| public double getRotation() { |
| CTTransform2D xfrm = getXfrm(false); |
| return (xfrm == null || !xfrm.isSetRot()) ? 0 : (xfrm.getRot() / 60000.d); |
| } |
| |
| @Override |
| public void setFlipHorizontal(boolean flip) { |
| CTTransform2D xfrm = getXfrm(true); |
| if (xfrm != null) { |
| xfrm.setFlipH(flip); |
| } |
| } |
| |
| @Override |
| public void setFlipVertical(boolean flip) { |
| CTTransform2D xfrm = getXfrm(true); |
| if (xfrm != null) { |
| xfrm.setFlipV(flip); |
| } |
| } |
| |
| @Override |
| public boolean getFlipHorizontal() { |
| CTTransform2D xfrm = getXfrm(false); |
| return (xfrm != null && xfrm.isSetFlipH()) && xfrm.getFlipH(); |
| } |
| |
| @Override |
| public boolean getFlipVertical() { |
| CTTransform2D xfrm = getXfrm(false); |
| return (xfrm != null && xfrm.isSetFlipV()) && xfrm.getFlipV(); |
| } |
| |
| |
| /** |
| * Get default line properties defined in the theme (if any). |
| * Used internally to resolve shape properties. |
| * |
| * @return line properties from the theme of null |
| */ |
| private CTLineProperties getDefaultLineProperties() { |
| CTShapeStyle style = getSpStyle(); |
| if (style == null) { |
| return null; |
| } |
| CTStyleMatrixReference lnRef = style.getLnRef(); |
| if (lnRef == null) { |
| return null; |
| } |
| // 1-based index of a line style within the style matrix |
| int idx = Math.toIntExact(lnRef.getIdx()); |
| |
| XSLFTheme theme = getSheet().getTheme(); |
| if (theme == null) { |
| return null; |
| } |
| CTBaseStyles styles = theme.getXmlObject().getThemeElements(); |
| if (styles == null) { |
| return null; |
| } |
| CTStyleMatrix styleMatrix = styles.getFmtScheme(); |
| if (styleMatrix == null) { |
| return null; |
| } |
| CTLineStyleList lineStyles = styleMatrix.getLnStyleLst(); |
| if (lineStyles == null || lineStyles.sizeOfLnArray() < idx) { |
| return null; |
| } |
| |
| return lineStyles.getLnArray(idx - 1); |
| } |
| |
| /** |
| * @param color the color to paint the shape outline. |
| * A <code>null</code> value turns off the shape outline. |
| */ |
| public void setLineColor(Color color) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| |
| if (ln.isSetSolidFill()) { |
| ln.unsetSolidFill(); |
| } |
| if (ln.isSetGradFill()) { |
| ln.unsetGradFill(); |
| } |
| if (ln.isSetPattFill()) { |
| ln.unsetPattFill(); |
| } |
| if (ln.isSetNoFill()) { |
| ln.unsetNoFill(); |
| } |
| |
| |
| if (color == null) { |
| ln.addNewNoFill(); |
| } else { |
| CTSolidColorFillProperties fill = ln.addNewSolidFill(); |
| XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr(), getSheet()); |
| col.setColor(color); |
| } |
| } |
| |
| /** |
| * |
| * @return the color of the shape outline or <code>null</code> |
| * if outline is turned off |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public Color getLineColor() { |
| PaintStyle ps = getLinePaint(); |
| if (ps instanceof SolidPaint) { |
| return ((SolidPaint)ps).getSolidColor().getColor(); |
| } |
| return null; |
| } |
| |
| @SuppressWarnings("WeakerAccess") |
| protected PaintStyle getLinePaint() { |
| XSLFSheet sheet = getSheet(); |
| final XSLFTheme theme = sheet.getTheme(); |
| final boolean hasPlaceholder = getPlaceholder() != null; |
| PropertyFetcher<PaintStyle> fetcher = new PropertyFetcher<PaintStyle>() { |
| @Override |
| public boolean fetch(XSLFShape shape) { |
| CTLineProperties spPr = getLn(shape, false); |
| XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(spPr); |
| |
| if (fp != null && fp.isSetNoFill()) { |
| setValue(null); |
| return true; |
| } |
| |
| PackagePart pp = shape.getSheet().getPackagePart(); |
| PaintStyle paint = selectPaint(fp, null, pp, theme, hasPlaceholder); |
| if (paint != null) { |
| setValue(paint); |
| return true; |
| } |
| |
| CTShapeStyle style = shape.getSpStyle(); |
| if (style != null) { |
| fp = XSLFPropertiesDelegate.getFillDelegate(style.getLnRef()); |
| paint = selectPaint(fp, null, pp, theme, hasPlaceholder); |
| |
| // line color was not found, check if it is defined in the theme |
| if (paint == null) { |
| paint = getThemePaint(style, pp); |
| } |
| } |
| |
| if (paint != null) { |
| setValue(paint); |
| return true; |
| } |
| |
| return false; |
| } |
| |
| PaintStyle getThemePaint(CTShapeStyle style, PackagePart pp) { |
| // get a reference to a line style within the style matrix. |
| CTStyleMatrixReference lnRef = style.getLnRef(); |
| if (lnRef == null) { |
| return null; |
| } |
| int idx = Math.toIntExact(lnRef.getIdx()); |
| CTSchemeColor phClr = lnRef.getSchemeClr(); |
| if(idx <= 0){ |
| return null; |
| } |
| |
| CTLineProperties props = theme.getXmlObject().getThemeElements().getFmtScheme().getLnStyleLst().getLnArray(idx - 1); |
| XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(props); |
| return selectPaint(fp, phClr, pp, theme, hasPlaceholder); |
| } |
| }; |
| fetchShapeProperty(fetcher); |
| |
| return fetcher.getValue(); |
| } |
| |
| /** |
| * |
| * @param width line width in points. <code>0</code> means no line |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineWidth(double width) { |
| CTLineProperties lnPr = getLn(this, true); |
| if (lnPr == null) { |
| return; |
| } |
| |
| if (width == 0.) { |
| if (lnPr.isSetW()) { |
| lnPr.unsetW(); |
| } |
| if (!lnPr.isSetNoFill()) { |
| lnPr.addNewNoFill(); |
| } |
| if (lnPr.isSetSolidFill()) { |
| lnPr.unsetSolidFill(); |
| } |
| if (lnPr.isSetGradFill()) { |
| lnPr.unsetGradFill(); |
| } |
| if (lnPr.isSetPattFill()) { |
| lnPr.unsetPattFill(); |
| } |
| } else { |
| if (lnPr.isSetNoFill()) { |
| lnPr.unsetNoFill(); |
| } |
| |
| lnPr.setW(Units.toEMU(width)); |
| } |
| } |
| |
| /** |
| * @return line width in points. <code>0</code> means no line. |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public double getLineWidth() { |
| PropertyFetcher<Double> fetcher = new PropertyFetcher<Double>() { |
| @Override |
| public boolean fetch(XSLFShape shape) { |
| CTLineProperties ln = getLn(shape, false); |
| if (ln != null) { |
| if (ln.isSetNoFill()) { |
| setValue(0.); |
| return true; |
| } |
| |
| if (ln.isSetW()) { |
| setValue(Units.toPoints(ln.getW())); |
| return true; |
| } |
| } |
| return false; |
| } |
| }; |
| fetchShapeProperty(fetcher); |
| |
| double lineWidth = 0; |
| if (fetcher.getValue() == null) { |
| CTLineProperties defaultLn = getDefaultLineProperties(); |
| if (defaultLn != null) { |
| if (defaultLn.isSetW()) { |
| lineWidth = Units.toPoints(defaultLn.getW()); |
| } |
| } |
| } else { |
| lineWidth = fetcher.getValue(); |
| } |
| |
| return lineWidth; |
| } |
| |
| |
| /** |
| * @param compound set the line compound style |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineCompound(LineCompound compound) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| if (compound == null) { |
| if (ln.isSetCmpd()) { |
| ln.unsetCmpd(); |
| } |
| } else { |
| STCompoundLine.Enum xCmpd; |
| switch (compound) { |
| default: |
| case SINGLE: |
| xCmpd = STCompoundLine.SNG; |
| break; |
| case DOUBLE: |
| xCmpd = STCompoundLine.DBL; |
| break; |
| case THICK_THIN: |
| xCmpd = STCompoundLine.THICK_THIN; |
| break; |
| case THIN_THICK: |
| xCmpd = STCompoundLine.THIN_THICK; |
| break; |
| case TRIPLE: |
| xCmpd = STCompoundLine.TRI; |
| break; |
| } |
| ln.setCmpd(xCmpd); |
| } |
| } |
| |
| /** |
| * @return the line compound |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public LineCompound getLineCompound() { |
| PropertyFetcher<Integer> fetcher = new PropertyFetcher<Integer>() { |
| @Override |
| public boolean fetch(XSLFShape shape) { |
| CTLineProperties ln = getLn(shape, false); |
| if (ln != null) { |
| STCompoundLine.Enum stCmpd = ln.getCmpd(); |
| if (stCmpd != null) { |
| setValue(stCmpd.intValue()); |
| return true; |
| } |
| } |
| return false; |
| } |
| }; |
| fetchShapeProperty(fetcher); |
| |
| Integer cmpd = fetcher.getValue(); |
| if (cmpd == null) { |
| CTLineProperties defaultLn = getDefaultLineProperties(); |
| if (defaultLn != null && defaultLn.isSetCmpd()) { |
| switch (defaultLn.getCmpd().intValue()) { |
| default: |
| case STCompoundLine.INT_SNG: |
| return LineCompound.SINGLE; |
| case STCompoundLine.INT_DBL: |
| return LineCompound.DOUBLE; |
| case STCompoundLine.INT_THICK_THIN: |
| return LineCompound.THICK_THIN; |
| case STCompoundLine.INT_THIN_THICK: |
| return LineCompound.THIN_THICK; |
| case STCompoundLine.INT_TRI: |
| return LineCompound.TRIPLE; |
| } |
| } |
| } |
| |
| return null; |
| } |
| |
| /** |
| * |
| * @param dash a preset line dashing scheme to stroke thr shape outline |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineDash(LineDash dash) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| if (dash == null) { |
| if (ln.isSetPrstDash()) { |
| ln.unsetPrstDash(); |
| } |
| } else { |
| CTPresetLineDashProperties ldp = ln.isSetPrstDash() ? ln.getPrstDash() : ln.addNewPrstDash(); |
| ldp.setVal(STPresetLineDashVal.Enum.forInt(dash.ooxmlId)); |
| } |
| } |
| |
| /** |
| * @return a preset line dashing scheme to stroke the shape outline |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public LineDash getLineDash() { |
| |
| PropertyFetcher<LineDash> fetcher = new PropertyFetcher<LineDash>() { |
| @Override |
| public boolean fetch(XSLFShape shape) { |
| CTLineProperties ln = getLn(shape, false); |
| if (ln == null || !ln.isSetPrstDash()) { |
| return false; |
| } |
| |
| setValue(LineDash.fromOoxmlId(ln.getPrstDash().getVal().intValue())); |
| return true; |
| } |
| }; |
| fetchShapeProperty(fetcher); |
| |
| LineDash dash = fetcher.getValue(); |
| if (dash == null) { |
| CTLineProperties defaultLn = getDefaultLineProperties(); |
| if (defaultLn != null && defaultLn.isSetPrstDash()) { |
| dash = LineDash.fromOoxmlId(defaultLn.getPrstDash().getVal().intValue()); |
| } |
| } |
| return dash; |
| } |
| |
| /** |
| * |
| * @param cap the line end cap style |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineCap(LineCap cap) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| |
| if (cap == null) { |
| if (ln.isSetCap()) { |
| ln.unsetCap(); |
| } |
| } else { |
| ln.setCap(STLineCap.Enum.forInt(cap.ooxmlId)); |
| } |
| } |
| |
| /** |
| * |
| * @return the line end cap style |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public LineCap getLineCap() { |
| PropertyFetcher<LineCap> fetcher = new PropertyFetcher<LineCap>() { |
| @Override |
| public boolean fetch(XSLFShape shape) { |
| CTLineProperties ln = getLn(shape, false); |
| if (ln != null && ln.isSetCap()) { |
| setValue(LineCap.fromOoxmlId(ln.getCap().intValue())); |
| return true; |
| } |
| return false; |
| } |
| }; |
| fetchShapeProperty(fetcher); |
| |
| LineCap cap = fetcher.getValue(); |
| if (cap == null) { |
| CTLineProperties defaultLn = getDefaultLineProperties(); |
| if (defaultLn != null && defaultLn.isSetCap()) { |
| cap = LineCap.fromOoxmlId(defaultLn.getCap().intValue()); |
| } |
| } |
| return cap; |
| } |
| |
| @Override |
| public void setFillColor(Color color) { |
| XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties()); |
| if (fp == null) { |
| return; |
| } |
| if (color == null) { |
| if (fp.isSetSolidFill()) { |
| fp.unsetSolidFill(); |
| } |
| |
| if (fp.isSetGradFill()) { |
| fp.unsetGradFill(); |
| } |
| |
| if (fp.isSetPattFill()) { |
| fp.unsetGradFill(); |
| } |
| |
| if (fp.isSetBlipFill()) { |
| fp.unsetBlipFill(); |
| } |
| |
| if (!fp.isSetNoFill()) { |
| fp.addNewNoFill(); |
| } |
| } else { |
| if (fp.isSetNoFill()) { |
| fp.unsetNoFill(); |
| } |
| |
| CTSolidColorFillProperties fill = fp.isSetSolidFill() ? fp.getSolidFill() : fp.addNewSolidFill(); |
| |
| XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr(), getSheet()); |
| col.setColor(color); |
| } |
| } |
| |
| @Override |
| public Color getFillColor() { |
| PaintStyle ps = getFillPaint(); |
| if (ps instanceof SolidPaint) { |
| return DrawPaint.applyColorTransform(((SolidPaint)ps).getSolidColor()); |
| } |
| return null; |
| } |
| |
| /** |
| * @return shadow of this shape or null if shadow is disabled |
| */ |
| @Override |
| public XSLFShadow getShadow() { |
| PropertyFetcher<CTOuterShadowEffect> fetcher = new PropertyFetcher<CTOuterShadowEffect>() { |
| @Override |
| public boolean fetch(XSLFShape shape) { |
| XSLFEffectProperties ep = XSLFPropertiesDelegate.getEffectDelegate(shape.getShapeProperties()); |
| if (ep != null && ep.isSetEffectLst()) { |
| CTOuterShadowEffect obj = ep.getEffectLst().getOuterShdw(); |
| setValue(obj == null ? NO_SHADOW : obj); |
| return true; |
| } |
| return false; |
| } |
| }; |
| fetchShapeProperty(fetcher); |
| |
| CTOuterShadowEffect obj = fetcher.getValue(); |
| if (obj == null) { |
| // fill color was not found, check if it is defined in the theme |
| CTShapeStyle style = getSpStyle(); |
| if (style != null && style.getEffectRef() != null) { |
| // 1-based index of a shadow style within the style matrix |
| int idx = (int) style.getEffectRef().getIdx(); |
| if(idx != 0) { |
| CTStyleMatrix styleMatrix = getSheet().getTheme().getXmlObject().getThemeElements().getFmtScheme(); |
| CTEffectStyleItem ef = styleMatrix.getEffectStyleLst().getEffectStyleArray(idx - 1); |
| obj = ef.getEffectLst().getOuterShdw(); |
| } |
| } |
| } |
| return (obj == null || obj == NO_SHADOW) ? null : new XSLFShadow(obj, this); |
| } |
| |
| /** |
| * @return definition of the shape geometry |
| */ |
| @Override |
| public CustomGeometry getGeometry() { |
| XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); |
| |
| if (gp == null) { |
| return null; |
| } |
| |
| CustomGeometry geom; |
| PresetGeometries dict = PresetGeometries.getInstance(); |
| if(gp.isSetPrstGeom()){ |
| String name = gp.getPrstGeom().getPrst().toString(); |
| geom = dict.get(name); |
| if(geom == null) { |
| throw new IllegalStateException("Unknown shape geometry: " + name + ", available geometries are: " + dict.keySet()); |
| } |
| } else if (gp.isSetCustGeom()){ |
| XMLStreamReader staxReader = gp.getCustGeom().newXMLStreamReader(); |
| geom = PresetGeometries.convertCustomGeometry(staxReader); |
| try { |
| staxReader.close(); |
| } |
| catch (XMLStreamException e) { |
| LOG.log(POILogger.WARN, |
| "An error occurred while closing a Custom Geometry XML Stream Reader: " + e.getMessage()); |
| } |
| } else { |
| geom = dict.get("rect"); |
| } |
| return geom; |
| } |
| |
| @Override |
| void copy(XSLFShape sh){ |
| super.copy(sh); |
| |
| XSLFSimpleShape s = (XSLFSimpleShape)sh; |
| |
| Color srsSolidFill = s.getFillColor(); |
| Color tgtSoliFill = getFillColor(); |
| if(srsSolidFill != null && !srsSolidFill.equals(tgtSoliFill)){ |
| setFillColor(srsSolidFill); |
| } |
| |
| XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties()); |
| if(fp != null && fp.isSetBlipFill()){ |
| CTBlip blip = fp.getBlipFill().getBlip(); |
| String blipId = blip.getEmbed(); |
| |
| String relId = getSheet().importBlip(blipId, s.getSheet()); |
| blip.setEmbed(relId); |
| } |
| |
| Color srcLineColor = s.getLineColor(); |
| Color tgtLineColor = getLineColor(); |
| if(srcLineColor != null && !srcLineColor.equals(tgtLineColor)) { |
| setLineColor(srcLineColor); |
| } |
| |
| double srcLineWidth = s.getLineWidth(); |
| double tgtLineWidth = getLineWidth(); |
| if(srcLineWidth != tgtLineWidth) { |
| setLineWidth(srcLineWidth); |
| } |
| |
| LineDash srcLineDash = s.getLineDash(); |
| LineDash tgtLineDash = getLineDash(); |
| if(srcLineDash != null && srcLineDash != tgtLineDash) { |
| setLineDash(srcLineDash); |
| } |
| |
| LineCap srcLineCap = s.getLineCap(); |
| LineCap tgtLineCap = getLineCap(); |
| if(srcLineCap != null && srcLineCap != tgtLineCap) { |
| setLineCap(srcLineCap); |
| } |
| |
| } |
| |
| /** |
| * Specifies the line end decoration, such as a triangle or arrowhead. |
| * |
| * @param style the line end docoration style |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineHeadDecoration(DecorationShape style) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); |
| if (style == null) { |
| if (lnEnd.isSetType()) { |
| lnEnd.unsetType(); |
| } |
| } else { |
| lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId)); |
| } |
| } |
| |
| /** |
| * @return the line end decoration shape |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public DecorationShape getLineHeadDecoration() { |
| CTLineProperties ln = getLn(this, false); |
| DecorationShape ds = DecorationShape.NONE; |
| if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetType()) { |
| ds = DecorationShape.fromOoxmlId(ln.getHeadEnd().getType().intValue()); |
| } |
| return ds; |
| } |
| |
| /** |
| * specifies decoration width of the head of a line. |
| * |
| * @param style the decoration width |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineHeadWidth(DecorationSize style) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); |
| if (style == null) { |
| if (lnEnd.isSetW()) { |
| lnEnd.unsetW(); |
| } |
| } else { |
| lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId)); |
| } |
| } |
| |
| /** |
| * @return the line end decoration width |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public DecorationSize getLineHeadWidth() { |
| CTLineProperties ln = getLn(this, false); |
| DecorationSize ds = DecorationSize.MEDIUM; |
| if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetW()) { |
| ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getW().intValue()); |
| } |
| return ds; |
| } |
| |
| /** |
| * Specifies the line end width in relation to the line width. |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineHeadLength(DecorationSize style) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| |
| CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); |
| if (style == null) { |
| if (lnEnd.isSetLen()) { |
| lnEnd.unsetLen(); |
| } |
| } else { |
| lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId)); |
| } |
| } |
| |
| /** |
| * @return the line end decoration length |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public DecorationSize getLineHeadLength() { |
| CTLineProperties ln = getLn(this, false); |
| |
| DecorationSize ds = DecorationSize.MEDIUM; |
| if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetLen()) { |
| ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getLen().intValue()); |
| } |
| return ds; |
| } |
| |
| /** |
| * Specifies the line end decoration, such as a triangle or arrowhead. |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineTailDecoration(DecorationShape style) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| |
| CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); |
| if (style == null) { |
| if (lnEnd.isSetType()) { |
| lnEnd.unsetType(); |
| } |
| } else { |
| lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId)); |
| } |
| } |
| |
| /** |
| * @return the line end decoration shape |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public DecorationShape getLineTailDecoration() { |
| CTLineProperties ln = getLn(this, false); |
| |
| DecorationShape ds = DecorationShape.NONE; |
| if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetType()) { |
| ds = DecorationShape.fromOoxmlId(ln.getTailEnd().getType().intValue()); |
| } |
| return ds; |
| } |
| |
| /** |
| * specifies decorations which can be added to the tail of a line. |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineTailWidth(DecorationSize style) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| |
| CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); |
| if (style == null) { |
| if (lnEnd.isSetW()) { |
| lnEnd.unsetW(); |
| } |
| } else { |
| lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId)); |
| } |
| } |
| |
| /** |
| * @return the line end decoration width |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public DecorationSize getLineTailWidth() { |
| CTLineProperties ln = getLn(this, false); |
| DecorationSize ds = DecorationSize.MEDIUM; |
| if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetW()) { |
| ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getW().intValue()); |
| } |
| return ds; |
| } |
| |
| /** |
| * Specifies the line end width in relation to the line width. |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public void setLineTailLength(DecorationSize style) { |
| CTLineProperties ln = getLn(this, true); |
| if (ln == null) { |
| return; |
| } |
| |
| CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); |
| if (style == null) { |
| if (lnEnd.isSetLen()) { |
| lnEnd.unsetLen(); |
| } |
| } else { |
| lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId)); |
| } |
| } |
| |
| /** |
| * @return the line end decoration length |
| */ |
| @SuppressWarnings("WeakerAccess") |
| public DecorationSize getLineTailLength() { |
| CTLineProperties ln = getLn(this, false); |
| |
| DecorationSize ds = DecorationSize.MEDIUM; |
| if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetLen()) { |
| ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getLen().intValue()); |
| } |
| return ds; |
| } |
| |
| @Override |
| public Guide getAdjustValue(String name) { |
| XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); |
| |
| if (gp != null && gp.isSetPrstGeom() && gp.getPrstGeom().isSetAvLst()) { |
| for (CTGeomGuide g : gp.getPrstGeom().getAvLst().getGdArray()) { |
| if (g.getName().equals(name)) { |
| Guide gd = new Guide(); |
| gd.setName(g.getName()); |
| gd.setFmla(g.getFmla()); |
| return gd; |
| } |
| } |
| } |
| |
| return null; |
| } |
| |
| @Override |
| public LineDecoration getLineDecoration() { |
| return new LineDecoration() { |
| @Override |
| public DecorationShape getHeadShape() { |
| return getLineHeadDecoration(); |
| } |
| |
| @Override |
| public DecorationSize getHeadWidth() { |
| return getLineHeadWidth(); |
| } |
| |
| @Override |
| public DecorationSize getHeadLength() { |
| return getLineHeadLength(); |
| } |
| |
| @Override |
| public DecorationShape getTailShape() { |
| return getLineTailDecoration(); |
| } |
| |
| @Override |
| public DecorationSize getTailWidth() { |
| return getLineTailWidth(); |
| } |
| |
| @Override |
| public DecorationSize getTailLength() { |
| return getLineTailLength(); |
| } |
| }; |
| } |
| |
| /** |
| * fetch shape fill as a java.awt.Paint |
| * |
| * @return either Color or GradientPaint or TexturePaint or null |
| */ |
| @Override |
| public FillStyle getFillStyle() { |
| return XSLFSimpleShape.this::getFillPaint; |
| } |
| |
| @Override |
| public StrokeStyle getStrokeStyle() { |
| return new StrokeStyle() { |
| @Override |
| public PaintStyle getPaint() { |
| return XSLFSimpleShape.this.getLinePaint(); |
| } |
| |
| @Override |
| public LineCap getLineCap() { |
| return XSLFSimpleShape.this.getLineCap(); |
| } |
| |
| @Override |
| public LineDash getLineDash() { |
| return XSLFSimpleShape.this.getLineDash(); |
| } |
| |
| @Override |
| public double getLineWidth() { |
| return XSLFSimpleShape.this.getLineWidth(); |
| } |
| |
| @Override |
| public LineCompound getLineCompound() { |
| return XSLFSimpleShape.this.getLineCompound(); |
| } |
| |
| }; |
| } |
| |
| @Override |
| public void setStrokeStyle(Object... styles) { |
| if (styles.length == 0) { |
| // remove stroke |
| setLineColor(null); |
| return; |
| } |
| |
| // TODO: handle PaintStyle |
| for (Object st : styles) { |
| if (st instanceof Number) { |
| setLineWidth(((Number)st).doubleValue()); |
| } else if (st instanceof LineCap) { |
| setLineCap((LineCap)st); |
| } else if (st instanceof LineDash) { |
| setLineDash((LineDash)st); |
| } else if (st instanceof LineCompound) { |
| setLineCompound((LineCompound)st); |
| } else if (st instanceof Color) { |
| setLineColor((Color)st); |
| } |
| } |
| } |
| |
| @Override |
| public XSLFHyperlink getHyperlink() { |
| CTNonVisualDrawingProps cNvPr = getCNvPr(); |
| if (!cNvPr.isSetHlinkClick()) { |
| return null; |
| } |
| return new XSLFHyperlink(cNvPr.getHlinkClick(), getSheet()); |
| } |
| |
| @Override |
| public XSLFHyperlink createHyperlink() { |
| XSLFHyperlink hl = getHyperlink(); |
| if (hl == null) { |
| CTNonVisualDrawingProps cNvPr = getCNvPr(); |
| hl = new XSLFHyperlink(cNvPr.addNewHlinkClick(), getSheet()); |
| } |
| return hl; |
| } |
| |
| private static CTLineProperties getLn(XSLFShape shape, boolean create) { |
| XmlObject pr = shape.getShapeProperties(); |
| if (!(pr instanceof CTShapeProperties)) { |
| LOG.log(POILogger.WARN, shape.getClass() +" doesn't have line properties"); |
| return null; |
| } |
| |
| CTShapeProperties spr = (CTShapeProperties)pr; |
| return (spr.isSetLn() || !create) ? spr.getLn() : spr.addNewLn(); |
| } |
| } |